Drug
D0001 | Fluorouracil
L
L01BC52 Fluorouracil, combinations
[L01BC] Pyrimidine analogues
[L01B] ANTIMETABOLITES
[L01] ANTINEOPLASTIC AGENTS
[L] Antineoplastic and immunomodulating agents
L01BC02 Fluorouracil
[L01BC] Pyrimidine analogues
[L01B] ANTIMETABOLITES
[L01] ANTINEOPLASTIC AGENTS
[L] Antineoplastic and immunomodulating agents
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
   |
Danger |
Aggregated GHS information provided by 166 companies from 15 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 55 of 166 companies. For more detailed information, please visit ECHA C&L website Of the 14 notification(s) provided by 111 of 166 companies with hazard statement code(s): H301 (98.2%): Toxic if swallowed [Danger Acute toxicity, oral] H312 (53.15%): Harmful in contact with skin [Warning Acute toxicity, dermal] H315 (55.86%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (55.86%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (54.05%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H340 (54.95%): May cause genetic defects [Danger Germ cell mutagenicity] H360 (58.56%): May damage fertility or the unborn child [Danger Reproductive toxicity] H412 (36.04%): Harmful to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P261, P264, P270, P271, P273, P280, P281, P301+P310, P302+P352, P304+P340, P305+P351+P338, P308+P313, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H341: Suspected of causing genetic defects [Warning Germ cell mutagenicity] H360: May damage fertility or the unborn child [Danger Reproductive toxicity] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] |
P201, P202, P260, P264, P270, P281, P301+P310, P308+P313, P314, P321, P330, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| mouse | LD50 | oral | 115mg/kg (115mg/kg) | Journal of Medicinal Chemistry. Vol. 21, Pg. 738, 1978. | |
| dog | LD50 | oral | 30mg/kg (30mg/kg) | gastrointestinal: nausea or vomiting | Oyo Yakuri. Pharmacometrics. Vol. 16, Pg. 303, 1978. |
| mouse | LD50 | subcutaneous | 169mg/kg (169mg/kg) | Iyakuhin Kenkyu. Study of Medical Supplies. Vol. 4, Pg. 90, 1973. | |
| hamster | LD10 | parenteral | 140mg/kg (140mg/kg) | Journal of Surgical Oncology. Vol. 15, Pg. 355, 1980. | |
| rat | LD50 | subcutaneous | 217mg/kg (217mg/kg) | Iyakuhin Kenkyu. Study of Medical Supplies. Vol. 4, Pg. 90, 1973. | |
| guinea pig | LD50 | intravenous | 25mg/kg (25mg/kg) | vascular: bp elevation not characterized in autonomic section | Japanese Journal of Pharmacology. Vol. 30, Pg. 871, 1980. |
| mouse | LD50 | intraperitoneal | 100mg/kg (100mg/kg) | Eksperimental'naya i Klinicheskaya Farmakoterapiya. Vol. 7, Pg. 100, 1977. | |
