D0318 | Azelaic acid
D
D10AX03 Azelaic acid
[D10AX] Other anti-acne preparations for topical use
[D10A] ANTI-ACNE PREPARATIONS FOR TOPICAL USE
[D10] ANTI-ACNE PREPARATIONS
[D] Dermatological drugs
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Warning |
Aggregated GHS information provided by 1126 companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 71 of 1126 companies. For more detailed information, please visit ECHA C&L website Of the 7 notification(s) provided by 1055 of 1126 companies with hazard statement code(s): H315 (47.3%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (99.91%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P264, P280, P302+P352, P305+P351+P338, P321, P332+P313, P337+P313, and P362; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
Aggregated GHS information provided by 38 companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (100%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| rabbit | LDLo | parenteral | 500mg/kg (500mg/kg) | behavioral: convulsions or effect on seizure threshold | Industrial and Engineering Chemistry. Vol. 29, Pg. 1247, 1937. |
| mouse | LD50 | intraperitoneal | 129mg/kg (129mg/kg) | Pharmaceutical Chemistry Journal Vol. 22, Pg. 469, 1988. | |
| rat | LC50 | inhalation | 7500mg/m3 (7500mg/m3) | Gigiena Truda i Professional'nye Zabolevaniya. Labor Hygiene and Occupational Diseases. Vol. 7(11), Pg. 51, 1963. | |
| mouse | LD50 | intravenous | 200mg/kg (200mg/kg) | International Polymer Science and Technology. Vol. 3, Pg. 93, 1976. | |
| mouse | LD50 | unreported | 770mg/kg (770mg/kg) | Toxicology and Applied Pharmacology. Vol. 14, Pg. 654, 1969. | |
| rat | LD50 | intraperitoneal | 300mg/kg (300mg/kg) | Nippon Yakurigaku Zasshi. Japanese Journal of Pharmacology. Vol. 65(1), Pg. 53S, 1969. | |
| guinea pig | LCLo | inhalation | 1200ppm/7H (1200ppm) | lungs, thorax, or respiration: other changes | Industrial Medicine and Surgery. Vol. 19, Pg. 317, 1950. |
| dog | LD50 | intravenous | 200mg/kg (200mg/kg) | behavioral: convulsions or effect on seizure threshold | Nippon Yakurigaku Zasshi. Japanese Journal of Pharmacology. Vol. 65(1), Pg. 53S, 1969. |
| mouse | LD50 | oral | 224mg/kg (224mg/kg) | "Toxicometric Parameters of Industrial Toxic Chemicals Under Single Exposure," Izmerov, N.F., et al., Moscow, Centre of International Projects, GKNT, 1982Vol. -, Pg. 41, 1982. | |
| rat | LD50 | oral | 11mg/kg (11mg/kg) | National Technical Information Service. Vol. OTS0534836, | |
| rabbit | LD50 | skin | 320uL/kg (0.32mL/kg) | American Industrial Hygiene Association Journal. Vol. 30, Pg. 470, 1969. | |
| mammal (species unspecified) | LD50 | intraperitoneal | 200mg/kg (200mg/kg) | AMA Archives of Industrial Hygiene and Occupational Medicine. Vol. 5, Pg. 311, 1952. | |
| mouse | LC50 | inhalation | 1070mg/m3 (1070mg/m3) | Gigiena Truda i Professional'nye Zabolevaniya. Labor Hygiene and Occupational Diseases. Vol. 7(11), Pg. 51, 1963. | |
| mouse | LD50 | subcutaneous | 1150mg/kg (1150mg/kg) | Voprosy Onkologii. Problems of Oncology. For English translation, see PONCAU. Vol. 4, Pg. 659, 1958. | |
| rabbit | LCLo | inhalation | 150ppm/7H (150ppm) | Industrial Medicine and Surgery. Vol. 19, Pg. 317, 1950. | |
| 0C50D8EC-0DB0-4F24-8EFC-2919E1F0D9BF | 1,7-Dicarboxyheptane | 1,7-Heptanedicarboxylate |
| 1,7-Heptanedicarboxylic acid | 1,9-Nonanedioate | 1,9-Nonanedioic acid |
| 123-99-9 | 1tuf | 21175-EP2269988A2 |
| 21175-EP2270008A1 | 21175-EP2275413A1 | 21175-EP2287156A1 |
| 21175-EP2292617A1 | 21175-EP2301940A1 | 21175-EP2314295A1 |
| 21175-EP2374895A1 | 21175-EP2380874A2 | 26776-28-3 |
| 27825-99-6 | 4-02-00-02055 (Beilstein Handbook Reference) | A-9800 |
| A0561 | AB00052140_12 | ACMC-1BTAP |
| AGN-191861 | AI3-06299 | AK308306 |
| AKOS000120052 | ANW-18182 | ARONIS24596 |
| AZA | Acide azelaique [French] | Acido azelaico |
