G
M
R
C
N
R02AX02 Ibuprofen
[R02AX] Other throat preparations
[R02A] THROAT PREPARATIONS
[R02] THROAT PREPARATIONS
[R] Respiratory system
N02AJ19 Oxycodone and ibuprofen
[N02AJ] Opioids in combination with non-opioid analgesics
[N02A] OPIOIDS
[N02] ANALGESICS
[N] Nervous system
N02AJ08 Codeine and ibuprofen
[N02AJ] Opioids in combination with non-opioid analgesics
[N02A] OPIOIDS
[N02] ANALGESICS
[N] Nervous system
M02AA13 Ibuprofen
[M02AA] Antiinflammatory preparations, non-steroids for topical use
[M02A] TOPICAL PRODUCTS FOR JOINT AND MUSCULAR PAIN
[M02] TOPICAL PRODUCTS FOR JOINT AND MUSCULAR PAIN
[M] Musculoskeletal system
M01AE51 Ibuprofen, combinations
[M01AE] Propionic acid derivatives
[M01A] ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS
[M01] ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS
[M] Musculoskeletal system
M01AE01 Ibuprofen
[M01AE] Propionic acid derivatives
[M01A] ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS
[M01] ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS
[M] Musculoskeletal system
G02CC01 Ibuprofen
[G02CC] Antiinflammatory products for vaginal administration
[G02C] OTHER GYNECOLOGICALS
[G02] OTHER GYNECOLOGICALS
[G] Genitourinary system and reproductive hormones
C01EB16 Ibuprofen
[C01EB] Other cardiac preparations
[C01E] OTHER CARDIAC PREPARATIONS
[C01] CARDIAC THERAPY
[C] Cardiovascular system
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| PROTONOPHORIC UNCOUPLING | 278 | |||||||
| MEMBRANE POTENTIAL | 355.9 µM | 30 mins | mouse | liver mitochondria | Rh123 fluorescence (excitation 485 nm, emission 535 nm) are recorded using a fluorescence multi-well plate reader (mCICCP (20 µM) treatments was considered as the 100% baseline for ΔΨm loss) | decrease | EC20 | 36 |
| RESPIRATION | 170.1 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Rotenone (2µM) was used as 100% baseline for complex I inhibition. | decrease | EC20 | 36 |
| RESPIRATION | 132.1 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Oligomycin A (1µM) was used as 100% baseline for complex II inhibition. | decrease | EC20 | 36 |
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | affect | 227 | ||||||
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | affect | 239 | ||||||
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | 287μM | 80* | mice | Lean mice vs Ob/ob mice | Measurement of oxygen consumption in the presence of ADP (state 3) and the different substrates was carried out on the Mitologics screening platform | EC20 | 227 | |
| SWELLING | > 200 µM | 30 mins | mouse | liver mitochondria | swelling assay: Absorbance at 545 nm using a fluorescence multi-well plate reader (CaCl2 (50 µM) was considered as the 100% baseline for the swelling ) | increase | EC20 | 36 |
| Target | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| NADH:ubiquinone reductase | 170.1 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Rotenone (2µM) was used as 100% baseline for complex I inhibition. | inhibit | EC20 | 36 |
