D0160 | fluoranthene
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| BASAL RESPIRATION | 100 µg/l | zebrafish | XFe24 Extracellular Flux Analyzer | decrease | 85 | |||
| MAXIMAL RESPIRATION | 100 µg/l | zebrafish | XFe24 Extracellular Flux Analyzer | decrease | 85 | |||
| ATP TURNOVER | 100 µg/l | zebrafish | XFe24 Extracellular Flux Analyzer | decrease | 85 | |||
| PROTON LEAK | 100 µg/l | zebrafish | XFe24 Extracellular Flux Analyzer | increase | 85 | |||
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Warning |
Aggregated GHS information provided by 84 companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 1 of 84 companies. For more detailed information, please visit ECHA C&L website Of the 7 notification(s) provided by 83 of 84 companies with hazard statement code(s): H302 (97.59%): Harmful if swallowed [Warning Acute toxicity, oral] H400 (73.49%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410 (72.29%): Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P264, P270, P273, P301+P312, P330, P391, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P264, P270, P273, P301+P312, P330, P391, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P273, P391, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| 1,2 - (1,8 - napthalenediyl)benzene | 1,2-(1,8-Naphthalene)benzene | 1,2-(1,8-Naphthalenediyl)benzene |
| 1,2-(1,8-Naphthylene)benzene | 1,2-Benzacenaphthene | 1,8-Naphthylene)benzene |
| 1D41162B-880B-494F-9960-6EEAC8E4EEE3 | 206-44-0 | 360UOL779Z |
| 4CH-007323 | 76774-50-0 | A814763 |
| ACMC-1CBEU | AKOS003617663 | AS-39328 |
| Benzacenaphthylene | Benzene, 1,2-(1,8-naphthalenediyl)- | Benzene, 1,2-(1,8-naphthylene)- |
| Benzene,2-(1,8-naphthalenediyl)- | Benzene,2-(1,8-naphthylene)- | Benzo(jk)fluorene |
| Benzo[j,k]fluorene | Benzo[jk]fluorene | C-34897 |
| C19425 | CAS-206-44-0 | CC-28476 |
| CCG-50891 | CCRIS 1034 | CHEBI:33083 |
| CHEMBL355014 | CTK1A3432 | ClusterCarbon |
| DSSTox_CID_4104 | DSSTox_GSID_24104 | DSSTox_RID_77290 |
| DTXSID3024104 | EINECS 205-912-4 | EN300-177281 |
| F0016 | F0074-0087 | FLUORANTHENE |
| FT-0626446 | Fluoranthene 10 microg/mL in Acetonitrile | Fluoranthene 10 microg/mL in Cyclohexane |
| Fluoranthene 100 microg/mL in Acetonitrile | Fluoranthene solution, 5000 mug/mL in methanol, analytical standard | Fluoranthene solution, certified reference material, 200 mug/mL in methylene chloride |
| Fluoranthene, 98% | Fluoranthene, BCR(R) certified Reference Material | Fluoranthene, analytical standard |
| Fluoranthene, certified reference material, TraceCERT(R) | Fluoranthrene | Fluroanthene |
| GVEPBJHOBDJJJI-UHFFFAOYSA-N | HMS2268M14 | HSDB 5486 |
| Idryl | InChI=1/C16H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-10 | KS-00000V10 |
| KSC203I3F | LS-69112 | MCULE-8741992230 |
| MLS002177805 | NCGC00090998-01 | NCGC00090998-02 |
| NCGC00090998-03 | NCGC00090998-04 | NCGC00254498-01 |
| NCGC00259384-01 | NSC 6803 | NSC-6803 |
| NSC6803 | Q423462 | RCRA waste no. U120 |
| RCRA waste number U120 | RTR-009648 | SB 00542 |
| SC-47055 | SMR000112026 | SR-01000640231-1 |
| ST24030711 | STL570455 | TR-009648 |
| TRA0118487 | Tox21_201835 | Tox21_300480 |
| UNII-0TNN3Q0D4D component GVEPBJHOBDJJJI-UHFFFAOYSA-N | UNII-360UOL779Z | W-107604 |
| WLN: L C6566 1A PJ | ZINC8585874 |
| CAS Number | 206-44-0, 76774-50-0 |
| PubChem Compound | 9154 |
| KEGG Compound ID | C19425 |
| ChEBI | 33083 |
| ChemSpider | 8800 |
| Wikipedia | Fluoranthene |