| rat | LD50 | intramuscular | 240mg/kg (240mg/kg) | K'at'ollik Taehak Uihakpu Nonmunjip. Journal of Catholic Medical College. Vol. 38, Pg. 481, 1985. | |
| rat | LD50 | intravenous | 245mg/kg (245mg/kg) | Oyo Yakuri. Pharmacometrics. Vol. 5, Pg. 569, 1971. | |
| mouse | LD50 | intravenous | 81mg/kg (81mg/kg) | Iyakuhin Kenkyu. Study of Medical Supplies. Vol. 4, Pg. 90, 1973. | |
| rabbit | LD50 | oral | 18900ug/kg (18.9mg/kg) | Kiso to Rinsho. Clinical Report. Vol. 8, Pg. 2603, 1974. | |
| rat | LD50 | oral | 230mg/kg (230mg/kg) | Iyakuhin Kenkyu. Study of Medical Supplies. Vol. 4, Pg. 90, 1973. | |
| women | TDLo | intravenous | 150mg/kg/17W- (150mg/kg) | blood: other hemolysis with or without anemia | British Journal of Haematology. Vol. 65, Pg. 357, 1987. |
| rabbit | LDLo | intravenous | 15mg/kg (15mg/kg) | vascular: bp elevation not characterized in autonomic section | Japanese Journal of Pharmacology. Vol. 30, Pg. 871, 1980. |
| rat | LD50 | parenteral | 500mg/kg (500mg/kg) | Recent Results in Cancer Research. Vol. 52, Pg. 76, 1975. | |
| rat | LD50 | rectal | 884mg/kg (884mg/kg) | Kiso to Rinsho. Clinical Report. Vol. 12, Pg. 1309, 1978. | |
| mouse | LD50 | unreported | 171mg/kg (171mg/kg) | Cancer Research. Vol. 46, Pg. 2703, 1986. | |
| women | TDLo | intravenous | 27mg/kg/4D-C (27mg/kg) | cardiac: other changes | British Medical Journal. Vol. 294, Pg. 125, 1987. |
| mouse | LD50 | intracrebral | 41600ug/kg (41.6mg/kg) | Chemotherapy Vol. 15, Pg. 519, 1967. | |
| human | TDLo | intravenous | 6mg/kg/3D (6mg/kg) | British Medical Journal. Vol. 1, Pg. 547, 1978. | |
| human | TDLo | oral | 450mg/kg/30D (450mg/kg) | Cancer Vol. 39, Pg. 1936, 1977. | |
| man | TDLo | intravenous | 39mg/kg/1D-I (39mg/kg) | cardiac: changes in coronary arteries | American Heart Journal. Vol. 114, Pg. 433, 1987. |
| man | TDLo | intravenous | 122mg/kg/9W-I (122mg/kg) | skin and appendages (skin): "dermatitis, other: after systemic exposure" | Australian and New Zealand Journal of Medicine. Vol. 22, Pg. 385, 1992. |
| mouse | LDLo | intratracheal | 200mg/kg (200mg/kg) | Toxicology Letters. Vol. 30, Pg. 63, 1986. | |
| rat | LD50 | intraperitoneal | 70mg/kg (70mg/kg) | Oyo Yakuri. Pharmacometrics. Vol. 5, Pg. 569, 1971. | |
| (5-fluorouracil)5-Fluoro-1H-pyrimidine-2,4-dione | 1-fluoro-1h-pyrimidine-2,4-dione | 191047-65-1 |
| 1upf | 2,3H)-Pyrimidinedione, 5-fluoro- | 2,4(1H,3H)-Pyrimidinedione, 5-fluoro- |
| 2,4-Dihydroxy-5-fluoropyrimidine | 2,4-Dihydroxy-5-fluoropyrimidine | 2,4-Dioxo-5-fluoropryimidine |