| Succinate dehydrogenase | 132.1 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Oligomycin A (1µM) was used as 100% baseline for complex II inhibition. | inhibit | EC20 | 36 |
| Cytochrome c | > 200 µM | 30 mins | mouse | liver mitochondria | Cytochrome c release was evaluated using ELISA kit ( 20 µg/ml Alamethicin was used as 100% baseline) | release | EC20 | 36 |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
![]() ![]() |
Warning |
Aggregated GHS information provided by 611 companies from 44 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] H319 (74.8%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (74.14%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H361 (14.73%): Suspected of damaging fertility or the unborn child [Warning Reproductive toxicity] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P261, P264, P270, P271, P280, P281, P301+P312, P304+P340, P305+P351+P338, P308+P313, P312, P330, P337+P313, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
![]() ![]() ![]() |
Danger |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H360: May damage fertility or the unborn child [Danger Reproductive toxicity] H362: May cause harm to breast-fed children [Reproductive toxicity, effects on or via lactation] H371: May cause damage to organs [Warning Specific target organ toxicity, single exposure] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] H401: Toxic to aquatic life [Hazardous to the aquatic environment, acute hazard] H411: Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P260, P263, P264, P270, P273, P281, P301+P312, P308+P313, P309+P311, P314, P330, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| ( inverted exclamation markA)-Ibuprofen | ( inverted question mark)-Ibuprofen | (+) ibuprofen |
| (+-)-2-(p-Isobutylphenyl)propionic acid | (+-)-Ibuprofen | (+-)-Ibuprophen |
| (+-)-alpha-Methyl-4-(2-methylpropyl)benzeneacetic acid | (+-)-p-Isobutylhydratropic acid | (+/-)-2-(4-Isobutylphenyl)Propanoic Acid |
| (+/-)-2-(p-isobutylphenyl)propionic acid | (+/-)-Ibuprofen | (+/-)-alpha-methyl-4-(2-methylpropyl)benzeneacetic acid |
| (+/-)-p-Isobutylhydratropic acid | (.+-.)-2-(p-Isobutylphenyl)propionic acid | (.+-.)-p-Isobutylhydratropic acid |
| (.+/-.)-2-(p-Isobutylphenyl)propionic acid | (.+/-.)-p-Isobutylhydratropic acid | (2s)-2-[4-(2-methylpropyl)phenyl]propionic acid DEXIBUPROFEN (S)-(+)-2-(4-ISOBUTYLPHENYL)PROPIONIC ACID (S)-(+)-4-ISOBUTYL-ALPHA-ME |
| (4-Isobutylphenyl)-alpha-methylacetic acid | (?)-Ibuprofen | (A+/-)-Ibuprofen |
| (RS)-2-(4-(2-Methylpropyl)phenyl)propanoic acid | (RS)-Ibuprofen | (S)-4-Isobutyl-alpha-methylphenylacetic acid |
| (r/s)-alpha-methyl-4-isobutylphenylacetic acid | (y)-Ibuprofen | .alpha.-(4-Isobutylphenyl)propionic acid |
| .alpha.-(p-isobutylphenyl)propionic acid | .alpha.-2-(p-Isobutylphenyl)propionic acid | .alpha.-Methyl-4-(2-methylpropyl)benzeneacetic acid |
| 15687-27-1 | 2-(4'-isobutylphenyl)-propionic acid | 2-(4'-isobutylphenyl)propionic acid |
| 2-(4-ISOBUTYLPHENYL)PROPIONIC ACID | 2-(4-Isobutyl-phenyl)-propionic acid | 2-(4-Isobutylphenyl)-propionic acid |
