D0215 | Triphenyl Phosphite
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Warning |
H315: Causes skin irritation [Warning Skin corrosion/irritation] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P264, P273, P280, P302+P352, P305+P351+P338, P321, P332+P313, P337+P313, P362, P391, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
Aggregated GHS information provided by 1746 companies from 27 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H302 (48.51%): Harmful if swallowed [Warning Acute toxicity, oral] H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] H317 (44.56%): May cause an allergic skin reaction [Warning Sensitization, Skin] H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H400 (99.6%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410 (100%): Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P270, P272, P273, P280, P301+P312, P302+P352, P305+P351+P338, P321, P330, P332+P313, P333+P313, P337+P313, P362, P363, P391, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H315: Causes skin irritation [Warning Skin corrosion/irritation] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P264, P273, P280, P302+P352, P305+P351+P338, P321, P332+P313, P337+P313, P362, P391, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H312: Harmful in contact with skin [Warning Acute toxicity, dermal] H315: Causes skin irritation [Warning Skin corrosion/irritation] H320: Causes eye irritation [Warning Serious eye damage/eye irritation] |
P264, P270, P280, P301+P312, P302+P352, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| (PhO)3P | 101-02-0 | 9P45GRD24X |
| ACMC-2097tu | ADK Stab TPP | AI3-07866 |
| AKOS015902569 | ANW-14416 | Advance TPP |
| Advancetpp | BP-21353 | BRN 1079456 |
| C18H15O3P | CAS-101-02-0 | CCRIS 4890 |
| CHEMBL1875503 | DSSTox_CID_6252 | DSSTox_GSID_26252 |
| DSSTox_RID_78075 | DTXSID0026252 | Doverphos 10 |
| Doverphos 10-HR | EC 202-908-4 | EFED |
| EINECS 202-908-4 | F0001-0051 | FT-0689185 |
| HSDB 2571 | HVLLSGMXQDNUAL-UHFFFAOYSA-N | InChI=1/C18H15O3P/c1-4-10-16(11-5-1)19-22(20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18/h1-15 |
| JP 360 | KS-00000156 | KSC108A5P |
| LS-324 | Lankromark LE65 | M995 |
| MFCD00003032 | Mellite 310 | NCGC00091577-01 |
| NCGC00091577-02 | NCGC00091577-03 | NCGC00091577-04 |
| NCGC00254028-01 | NCGC00259583-01 | NCIOpen2_007800 |
| NE10254 | NSC 43789 | NSC-43789 |
| NSC-62219 | NSC43789 | NSC62219 |
| P 36 | P 36 (stabilizer) | P(OC6H5)3 |
| P(OPh)3 | Phenyl phosphite | Phenyl phosphite ((C6H5O)3P) |
| Phenyl phosphite ((C6H5O)3P) (6CI,7CI) | Phenyl phosphite, (PhO)3P | Phosclere T 36 |
| Phosphorous Acid Triphenyl Ester | Phosphorous acid triphenyl | Phosphorous acid, triphenyl ester |
| PubChem18696 | Q222290 | RTR-000300 |
| SC-22578 | SCHEMBL13289 | ST2414033 |
| Stabilizer P 36 | Sumilizer TPP-R | Sumilizer TTP-R |
| TP 1 (plasticizer) | TPP (VAN) | TPP (plasticizer) |
| TR-000300 | TRIPHENYL PHOSPHITE | Tox21_202034 |
| Tox21_300002 | Trifenoxyfosfin | Trifenoxyfosfin [Czech] |
| Trifenylfosfit | Trifenylfosfit [Czech] | Triphenoxyphosphine |
| Triphenyl phosphite, 97% | Triphenyl phosphite, 99% | Triphenyl phosphite, purum, >=97.0% (HPLC) |
| Tris(phenoxy)phosphine | UNII-9P45GRD24X | WLN: ROPOR & OR |
| Weston EGTPP | Weston TPP | ZINC2504359 |
| triphelyn phosphite | triphenylphosphite |
| CAS Number | 101-02-0 |
| PubChem Compound | 7540 |
| ChemSpider | 7259 |
| Wikipedia | Triphenyl phosphite |