| 2,4-Dioxo-5-fluoropyrimidine | 2,4-Pyrimidinedione, 5-fluoro- | 2794-13-0 |
| 29507-EP2270008A1 | 29507-EP2270505A1 | 29507-EP2272827A1 |
| 29507-EP2289892A1 | 29507-EP2292234A1 | 29507-EP2292617A1 |
| 29507-EP2295426A1 | 29507-EP2295427A1 | 29507-EP2298305A1 |
| 29507-EP2308861A1 | 29507-EP2311842A2 | 42164-EP2272827A1 |
| 42164-EP2275420A1 | 42164-EP2277565A2 | 42164-EP2277566A2 |
| 42164-EP2277567A1 | 42164-EP2277568A2 | 42164-EP2277569A2 |
| 42164-EP2277570A2 | 42164-EP2277876A1 | 42164-EP2292280A1 |
| 42164-EP2292614A1 | 42164-EP2295412A1 | 42164-EP2295413A1 |
| 42164-EP2295416A2 | 42164-EP2298748A2 | 42164-EP2298764A1 |
| 42164-EP2298765A1 | 42164-EP2298778A1 | 42164-EP2305642A2 |
| 42164-EP2308833A2 | 42164-EP2311808A1 | 42164-EP2311829A1 |
| 42164-EP2311840A1 | 4CA-0544 | 5 Fluorouracil |
| 5-FU | 5-FU | 5-FU (TN) |
| 5-Faracil | 5-Fluor-2,4(1H,3H)-pyrimidindion | 5-Fluor-2,4(1H,3H)-pyrimidindion [Czech] |
| 5-Fluor-2,4-dihydroxypyrimidin | 5-Fluor-2,4-dihydroxypyrimidin [Czech] | 5-Fluor-2,4-pyrimidindiol |
| 5-Fluor-2,4-pyrimidindiol [Czech] | 5-Fluoracil | 5-Fluoracil [German] |
| 5-Fluoracyl | 5-Fluoro-1H-pyrimidine-2,4-dione (5-FU) | 5-Fluoro-1H-pyrimidine-2,4-dione (5-Fluorouracil) |
| 5-Fluoro-1H-pyrimidine-2,4-dione(5-FU) | 5-Fluoro-1H-pyrimidine-2,4-dione(5-FUra) | 5-Fluoro-1H-pyrimidine-2,4-dione(5-fluoro uracil) |
| 5-Fluoro-1H-pyrimidine-2,4-dione(5-fluorouracil)(5-FU) | 5-Fluoro-1H-pyrimidine-2,4-dione(5FU) | 5-Fluoro-2,3H)-pyrimidinedione |
| 5-Fluoro-2,4(1H,3H)-pyrimidinedione | 5-Fluoro-2,4(1H,3H)-pyrimidinedione | 5-Fluoro-2,4-(1H,3H)-pyrimidinedione |
| 5-Fluoro-2,4-pyrimidinedione | 5-Fluoropyrimidin-2,4-diol | 5-Fluoropyrimidine-2,4-dione |
| 5-Fluorouracil | 5-Fluorouracil, 99% | 5-Fluorouracil, >=99% (HPLC), powder |
| 5-Fluorouracil, Vetec(TM) reagent grade, >=99% | 5-Fluorouracil, analytical standard | 5-Fluorouracil, certified reference material, TraceCERT(R) |
| 5-Fluoruracil | 5-Fluoruracil [German] | 5-Fluracil |
| 5-Ftouracyl | 5-florouracil | 5-fluoro uracil |
| 5-fluoro-1,2,3,4-tetrahydropyrimidine-2,4-dione | 5-fluoro-1,3-dihydropyrimidine-2,4-dione | 5-fluoro-1H-pyrimidine-2,4-dione |
| 5-fluoro-2,4-Pyrimidinediol | 5-fluoro-2,4-dioxo-pyrimidin | 5-fluoro-pyrimidine-2,4-diol |
| 5-fluoro-uracil | 5-fluoropyrimidine-2,4(1H,3H)-dione | 5-fluoropyrimidine-2,4-diol |
| 5-fluorouacil | 5-fluorourasil | 5-fluorpyrimidin-2,4-diol |
| 51-21-8 | 51F218 | 5F-uracil |
| 5FU | 7375-EP2269989A1 | 7375-EP2269994A1 |
| 7375-EP2270008A1 | 7375-EP2270018A1 | 7375-EP2272827A1 |
| 7375-EP2272832A1 | 7375-EP2275102A1 | 7375-EP2275412A1 |