| 2-(4-Isobutylphenyl)propanoic acid | 2-(4-Isobutylphenyl)propanoicAcid | 2-(4-isobutylphenyl) propanoic acid |
| 2-(4-isobutylphenyl) propionic acid | 2-(4-isobutylphenyl)-propionic acid | 2-(4-isobutylphenyl)-propionoic acid |
| 2-(p-Isobutylphenyl)propionic acid | 2-[4-(2-methylpropyl)phenyl]propanoic acid | 2-p-isobutylphenylpropionic acid |
| 4-Isobutyl-.alpha.-methylphenylacetic acid | 4-Isobutyl-alpha-methylphenylacetic acid | 4-Isobutylhydratropic acid |
| 4-Isobutylphenyl)-.alpha.-methylacetic acid | 58560-75-1 | 687I271 |
| A831926 | AB00052020-16 | AB00052020-17 |
| AB00052020_18 | AB00052020_19 | AB1009266 |
| AC-11312 | ACHES-N-PAIN | ACMC-209df0 |
| ACMC-209ks2 | ACT03248 | AK-47272 |
| AK-73124 | AK307336 | AKOS003237488 |
| AKOS016340658 | ALBB-025647 | AM20060782 |
| ANW-21658 | ARONIS23835 | Acide (isobutyl-4 phenyl)-2 propionique |
| Acide (isobutyl-4-phenyl)-2 propionique | Acide (isobutyl-4-phenyl)-2 propionique [French] | Act-3 |
| Adex 200 | Adran | Advil |
| Advil (TN) | Advil Cold & Sinus (Salt/Mix) | Advil Liqui-Gels |
| Advil Migraine Liqui-Gels | Advil migraine | Advil, Children's |
| Ak+C2278tren | Aktren | Alaxan |
| Algofen | Alivium | Am-Fam 400 |
| Amelior | Amersol | Amibufen |
| Anafen | Anco | Andran |
| Anflagen | Antagil | Antalfene |
| Antarene | Antiflam | Apo-Ibuprofen |
| Apsifen | Artofen | Artril |
| Artril 300 | BB 0258487 | BBL010660 |
| BCP10423 | BCP20325 | BCP25225 |
| BDBM50009859 | BIDD:GT0050 | BR-47272 |
| BRD-A17655518-001-02-0 | BRD-A17655518-001-12-9 | BRN 2049713 |
| BSPBio_002170 | Balkaprofen | Bayer Select Pain Relief |
| Benzeneacetic acid, .alpha.-methyl-4-(2-methylpropyl), (.+/-.)- | Benzeneacetic acid, .alpha.-methyl-4-(2-methylpropyl)- | Benzeneacetic acid, alpha-methyl-4-(2-methylpropyl), (+-)- |
| Benzeneacetic acid, alpha-methyl-4-(2-methylpropyl), (+/-)- | Benzeneacetic acid, alpha-methyl-4-(2-methylpropyl)- | Betaprofen |
| Bloom | Bluton | Brofen |
| Brufanic | Brufen | Brufen 400 |
| Brufen Retard | Bruflam | Brufort |
| Buburone | Bufeno | Bufigen |
| Bukrefen | Bupron | Buracaps |
| Burana | Butacortelone | Butylenin |
| C01588 | C13H18O2 | CAS-15687-27-1 |
| CBMicro_005634 | CCG-38947 | CCRIS 3223 |
| CDT-ibuprofen | CHEBI:5855 | CHEMBL521 |
| CHILDREN'S ADVIL-FLAVORED | CPD000058184 | CS-1931 |
| CTK3J2010 | Caldolor | Cambridge id 5152402 |
| Cap-Profen | Carol | Certified Reference Material |
| Cesra | Children's Advil | Children's Elixsure |
| Children's Elixsure IB | Children's Elixsure IB (Salt/Mix) | Children's Ibuprofen |
| Children's Motrin | Citalgan | Cobo |
| Codral Period Pain | Combiflam | Combunox (Salt/Mix) |
| Cunil | D00126 | DB-043333 |
| DB-071312 | DB01050 | DOLO PUREN |
| DSSTox_CID_732 | DSSTox_GSID_20732 | DSSTox_RID_75759 |
| DTXSID5020732 | Daiprophen | Dalsy |
| Dansida | Deep Relief | Dentigoa |
| Dibufen | Dignoflex | DivK1c_000887 |
| Dolgin | Dolgirid | Dolgit |
| Dolibu | Dolmaral | Dolo-Dolgit |
| Dolocyl | Dolofen | Dolofen-F |
| Dolofin | Dolofort | Dologel |
