| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
![]() |
Aggregated GHS information provided by 23 companies from 5 notifications to the ECHA C&L Inventory. Reported as not meeting GHS hazard criteria by 3 of 23 companies. For more detailed information, please visit ECHA C&L website Of the 4 notification(s) provided by 20 of 23 companies with hazard statement code(s): H411 (95%): Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P273, P391, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) | |
| (1,1'-Biphenyl)-2,2'-diyl oxide | 132-64-9 | 1IT |
| 2,2'-Biphenylene oxide | 2,2'-Biphenylylene oxide | 8-oxatricyclo[7.4.0.0(2),]trideca-1(9),2(7),3,5,10,12-hexaene |
| 8-oxatricyclo[7.4.0.0?,?]trideca-1(9),2(7),3,5,10,12-hexaene | 8-oxatricyclo[7.4.0.0^{2,7}]trideca-1(9),2(7),3,5,10,12-hexaene | 8U54U639VI |
| AC-19766 | ACMC-1BNIJ | AI3-00039 |
| AK112050 | AKOS000120971 | ANW-19449 |
| BDBM50408362 | C07729 | CAS-132-64-9 |
| CCRIS 1436 | CHEBI:28145 | CHEMBL277497 |
| CS-W017802 | D0147 | DB-042123 |
| DSSTox_CID_1993 | DSSTox_GSID_21993 | DSSTox_RID_76446 |
| DTXSID2021993 | Dibenzo(b,d)furan | Dibenzo[b,d]furan |
| Dibenzo[b,d]furan, BCR(R) certified Reference Material | Dibenzo[b]furan | Dibenzofuran, 98% |
| Dibenzofuran, analytical standard | Dibenzofurans | Dibenzol(b,d)furan |
| EBD29106 | EINECS 205-071-3 | FT-0624634 |
| HSDB 2163 | I961 | InChI=1/C12H8O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8 |
| Industry fluorene oxide | KS-0000016U | KSC154C7P |
| LS-757 | MCULE-9430669072 | MFCD00004968 |
| NCGC00164102-01 | NCGC00164102-02 | NCGC00164102-03 |
| NCGC00254221-01 | NCGC00259665-01 | NE10370 |
| NSC 1245 | NSC-1245 | NSC1245 |
| PS-5378 | PubChem7058 | Q-101160 |
| Q419513 | RTR-004456 | SBB060835 |
| SC-47120 | SCHEMBL8207 | ST24033149 |
| ST50824932 | STL185574 | TR-004456 |
| TRA0064754 | TXCDCPKCNAJMEE-UHFFFAOYSA-N | Tox21_202116 |
| Tox21_300052 | UNII-8U54U639VI | Z57127512 |
| ZINC3861058 | [1,1'-Biphenyl]-2,2'-diyl oxide | [1,2'-diyl oxide |
| bmse000548 | dibenzofuran | dibenzofurane |
| diphenylene oxide |
| CAS Number | 132-64-9 |
| PubChem Compound | 568 |
| KEGG Compound ID | C07729 |
| ChEBI | 28145 |
| ChemSpider | 551 |
| Wikipedia | Dibenzofuran |