D0248 | Alpha-Cyanocinnamate
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| TRANSPORT OF PYRUVATE | 0.05mM | inhibitor | >90% inhibition | 280 | ||||
| Target | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| Pyruvate kinase PKLR | 0.05mM | rabbit | muscle | inhibit | 25% inhibition | 280 | ||
| Pyruvate carboxylase, mitochondrial | 2mM | fat cell | inhibit | 65%inhibition | 280 | |||
| NADP-dependent malic enzyme, mitochondrial | 2mM | fat cell | inhibit | 23%inhibition | 280 | |||
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Danger |
Aggregated GHS information provided by 44 companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H301 (86.36%): Toxic if swallowed [Danger Acute toxicity, oral] H315 (11.36%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (11.36%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (11.36%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| (2E)-2-Cyano-3-phenyl-2-propenoic acid # | (2E)-2-cyano-3-phenylacrylic acid | (2E)-2-cyano-3-phenylprop-2-enoic acid |
| (E)-2-Cyano-3-phenylacrylic acid | (E)-2-cyano-3-phenylprop-2-enoic acid | .alpha.-Cyano-.beta.-phenylacrylic acid |
| .alpha.-Cyanocinnamic acid | 1011-92-3 | 14378-06-4 |
| 2-Cyano-3-phenyl-acrylic acid | 2-Cyano-3-phenylacrylic Acid | 2-Cyano-3-phenylpropenoic acid |
| 2-Propenoic acid, 2-cyano-3-phenyl- | 2-cyano-3-phenylprop-2-enoic acid | 2-propenoic acid, 2-cyano-3-phenyl-, (2E)- |
| 5806AF | AF-213/30142035 | AKOS000274287 |
| ALPHA-CYANOCINNAMICACID | AS-62210 | BDBM4342 |
| CDUQMGQIHYISOP-RMKNXTFCSA-N | CHEMBL77595 | Cinnamic acid, alpha-cyano- |
| EINECS 213-788-8 | HMS1757L09 | InChI=1/C10H7NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-6H,(H,12,13)/b9-6 |
| LS-54070 | NSC 298 | SBB028487 |
| SCHEMBL305982 | ST50189880 | STL281379 |
| ZINC84158 | ZX-AL001498 | a-cyanocinnamic acid |
| alpha-Cyanocinnamate | alpha-Cyanocinnamic acid | benzylidenemalononitrile (BMN) deriv. 26 |