| Acido azelaico [Spanish] | Acidum acelaicum | Acidum azelaicum [Latin] |
| Anchoate | Anchoic acid | Azalaic Acid |
| Azelaic | Azelaic acid (USAN/INN) | Azelaic acid 99% |
| Azelaic acid [USAN:INN] | Azelaic acid polyanhydride | Azelaic acid, 98% |
| Azelaic acid, Vetec(TM) reagent grade | Azelaic acid, analytical standard | Azelaic acid, technical grade |
| Azelaic acid, technical grade, 80% | Azelaic acid, technical, ~85% (GC) | Azelaic polyanhydride |
| Azelaicacidtech | Azelainic acid | Azelainsaeure |
| Azelainsaure | Azelex | Azelex (TN) |
| Azleaic Acid | BCP18690 | BDJRBEYXGGNYIS-UHFFFAOYSA-N |
| BIDD:GT0315 | BRN 1101094 | BSPBio_001756 |
| C08261 | C9-120-alpha-polymorph | C9-140-alpha-polymorph |
| C9-180-alpha-polymorph | C9-220-alpha-polymorph | C9-260-alpha-polymorph |
| C9-298-alpha-polymorph | CAS-123-99-9 | CCG-40081 |
| CHEBI:48131 | CHEMBL1238 | CTK0H8917 |
| D03034 | DB00548 | DSSTox_CID_1640 |
| DSSTox_GSID_21640 | DSSTox_RID_76254 | DTXSID8021640 |
| Dicarboxylic acid C9 | DivK1c_000532 | EC 204-669-1 |
| EINECS 204-669-1 | EU-0100051 | Emerox 1110 |
| Emerox 1144 | Emery's L-110 | Epitope ID:187039 |
| F2VW3D43YT | F8889-5093 | FT-0626920 |
| Finacea | Finacea (TN) | Finevin |
| GTPL7484 | HMS1921O11 | HMS2092E22 |
| HMS2234D10 | HMS3260K03 | HMS3372J07 |
| HMS501K14 | HSDB 7659 | HY-B0704 |
| Heptanedicarboxylic acid | IDI1_000532 | InChI=1/C9H16O4/c10-8(11)6-4-2-1-3-5-7-9(12)13/h1-7H2,(H,10,11)(H,12,13 |
| KBio1_000532 | KBio2_000437 | KBio2_003005 |
| KBio2_005573 | KBio3_001256 | KBioGR_000662 |
| KBioSS_000437 | KS-00000WLV | KS-000046KE |
| KS-5293 | KSC178S1P | LMFA01170054 |
| LP00051 | LS-22779 | LS41867 |
| Lepargylate | Lepargylic acid | Lopac-246379 |
| Lopac0_000051 | M112324 | MCULE-4093240509 |
| MFCD00004432 | MLS-0066619 | MLS-0066619.P021 |
| MLS000069659 | MLS001148615 | NCGC00014993-01 |
| NCGC00014993-02 | NCGC00014993-03 | NCGC00014993-04 |
| NCGC00014993-05 | NCGC00014993-06 | NCGC00014993-07 |
| NCGC00014993-08 | NCGC00014993-09 | NCGC00014993-10 |
| NCGC00014993-12 | NCGC00093565-01 | NCGC00093565-02 |
| NCGC00093565-03 | NCGC00093565-04 | NCGC00093565-05 |
| NCGC00093565-06 | NCGC00093565-07 | NCGC00256508-01 |
| NCGC00259538-01 | NCGC00260736-01 | NE10317 |
| NINDS_000532 | NONANEDIOIC ACID | NSC 19493 |
| NSC-19493 | NSC-757406 | NSC19493 |
| NSC757406 | Nonandisaeure | Nonandisaure |
| Nonanedioic acid | Nonanedioic acid Azelaic acid | Nonanedioic acid homopolymer |
| Nonanedioic acid, homopolymer | Nonanedioic acid, sodium salt | Opera_ID_740 |
| Pharmakon1600-01500648 | Poly(azelaic anhydride) | Polyazelaic Polyanhydride |
| Polyazelaic anhydride | Q413504 | RTR-003741 |
| SBB060279 | SBI-0050040.P003 | SC-16119 |
| SCHEMBL3887 | SDCCGMLS-0066619.P001 | SH-441 |
| SMR000059164 | SPBio_001089 | SPECTRUM1500648 |
| SR-01000075671 | SR-01000075671-1 | SR-01000075671-4 |
| SR-01000075671-6 | ST45053319 | STL059432 |
| Skinorem | Skinoren | Spectrum2_000995 |
| Spectrum3_000278 | Spectrum4_000401 | Spectrum5_001304 |
| Spectrum_000057 | TR-003741 | TRA0060478 |
| Tox21_110063 | Tox21_110063_1 | Tox21_201989 |
| Tox21_303011 | Tox21_500051 | UNII-F2VW3D43YT |
| Water-soluble azelaic acid | Z57127532 | ZINC1531036 |
| ZK 62498 | ZK-62498 | acide azelaique |
| acidum azelaicum | azelaate | azelaic acid |
| azelaic-acid | azelaicacid | azelate |
| heptane-1,7-dicarboxylic acid | n-Nonanedioate | n-Nonanedioic acid |
| nonanedionic acid | s4550 |
| DrugBank Name | Azelaic acid |
| DrugBank | DB00548 |
| CAS Number | 108-91-8, 123-99-9, 26776-28-3, 27825-99-6 |
| PubChem Compound | 2266 |
| KEGG Compound ID | C08261 |
| KEGG Drug | D03034 |
| PubChem.Substance | 46506284 |
| ChEBI | 48131 |
| PharmGKB | PA164754850 |
| ChemSpider | 2179 |
| TTD | DAP000889 |
| Wikipedia | Azelaic_acid |
| HET | AZ1 |
| DPD | 277 |