Compound
D0457 | nitrobenzoic acid
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| STATE 3 RESPIRATION | 1mM | mouse; C57B/6J | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 13 | |
| STATE 3 RESPIRATION | 1mM | mouse; C57B/6J | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 13 | |
| STATE 3 RESPIRATION | 1mM | mouse; C57B/6J | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 13 | |
| DNP-UNCOUPLED RESPIRATION | 1mM | mouse; C57B/6J | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 13 | |
| DNP-UNCOUPLED RESPIRATION | 1mM | mouse; C57B/6J | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 13 | |
| DNP-UNCOUPLED RESPIRATION | 1mM | mouse; C57B/6J | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 13 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Warning |
Aggregated GHS information provided by 68 companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (98.53%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| 2-NITROBENZOIC ACID | 2-Nitrobenzoic acid, 95% | 2-Nitrobenzoic acid, 95%, Contains 3- and 4-isomers |
| 2-Nitrobenzoic acid, Vetec(TM) reagent grade, 94% | 2-Nitrobenzoic acid, purum, >=97.0% (HPLC) | 2-Nitrobenzoic acid, technical, >=85% (HPLC) |
| 2-nitro benzoic acid | 2-nitro-benzoic acid | 2-nitro-benzoicaci |
| 2-nitrobenzoicacid | 31520-EP2270010A1 | 31520-EP2308858A1 |
| 31520-EP2311816A1 | 31520-EP2311817A1 | 52N169 |
| 552-16-9 | 6-nitro-benzoic acid | 92692-EP2277869A1 |
| 92692-EP2277870A1 | 92692-EP2305649A1 | AB-131/40245354 |
| AB1002856 | AC-652 | ACMC-1ASVT |
| AI3-08821 | AK-49895 | AKOS000119255 |
| AM87062 | ANW-32262 | AS-11055 |
| AS04600 | BBL019769 | BENZOIC ACID,2-NITRO MFC7 H5 N1 O4 |
| BR-49895 | Benzoic acid, 2-nitro- | Benzoic acid, o-nitro- |
| C16234 | CAS-552-16-9 | CCRIS 2334 |
| CHEBI:25620 | CHEMBL114719 | CS-W020072 |
| CTK0J2780 | DB-024127 | DSSTox_CID_5738 |
| DSSTox_GSID_25738 | DSSTox_RID_77900 | DTXSID5025738 |
| EINECS 209-004-9 | F3096-1719 | FT-0082641 |
| FT-0650584 | InChI=1/C7H5NO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10; | KS-00000CHO |
| KSC192O8B | LS-1360 | MCULE-3357987129 |
| MFCD00007137 | MP-2162 | N0155 |
| NCGC00091364-01 | NCGC00091364-02 | NCGC00258573-01 |
| NSC 9576 | NSC-9576 | NSC9576 |
| Nitrobenzoic acid | Oprea1_474365 | PubChem22385 |
| Q-200311 | Q19810380 | RTR-019471 |
| S6S4653K7Z | SBB058380 | SC-18492 |
| SCHEMBL17461588 | SCHEMBL78205 | SLAMLWHELXOEJZ-UHFFFAOYSA-N |
| ST2410184 | ST50186531 | STL168882 |
| SY005662 | TR-019471 | TRA0020042 |
| Tox21_201020 | UNII-S6S4653K7Z | Z57160141 |
| ZINC80841 | nitro benzoic acid | o-Carboxynitrobenzene |
| o-Nitrobenzoic acid | ortho-nitrobenzoic acid |