D0315 | Anthralin
D
D05AC51 Dithranol, combinations
[D05AC] Antracen derivatives
[D05A] ANTIPSORIATICS FOR TOPICAL USE
[D05] ANTIPSORIATICS
[D] Dermatological drugs
D05AC01 Dithranol
[D05AC] Antracen derivatives
[D05A] ANTIPSORIATICS FOR TOPICAL USE
[D05] ANTIPSORIATICS
[D] Dermatological drugs
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Warning |
Aggregated GHS information provided by 58 companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H315 (98.28%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (98.28%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (96.55%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| rat | LD50 | intraperitoneal | 3mg/kg (3mg/kg) | Developments in Biochemistry. Vol. 23, Pg. 759, 1982. | |
| mouse | LD50 | oral | 1542mg/kg (1542mg/kg) | Archives of Toxicology. Vol. 59, Pg. 180, 1986. | |
| rat | LD50 | oral | 3216mg/kg (3216mg/kg) | Archives of Toxicology. Vol. 59, Pg. 180, 1986. | |
| mouse | LD50 | intraperitoneal | > 1600mg/kg (1600mg/kg) | JNCI, Journal of the National Cancer Institute. Vol. 62, Pg. 911, 1979. | |
| 1,8,9-Trihydroxyanthracene, 97% | 1,8-DIHYDROXY-9(10H)-ANTHRACENONE | 1,8-Dihydroxy-9(10H)-anthracenone # |
| 1,8-Dihydroxy-9(10H)-anthracenone;Anthralin | 1,8-Dihydroxy-9-anthrone | 1,8-Dihydroxyanthracen-9(10H)-one |
| 1,8-Dihydroxyanthrone | 1,8-dihydroxy-10-hydroanthracen-9-one | 1,8-dihydroxy-10H-anthracen-9-one |
| 1,8-dihydroxy-9,10-dihydroanthracen-9-one | 1,8-dihydroxy-9-(10H)anthracenone | 1,8-dihydroxy-9-anthrane |
| 1143-38-0 | 4-06-00-07602 (Beilstein Handbook Reference) | 9(10H)-Anthracenone, 1,8-dihydroxy- |
| 9(10H)-Anthracenone, 1,8-dihydroxy- (9CI) | 9(10H)-Anthracenone,8-dihydroxy- | AB00051916_07 |
| AB0105711 | AC-14842 | AK481321 |
| AKOS015914122 | ANTHRADERM (TN) | API0002431 |
| Anthra-Derm | Anthralin (Dithranol) | Anthralin (Dithranol), Pharmaceutical Secondary Standard |
| Anthralin (USP) | Anthralin [USP] | Anthralin, Dithranol |
| Anthralin, United States Pharmacopeia (USP) Reference Standard | Anthraline | Anthrone, 1,8-dihydroxy- |
| Anthrone,8-dihydroxy- | BDBM50041802 | BRN 2054360 |
| BSPBio_001868 | Batridol | C06831 |
| CAS-1143-38-0 | CCG-38920 | CCRIS 628 |
| CHEBI:37510 | CHEMBL46469 | CS-2980 |
| CTK8A0163 | Certified Reference Material | Chrysodermol |
| Cignolin | Cigthranol | D00233 |
| DB-060606 | DB11157 | DSSTox_CID_4538 |
| DSSTox_GSID_24538 | DSSTox_RID_77448 | DTXSID7024538 |
| Dithranol | Dithranol (INN) | Dithranol ,(S) |
| Dithranol [INN] | Dithranol, >=90% (HPLC) | Dithranol, European Pharmacopoeia (EP) Reference Standard |
| Dithranolum | Dithranolum [INN-Latin] | DivK1c_000021 |
| DrithoCreme | Drithoscalp | EINECS 214-538-0 |
| Epitope ID:114081 | FT-0625372 | HMS1920E07 |
| HMS2091K07 | HMS2271B09 | HMS3715H19 |
| HMS500B03 | HY-B0738 | IDI1_000021 |
| InChI=1/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-6,15-16H,7H2 | K-1044 | KBio1_000021 |
| KBio2_000436 | KBio2_003004 | KBio2_005572 |
| KBio3_001368 | KBioGR_000622 | KBioSS_000436 |
| KS-5183 | LS-570 | MCULE-8492759735 |
| MFCD00001250 | MFCD00053409 | MLS001332632 |
| MLS002415712 | NCGC00091330-01 | NCGC00091330-02 |
| NCGC00091330-03 | NCGC00091330-04 | NCGC00091330-05 |
| NCGC00091330-07 | NCGC00253941-01 | NCGC00259400-01 |
| NCI60_004019 | NINDS_000021 | NSC 43970 |
| NSC 629313 | NSC-43970 | NSC-629313 |
| NSC-755873 | NSC43970 | NSC629313 |
| NSC755873 | NUZWLKWWNNJHPT-UHFFFAOYSA- | NUZWLKWWNNJHPT-UHFFFAOYSA-N |
| Pharmakon1600-01500127 | Prestwick_528 | Psodadrate |
| Psoriacid-Stift | Q419397 | SBI-0051286.P003 |
| SC-19051 | SCHEMBL3197 | SPBio_000122 |
| SPECTRUM1500127 | SR-05000002011 | SR-05000002011-1 |
| SR-05000002011-2 | ST50825759 | Spectrum2_000111 |
| Spectrum3_000304 | Spectrum4_000151 | Spectrum5_000820 |
| Spectrum_000056 | Tox21_111115 | Tox21_111115_1 |
| Tox21_201851 | Tox21_300290 | U8CJK0JH5M |
| UNII-U8CJK0JH5M | W-108602 | ZINC1322 |
| Zithranol-RR | anthralin | cid_2202 |
| cignoline |