D0174 | Dimethylnitrosamine
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
   |
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H330: Fatal if inhaled [Danger Acute toxicity, inhalation] H350: May cause cancer [Danger Carcinogenicity] H372 **: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H411: Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P260, P264, P270, P271, P273, P281, P284, P301+P310, P304+P340, P308+P313, P310, P314, P320, P321, P330, P391, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
Aggregated GHS information provided by 88 companies from 10 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H300 (17.05%): Fatal if swallowed [Danger Acute toxicity, oral] H301 (82.95%): Toxic if swallowed [Danger Acute toxicity, oral] H330 (100%): Fatal if inhaled [Danger Acute toxicity, inhalation] H350 (100%): May cause cancer [Danger Carcinogenicity] H372 (98.86%): Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H411 (100%): Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P260, P264, P270, P271, P273, P281, P284, P301+P310, P304+P340, P308+P313, P310, P314, P320, P321, P330, P391, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H330: Fatal if inhaled [Danger Acute toxicity, inhalation] H350: May cause cancer [Danger Carcinogenicity] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H411: Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P260, P264, P270, P271, P273, P281, P284, P301+P310, P304+P340, P308+P313, P310, P314, P320, P321, P330, P391, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
 |
Danger |
H227: Combustible liquid [Warning Flammable liquids] H300: Fatal if swallowed [Danger Acute toxicity, oral] H315: Causes skin irritation [Warning Skin corrosion/irritation] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] H330: Fatal if inhaled [Danger Acute toxicity, inhalation] H335: May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H340: May cause genetic defects [Danger Germ cell mutagenicity] H350: May cause cancer [Danger Carcinogenicity] H361: Suspected of damaging fertility or the unborn child [Warning Reproductive toxicity] H370: Causes damage to organs [Danger Specific target organ toxicity, single exposure] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] |
P201, P202, P210, P260, P261, P264, P270, P271, P280, P281, P284, P301+P310, P302+P352, P304+P340, P305+P351+P338, P307+P311, P308+P313, P310, P312, P314, P320, P321, P330, P332+P313, P337+P313, P362, P370+P378, P403+P233, P403+P235, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H227: Combustible liquid [Warning Flammable liquids] H300: Fatal if swallowed [Danger Acute toxicity, oral] H316: Causes mild skin irritation [Warning Skin corrosion/irritation] H320: Causes eye irritation [Warning Serious eye damage/eye irritation] H330: Fatal if inhaled [Danger Acute toxicity, inhalation] H335: May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H340: May cause genetic defects [Danger Germ cell mutagenicity] H350: May cause cancer [Danger Carcinogenicity] H361: Suspected of damaging fertility or the unborn child [Warning Reproductive toxicity] H370: Causes damage to organs [Danger Specific target organ toxicity, single exposure] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] |
P201, P202, P210, P260, P261, P264, P270, P271, P280, P281, P284, P301+P310, P304+P340, P305+P351+P338, P307+P311, P308+P313, P310, P312, P314, P320, P321, P330, P332+P313, P337+P313, P370+P378, P403+P233, P403+P235, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| (CH3)2NNO | 1,1-Dimethyl-2-oxohydrazine | 1,1-Dimethyl-2-oxohydrazine # |
| 62-75-9 | 6868AF | A833977 |
| AI3-25308 | AKOS016000499 | BDBM73982 |
| BIDD:ER0584 | BRN 1738979 | C14704 |
| CAS-62-75-9 | CCRIS 261 | CHEBI:35807 |
| CHEMBL117311 | CTK5B5914 | D0761 |
| DMN | DMNA | DSSTox_CID_1029 |
| DSSTox_GSID_21029 | DSSTox_RID_75914 | DTXSID7021029 |
| Dimethylamine, N-nitroso- | Dimethylnitrosamin | Dimethylnitrosamin (german) |
| Dimethylnitrosamin [German] | Dimethylnitrosamine | Dimethylnitrosoamine |
| EBD71417 | EINECS 200-549-8 | FT-0658538 |
| HSDB 1667 | InChI=1/C2H6N2O/c1-4(2)3-5/h1-2H | LS-1482 |
| M43H21IO8R | MCULE-1157726226 | MLS001065602 |
| Methamine, N-methyl-N-nitroso- | Methanamine, N-methyl-N-nitroso- | Methanamine,N-methyl-N-nitroso- |
| N Nitrosodimethylamine | N, N-Dimethylnitrosamine | N, N-dimethyl nitrous amide |
| N,N-Dimethylnitrosamine | N,N-dimethyl nitrous amide | N,N-dimethyl-nitrous amide |
| N,N-dimethylnitrous amide | N-Dimethyl-nitrosamine | N-Methyl-N-nitroso-Methamine |
| N-Methyl-N-nitrosomethanamine | N-Methyl-N-nitrosomethanamine, 9CI | N-N-Dimethyl N Nitrosoamine |
| N-NITROSODIMETHYLAMINE | N-Nitroaodimethylamine | N-Nitroso-N,N-dimethylamine |
| N-Nitroso-dimethylamine 10 microg/mL in Methanol | N-Nitroso-dimethylamine 100 microg/mL in Methanol | N-Nitrosodimethylamine (NDMA) |
| N-Nitrosodimethylamine (NDMA) 5000 microg/mL in Methanol | N-Nitrosodimethylamine 0.2 mg/ml in Methanol | N-Nitrosodimethylamine 1000 microg/mL in Dichloromethane |
| N-Nitrosodimethylamine, analytical standard | N-dimethylnitrosoamine | N-methyl-N-nitroso-methanamine |
| N-nitrosodimethylamine 1000 microg/mL in Methanol | N-nitrosodimethylamine 1000 microg/mL in Methanol, Second Source | NCGC00091431-01 |
| NCGC00091431-02 | NCGC00091431-03 | NCGC00256498-01 |
| NCGC00259212-01 | NDMA Nitrosodimethylamine | NSC 23226 |
| NSC-23226 | NSC23226 | Nitrosamine, dimethyl- |
| Nitrosodimethylamine | Nitrosodimethylamine, NDMA | Q409367 |
| RCRA waste no. P082 | RCRA waste number P082 | SMR000568479 |
| Tox21_201663 | Tox21_302873 | UMFJAHHVKNCGLG-UHFFFAOYSA-N |
| UNII-M43H21IO8R | WLN: ONN1&1 | ZINC4658628 |
| cid_6124 | dimethyl(nitroso)amine | dimethyl-nitrosamine |
| n-nitroso-dimethylamine | nitrous dimethylamide |
| CAS Number | 62-75-9 |
| PubChem Compound | 6124 |
| KEGG Compound ID | C14704 |
| ChEBI | 35807 |
| ChemSpider | 5894 |
| Wikipedia | N-Nitrosodimethylamine |