Compound
D0288 | Nordihydro-guaiaretic acid
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Warning |
Aggregated GHS information provided by 323 companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (87.93%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| .beta.,.delta.-bis(3,4-dihydroxyphenyl)butane | .beta.,.gamma.-Dimethyl-.alpha.,.delta.-bis(3,4-dihydroxyphenyl)butane | 1, 4,4'-(2,3-dimethyl-1,4-butanediyl)bis- |
| 1,2-Benzenediol, 4,4'-(2,3-dimethyl-1,4-butanediyl)bis- | 1,2-Benzenediol, 4,4'-[(2R,3R)-2,3-dimethyl-1,4-butanediyl]bis- | 1,2-Benzenediol, 4,4'-[(2R,3S)-2,3-dimethyl-1,4-butanediyl]bis-, rel- |
| 1,2-Benzenediol,4,4'-(2,3-dimethyl-1,4-butanediyl)bis- | 1,4-Bis(3,4-dihydroxyphenyl)-2,3-dimethylbutane | 103185-28-0 |
| 2,3-Bis(3,4-dihydroxyphenylmethyl)butane | 2,3-Dimethyl-1,4-bis(3,4-dihydroxyphenyl)butane | 4,3-Dimethyl-1,4-butanediyl)bis(pyrocatechol) |
| 4,3-Dimethyltetramethylene)dipyrocatechol | 4,4'-(2,3 Dimethyl-1,4-butanediyl)bis(1,2-benzenediol) | 4,4'-(2,3-Dimethyl-1,4-butanediyl)bis(1,2-benzenediol) |
| 4,4'-(2,3-Dimethyl-1,4-butanediyl)bis(pyrocatechol) | 4,4'-(2,3-Dimethyl-1,4-butanediyl)bis-1,2-benzenediol | 4,4'-(2,3-Dimethyltetramethylene)dipyrocatechol |
| 4,4'-(2,3-dimethylbutane-1,4-diyl)bis(benzene-1,2-diol) | 4,4'-(2,3-dimethylbutane-1,4-diyl)dibenzene-1,2-diol | 4,4'-(2,3-dimethyltetramethylene)dipyrocatechol (Nordihydroguaiaretic acid) |
| 4-[(2S,3R)-4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol | 4-[4-(3,4-dihydroxyphenyl)-2,3-dimethyl-butyl]benzene-1,2-diol | 4-[4-(3,4-dihydroxyphenyl)-2,3-dimethyl-butyl]pyrocatechol |
| 4-[4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol | 4-[4-[3,4-bis(oxidanyl)phenyl]-2,3-dimethyl-butyl]benzene-1,2-diol | 500-38-9 |
| 500N389 | AC-24202 | ACMC-20m628 |
| AI3-23059 | AKOS003367978 | AS-58406 |
| BCP08590 | BDBM32020 | Butane, 1,4-bis(3,4-dihydroxyphenyl)-2,3-dimethyl- |
| Butane,4-bis(3,4-dihydroxyphenyl)-2,3-dimethyl- | C10719 | C18H22O4 |
| CAS-500-38-9 | CCG-207935 | CCRIS 1399 |
| CHEBI:7625 | CHEMBL52 | CN0046 |
| CS-1431 | CTK4J1997 | D0800 |
| DSSTox_CID_2437 | DSSTox_GSID_22437 | DSSTox_RID_76590 |
| DTXSID5022437 | Dihydronorguaiaretic acid | Dinorguaiaretic acid, dihydro- |
| DivK1c_000999 | EINECS 207-903-0 | FT-0606781 |
| GTPL4265 | HCZKYJDFEPMADG-UHFFFAOYSA- | HCZKYJDFEPMADG-UHFFFAOYSA-N |
| HMS2232L16 | HMS3370G10 | HMS3649M15 |
| HMS503G19 | HY-N0198 | IDI1_000999 |
| INB0000262 | InChI=1/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3 | KBio1_000999 |
| KBio2_001626 | KBio2_002349 | KBio2_004194 |
| KBio2_004917 | KBio2_006762 | KBio2_007485 |
| KBio3_002828 | KBioGR_002349 | KBioSS_001626 |
| KBioSS_002352 | LOX inhibitor, N/A | LS-136429 |
| MCULE-7119316381 | MFCD00002206 | MLS000069451 |
| MLS002153435 | MLS006011710 | N-8500 |
| NCGC00015741-04 | NCGC00015741-05 | NCGC00015741-06 |
| NCGC00015741-08 | NCGC00089785-02 | NCGC00089785-03 |
| NCGC00255380-01 | NCI60_003992 | NDGA |
| NDGA, Larrea divaricata | NDGA;Masoprocol | NINDS_000999 |
| NORDIHYDROGUAIARETIC ACID | NSC 4291 | NSC 682984 |
| NSC-4291 | NSC-682984 | NSC4291 |
| NSC682984 | Nordihydroguaiaretic Acid, (R*,S*)-Isomer | Nordihydroguaiaretic acid (unspecified) |
| Nordihydroguaiaretic acid, 95% | Nordihydroguaiaretic acid, >=90% (HPLC), from Larrea divaricata (creosote bush) | Nordihydroguaiaretic acid, >=97.0% (HPLC) |
| Nordihydroguairaretic acid | Norguaiaretic acid, dihydro | Norguaiaretic acid, dihydro- |
| Norhydroguaiaretic acid | Oprea1_368609 | PYROCATECHOL,4'- (2,3-DIEMTHYLTETRAMETHYLENE) DI- |
| Pyrocatechol, 4,4'-(2,3-dimethyltetramethylene)di- | Pyrocatechol,4'-(2,3-dimethyltetramethylene)di- | Q7050774 |
| SBB005930 | SCHEMBL135976 | SMP2_000272 |
| SMR000059049 | SR-01000003007 | SR-01000003007-2 |
| ST056220 | STL570288 | Spectrum5_000735 |
| Spectrum_001146 | Tox21_302171 | W-5032 |
| WLN: QR BQ D1Y1&Y1&1R CQ DQ | beta,gamma-Dimethyl-alpha,delta-bis(3,4-dihydroxyphenyl)butane | cMAP_000026 |
| cid_4534 | nordihydroguaiaretate | nordihydroguaiaretic acid (ndga) |
| nordihydroguaiaretic-acid | nordihydroguaiareticacid | nordihydroguajaretic acid |
| nordihydroguaretic acid | nordihydroguiaretic acid |
| CAS Number | 103185-28-0, 27686-84-6, 500-38-9, 519-34-6 |
| PubChem Compound | 4534 |
| ChEBI | 7625 |
| ChemSpider | 64490 |
| Wikipedia | Nordihydroguaiaretic acid |