Pictogram | Signal | Statements | Precautionary Statement Codes |
---|---|---|---|
Danger |
Aggregated GHS information provided by 194 companies from 18 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H226 (100%): Flammable liquid and vapor [Warning Flammable liquids] H315 (97.94%): Causes skin irritation [Warning Skin corrosion/irritation] H317 (100%): May cause an allergic skin reaction [Warning Sensitization, Skin] H318 (99.48%): Causes serious eye damage [Danger Serious eye damage/eye irritation] H330 (97.42%): Fatal if inhaled [Danger Acute toxicity, inhalation] H334 (100%): May cause allergy or asthma symptoms or breathing difficulties if inhaled [Danger Sensitization, respiratory] H335 (97.42%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P210, P233, P240, P241, P242, P243, P260, P261, P264, P271, P272, P280, P284, P285, P302+P352, P303+P361+P353, P304+P340, P304+P341, P305+P351+P338, P310, P312, P320, P321, P332+P313, P333+P313, P342+P311, P362, P363, P370+P378, P403+P233, P403+P235, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) | |
Warning |
H226: Flammable liquid and vapor [Warning Flammable liquids] H317: May cause an allergic skin reaction [Warning Sensitization, Skin] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] |
P210, P233, P240, P241, P242, P243, P260, P261, P272, P280, P302+P352, P303+P361+P353, P314, P321, P333+P313, P363, P370+P378, P403+P235, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) | |
(PROPAN-2-YL)({[(PROPAN-2-YL)IMINO]METHYLIDENE)AMINE | (propan-2-yl)({[(propan-2-yl)imino]methylidene})amine | 1,3-Diisopropylcarbodiimide |
1,3-di-iso-propylcarbodiimide | 1,3-diisopropyl carbodiimide | 1,3-diisopropyl-carbodiimide |
1,3-diisopropylcarbodiimid | 100576-EP2287165A2 | 100576-EP2287166A2 |
100576-EP2292620A2 | 100576-EP2301939A1 | 2,6-dimethyl-3,5-diazahepta-3,4-diene |
2-Propanamine, N,N'-methanetetraylbis- | 2-Propanamine,N'-methanetetraylbis- | 29815-EP2269989A1 |
29815-EP2272817A1 | 29815-EP2272822A1 | 29815-EP2272830A1 |
29815-EP2281823A2 | 29815-EP2289882A1 | 29815-EP2289891A2 |
29815-EP2289893A1 | 29815-EP2292616A1 | 29815-EP2295401A2 |
29815-EP2295402A2 | 29815-EP2301939A1 | 29815-EP2305671A1 |
29815-EP2305684A1 | 29815-EP2305808A1 | 29815-EP2308833A2 |
29815-EP2311464A1 | 29815-EP2311830A1 | 29815-EP2311832A1 |
29815-EP2311833A1 | 29815-EP2371811A2 | 29815-EP2374791A1 |
30259-EP2305808A1 | 30259-EP2311464A1 | 34407-EP2301536A1 |
34407-EP2301538A1 | 34407-EP2308833A2 | 34407-EP2311455A1 |
4-04-00-00531 (Beilstein Handbook Reference) | 40046-EP2272537A2 | 40046-EP2272972A1 |
40046-EP2272973A1 | 40046-EP2275414A1 | 40046-EP2277872A1 |
40046-EP2277878A1 | 40046-EP2287155A1 | 40046-EP2289882A1 |
40046-EP2298772A1 | 40046-EP2305647A1 | 40046-EP2308839A1 |
40046-EP2308857A1 | 40046-EP2311811A1 | 40046-EP2311830A1 |
693-13-0 | 693D130 | 8375-EP2277867A2 |
8375-EP2280003A2 | 8375-EP2281823A2 | 8375-EP2295401A2 |
8375-EP2298728A1 | 8375-EP2298776A1 | 8375-EP2301536A1 |
8375-EP2301538A1 | 8375-EP2302382A2 | 8375-EP2302383A2 |
8375-EP2305808A1 | 8375-EP2308828A2 | 8375-EP2308840A1 |
8375-EP2311455A1 | 8375-EP2311830A1 | 8375-EP2316824A1 |
AB0007248 | ACMC-209o74 | ACT10052 |
AKOS000121276 | AM83823 | ANW-35630 |
BBL028105 | BDNKZNFMNDZQMI-UHFFFAOYSA-N | BP-20548 |
BRN 0878281 | CAS-693-13-0 | CCRIS 3413 |
CHEBI:53092 | CHEMBL1332992 | CS-0008466 |
CTK2F2949 | Carbodiimide, diisopropyl- | D0254 |
DIC | DIC [N,N'-Diisopropylcarbodiimide] | DIC, 99% |
DIC, purum, >=98.0% (GC) | DIPC | DIPCDI |
DSSTox_CID_5086 | DSSTox_GSID_25086 | DSSTox_RID_77659 |
DTXSID4025086 | Diisopropyl-carbodiimide | Diisopropylcarbodiimide |
Diisopropylcarbodiimide solution, 1 M in THF | Diisopropylcarbodiimide solution, 1 M in dichloromethane | Diisoproylcarbodiimide |
EINECS 211-743-7 | Epitope ID:114068 | F0001-1801 |
FT-0632820 | HSDB 8051 | InChI=1/C7H14N2/c1-6(2)8-5-9-7(3)4/h6-7H,1-4H |
J-670017 | KS-00000142 | KSC352S4T |
LS-1591 | M02889 | MCULE-8262188101 |
MFCD00065689 | N,N'-Diisopropyl carbodimide | N,N'-Diisopropylcarbodiimide |
N,N'-Diisopropylcarbodiimide, 99% | N,N'-Diisopropylcarbodiimide, 99%, AcroSeal(R) | N,N'-Diisopropylcarbodiimide, ChemDose(TM) tablets, Loading: 0.15mmol per tablet |
N,N'-METHANETETRAYLBIS-2-PROPANAMINE | N,N'-Methanediylidenebis(propan-2-amine) | N,N'-Methanetetraylbis(1-methylethylamine) |
N,N'-diisopropycarbodiimide | N,N'-diisopropyl carbodiimide | N,N'-diisopropyl-carbodiimide |
N,N'-diisopropylcarbodimide | N,N'-diisopropylmethanediimine | N,N'-diisoproyl carbodiimide |
N,N'-dipropan-2-ylcarbodiimide | N,N'-methanediylidenedi propan-2-amine | N,N'-methanediylidenedipropan-2-amine |
N,N-Diisopropylcarbodiimide | N,N-Diisopropylcarbodimide | N,N-diisopropylcarbodiimide(dic) |
N-((isopropylimino)methyl-ene)propan-2-amine | N-((isopropylimino)methylene)propan-2-amine | NCGC00091541-01 |
NCGC00091541-02 | NCGC00260000-01 | NSC 42080 |
NSC-42080 | NSC42080 | OQO20I6TWH |
PubChem12717 | Q408747 | RTR-023067 |
SBB056444 | SC-11256 | SCHEMBL6720 |
ST24048144 | ST51044325 | STL146472 |
STR04127 | Tox21_202451 | UNII-OQO20I6TWH |
VZ36370 | W-104638 | X-4432 |
ZINC8585903 | di(propan-2-yl)methanediimine | di-isopropylcarbodiimide |
diisopropyl carbodiimide | diisopropylcarbo-diimide | diisopropylmethanediimine |
dipropan-2-ylmethanediimine |
CAS Number | 693-13-0 |
PubChem Compound | 12734 |
ChEBI | 53092 |
ChemSpider | 12211 |
Wikipedia | N,N'-Diisopropylcarbodiimide |