Compound
D0184 | xanthone
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| BASAL RESPIRATION | 20 µM | zebrafish | XFe24 Extracellular Flux Analyzer | decrease | 86 | |||
| MAXIMAL RESPIRATION | 20 µM | zebrafish | XFe24 Extracellular Flux Analyzer | decrease | 86 | |||
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Danger |
Aggregated GHS information provided by 40 companies from 2 notifications to the ECHA C&L Inventory. H301 (97.5%): Toxic if swallowed [Danger Acute toxicity, oral] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P264, P270, P301+P310, P321, P330, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| rat | LD | oral | > 500mg/kg (500mg/kg) | National Academy of Sciences, National Research Council, Chemical-Biological Coordination Center, Review. Vol. 5, Pg. 25, 1953. | |
| mouse | LD50 | intravenous | 180mg/kg (180mg/kg) | U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#01611, | |
| 9-Oxoxanthene | 9-Xanthenone | 9-Xanthone |
| 90-47-1 | 9749WEV0CA | 9H-Xanthen-9-one |
| 9H-Xanthene, 9-oxo- | A10993 | A843557 |
| AC-907/21098006 | ACMC-209r6d | AI3-00077 |
| AKOS001213782 | ANW-39491 | BCP21155 |
| BDBM50155411 | BSPBio_003388 | Benzophenone oxide |
| CAS-90-47-1 | CCG-38356 | CHEBI:37647 |
| CHEMBL186784 | CS-0007833 | CTK3I6784 |
| Caswell No. 905 | DSSTox_CID_1795 | DSSTox_GSID_21795 |
| DSSTox_RID_76331 | DTXSID6021795 | Dibenzo-.gamma.-pyrone |
| Dibenzo-gamma-pyrone | Diphenylene ketone oxide | E 6 |
| EINECS 201-997-7 | EPA Pesticide Chemical Code 086503 | F8889-9282 |
| FT-0645039 | Genicide | HMS3651G22 |
| HY-N0126 | InChI=1/C13H8O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8 | JNELGWHKGNBSMD-UHFFFAOYSA-N |
| KBio3_002891 | KS-00000UQW | KSC486O8J |
| LS-162426 | MCULE-8122570588 | MFCD00005060 |
| MLS002207109 | N-methyl-1-[5-({[(4-methylbenzyl)amino]carbonyl}amino)pyridin-2-yl]piperidine-4-carboxamide | NCGC00095484-01 |
| NCGC00095484-02 | NCGC00095484-03 | NCGC00255049-01 |
| NE10375 | NSC 14978 | NSC-14978 |
| NSC14978 | Q421789 | R895 |
| RTR-028437 | SBB069491 | SC-75486 |
| SCHEMBL41161 | SDCCGMLS-0066462.P001 | SMR000112239 |
| SPBio_000203 | SPECTRUM200523 | SR-05000002437 |
| SR-05000002437-1 | ST024714 | STK372481 |
| STR05546 | SW219800-1 | Spectrum2_000052 |
| Spectrum3_001884 | TR-028437 | TRA0014485 |
| Tox21_301151 | UNII-9749WEV0CA | W-100331 |
| WLN: T C666 BO IVJ | XANTHONE | Xanthen-9-one |
| Xanthene, 9-oxo- | Xanthenone | Xanthone (Genicide) |
| Xanthone, 97% | Xanthone, United States Pharmacopeia (USP) Reference Standard | ZINC3860823 |
| diphenyline ketone oxide | ghl.PD_Mitscher_leg0.1212 | s2372 |
| xanthene-9-one |