| 7375-EP2275413A1 | 7375-EP2277876A1 | 7375-EP2280012A2 |
| 7375-EP2281563A1 | 7375-EP2281815A1 | 7375-EP2287156A1 |
| 7375-EP2289892A1 | 7375-EP2292233A2 | 7375-EP2292614A1 |
| 7375-EP2292615A1 | 7375-EP2292617A1 | 7375-EP2295416A2 |
| 7375-EP2295426A1 | 7375-EP2295427A1 | 7375-EP2298748A2 |
| 7375-EP2298768A1 | 7375-EP2298772A1 | 7375-EP2298780A1 |
| 7375-EP2301928A1 | 7375-EP2301933A1 | 7375-EP2305219A1 |
| 7375-EP2305243A1 | 7375-EP2305640A2 | 7375-EP2305642A2 |
| 7375-EP2305671A1 | 7375-EP2305689A1 | 7375-EP2308833A2 |
| 7375-EP2308839A1 | 7375-EP2308855A1 | 7375-EP2308861A1 |
| 7375-EP2311807A1 | 7375-EP2311808A1 | 7375-EP2311825A1 |
| 7375-EP2311827A1 | 7375-EP2311829A1 | 7375-EP2311840A1 |
| 7375-EP2314590A1 | 7375-EP2316459A1 | 7375-EP2316831A1 |
| 7375-EP2316834A1 | 7375-EP2316974A1 | 7375-EP2374454A1 |
| 766-63-2 | AB1000177 | AC-11201 |
| ACMC-1ATRK | AI3-25297 | AK-46307 |
| AKOS000119162 | AKOS003237897 | AKOS008044307 |
| AM20100252 | ANW-31214 | Adrucil |
| Adrucil (Fluorouracil) | Adrucil (ICN) | Adrucil (TN) |
| Adrucil(Fluorouracil) | Arumel | BBL009635 |
| BCP02083 | BCP9000239 | BCPP000428 |
| BDBM50340677 | BRD-K24844714-001-02-1 | BSPBio_002048 |
| C07649 | C4H3FN2O2 | CAS-51-21-8 |
| CCG-39879 | CCRIS 2582 | CF0033 |
| CHEBI:46345 | CHEMBL185 | CPD000038082 |
| CS-0993 | CTK1H0569 | CTK8H4220 |
| Carac | Carac (TN) | Carzonal |
| Certified Reference Material | Cinco FU | D00584 |
| DB-051923 | DB-065735 | DB00544 |
| DL-399 | DSSTox_CID_634 | DSSTox_GSID_20634 |
| DSSTox_RID_75705 | DTXSID2020634 | DivK1c_000054 |
| EC 200-085-6 | EINECS 200-085-6 | EU-0100536 |
| Effluderm | Effluderm (free base) | Efudex |
| Efudix | Efurix | F 6627 |
| F0151 | FT-0082524 | FT-0601511 |
| FT-0707652 | FU | Fluoro Uracil |
| Fluoro-uracile | Fluoro-uracilo | Fluoroblastin |
| Fluoroplex | Fluoroplex (TN) | Fluorouracil (5-Fluoracil, 5-FU) |
| Fluorouracil (Adrucil) | Fluorouracil (JP17/USP/INN) | Fluorouracil - Adrucil |
| Fluorouracil Cream | Fluorouracil [USAN:INN:BAN:JAN] | Fluorouracil [USAN:USP:INN:BAN:JAN] |
| Fluorouracil, 5- | Fluorouracil, British Pharmacopoeia (BP) Reference Standard | Fluorouracil, European Pharmacopoeia (EP) Reference Standard |
| Fluorouracil, Pharmaceutical Secondary Standard | Fluorouracil, United States Pharmacopeia (USP) Reference Standard | Fluorouracil, meets USP testing specifications |
| Fluorouracile | Fluorouracile [DCIT] | Fluorouracilo |
| Fluorouracilo [INN-Spanish] | Fluorouracilum | Fluorouracilum [INN-Latin] |
| Fluouracil | Fluracil | Fluracilum |
| Fluri | Fluril | Fluro Uracil |
| Fluroblastin | Ftoruracil | GHASVSINZRGABV-UHFFFAOYSA-N |
| GTPL4789 | HMS1920O18 | HMS2090I04 |
| HMS2091F19 | HMS3259O03 | HMS3261L13 |
| HMS3654K22 | HMS3715H03 | HMS500C16 |
| HSDB 3228 | HY-90006 | IDI1_000054 |
| InChI=1/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9 | KBio1_000054 | KBio2_001321 |
| KBio2_003889 | KBio2_006457 | KBio3_001268 |
| KBioGR_001253 | KBioSS_001321 | KS-00000DY3 |
| KS-5129 | KSC270K6T | Kecimeton |
| LP00536 | LS-153 | LS40596 |
| Lopac-F-6627 | Lopac0_000536 | MCULE-6338086431 |
| MFCD00006018 | MLS000069498 | MLS002415705 |
| NC00454 | NCGC00015442-01 | NCGC00015442-02 |
| NCGC00015442-03 | NCGC00015442-04 | NCGC00015442-05 |
| NCGC00015442-06 | NCGC00015442-07 | NCGC00015442-08 |
| NCGC00015442-09 | NCGC00015442-10 | NCGC00015442-11 |
| NCGC00015442-12 | NCGC00015442-15 | NCGC00015442-16 |
| NCGC00091349-01 | NCGC00091349-02 | NCGC00091349-03 |
| NCGC00091349-04 | NCGC00091349-05 | NCGC00091349-07 |
| NCGC00091349-08 | NCGC00254023-01 | NCGC00259884-01 |
| NCGC00261221-01 | NCI60_001652 | NINDS_000054 |
| NSC 19893 | NSC-19893 | NSC-757036 |
| NSC19893 | NSC757036 | Opera_ID_134 |
| Pharmakon1600-01500305 | Phthoruracil | Phtoruracil |
| Q238512 | Queroplex | RW2456 |
| Ro 2-9757 | Ro-2-9757 | Ro-29757 |
| SAM002264615 | SBB085751 | SBI-0050519.P004 |
| SC-09038 | SCHEMBL3646 | SMR000038082 |
| SPBio_000291 | SPECTRUM1500305 | SR-01000075881 |
| SR-01000075881-1 | SR-01000075881-3 | SR-01000075881-5 |
| SRI-10792-04 | SRI-10792-05 | SRI-10792-06 |
| SRI-10792_07 | SRI-10792_08 | ST45025877 |
| STK297802 | STL367375 | SW199617-3 |
| Spectrum2_000076 | Spectrum3_000434 | Spectrum4_000557 |
| Spectrum5_000718 | Spectrum_000841 | Timazin |
| Tolak | Tox21_110150 | Tox21_110150_1 |
| Tox21_202335 | Tox21_300112 | Tox21_500536 |
| U 8953 | U-8953 | U3P01618RT |
| UNII-U3P01618RT | UPCMLD-DP130 | UPCMLD-DP130:001 |
| URF | Ulup | Uracil, 5-fluoro- |
| W-202929 | W-5036 | W-60379 |
| WLN: T6MVMVJ EF | Z275128052 | ZINC38212689 |
| fluorouracil | inhibits thymilidate synthetase | pyrimidine antimetabolite: inhibits nucleic acid replication |
| s1209 | tetratogen |
| DrugBank Name | Fluorouracil |
| DrugBank | DB00544 |
| CAS Number | 1004-03-1, 191047-64-0, 191047-65-1, 191115-88-5, 51-21-8, 68941-95-7, 790299-79-5, 90344-84-6 |
| PubChem Compound | 3385 |
| KEGG Compound ID | C07649 |
| KEGG Drug | D00584 |
| PubChem.Substance | 46508557 |
| ChEBI | 46345 |
| PharmGKB | PA128406956 |
| ChemSpider | 3268 |
| BindingDB | 50340677.0 |
| TTD | DAP000829 |
| Wikipedia | Fluorouracil |
| HET | URF |
| DPD | 6311 |
1. Ya?ez et al., 2003