| Dolomax | Doloren | Dolormin |
| Doltibil | Dolven | Donjust B |
| Dorival | Drin | Duafen |
| Dularbuprofen | Duobrus | Dura-Ibu |
| Dysdolen | EC 239-784-6 | EINECS 239-784-6 |
| EU-0100691 | Easifon | Ebufac |
| Emflam | Emflam-200 | Epitope ID:139973 |
| Epobron | Eputex | Ergix |
| Esprenit | Exneural | FT-0601629 |
| FT-0655194 | Faspic | Femadon |
| Femafen | Femapirin | Femidol |
| Fenbid | Fendol | Fenspan |
| Fibraflex | GTPL2713 | Gelufene |
| Genpril | Gofen | Grefen |
| Gynofug | HEFNNWSXXWATRW-UHFFFAOYSA- | HEFNNWSXXWATRW-UHFFFAOYSA-N |
| HMS1920F15 | HMS2089P05 | HMS2091N03 |
| HMS2230N04 | HMS3259G05 | HMS3262K03 |
| HMS3372M09 | HMS3649M11 | HMS3651A15 |
| HMS502M09 | HSDB 3099 | HY-78131 |
| Haltran | Hemagene Tailleur | Hydratropic acid, p-isobutyl- |
| I 4883 | I0415 | IB-100 |
| IDI1_000887 | IP-82 | Ibol |
| Ibren | Ibu | Ibu-Attritin |
| Ibu-Tab | Ibu-Tab 200 | Ibu-slo |
| Ibu-slow | Ibubest | Ibubeta |
| Ibucasen | Ibudol | Ibudolor |
| Ibufen | Ibuflamar | Ibufug |
| Ibugel | Ibugen | Ibugesic |
| Ibuhexal | Ibulagic | Ibular |
| Ibulav | Ibuleve | Ibulgan |
| Ibumed | Ibumerck | Ibumetin |
| Ibupirac | Ibupril | Ibuprin |
| Ibuprocin | Ibuprofen (Advil) | Ibuprofen (Dolgesic) |
| Ibuprofen (JP17/USP/INN) | Ibuprofen - Adooq Bioscience | Ibuprofen 1.0 mg/ml in Methanol |
| Ibuprofen 100 microg/mL in Methanol | Ibuprofen I.V. Solution | Ibuprofen [USAN:BAN:INN:JAN] |
| Ibuprofen [USAN:USP:INN:BAN:JAN] | Ibuprofen for peak identification, European Pharmacopoeia (EP) Reference Standard | Ibuprofen(Advil) |
| Ibuprofen, 99% | Ibuprofen, >=98% (GC) | Ibuprofen, British Pharmacopoeia (BP) Reference Standard |
| Ibuprofen, European Pharmacopoeia (EP) Reference Standard | Ibuprofen, Pharmaceutical Secondary Standard | Ibuprofen, United States Pharmacopeia (USP) Reference Standard |
| Ibuprofen, VETRANAL(TM), analytical standard | Ibuprofen, Vetec(TM) reagent grade, 97% | Ibuprofen, meets USP testing specifications |
| Ibuprofen,(S) | Ibuprofen-Zinc | Ibuprofene |
| Ibuprofene [INN-French] | Ibuprofeno | Ibuprofeno [INN-Spanish] |
| Ibuprofenum | Ibuprofenum [INN-Latin] | Ibuprohm |
| Ibuprophen | Ibuprox | Ibusal |
| Ibutid | Ibux | Ifen |
| InChI=1/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15) | Inabrin | Inflam |
| Inoven | Ipren | Irfen |
| Isobutylpropanoicphenolic acid | Isodol | J-009349 |
| J10135 | Jenaprofen | Junifen |
| Junior Strength Advil | Junior Strength Ibuprofen | Junior Strength Motrin |
| KBio1_000887 | KBio2_001329 | KBio2_003897 |
| KBio2_006465 | KBio3_001390 | KBioGR_000389 |
| KBioSS_001329 | KS-00000CJ0 | KS-000047NV |
| KS-5029 | KSC492A1B | Kesan |
| Kontagripp Mono | Kratalgin | LP00691 |
| LS-7454 | Lamidon | Lebrufen |
| Librofem | Lidifen | Liptan |
| Lopac0_000691 | Lopane | M-4957 |
| MCULE-9475454445 | MFCD00010393 | MLS000069733 |
| MLS001146965 | MOTRIN MIGRAINE PAIN | Malafene |
| Manypren | Medipren | Melfen |
| Mensoton | Midol | Midol 200 |
| Midol IB Cramp Relief | Midol Liquid Gels | Moment |
| Motrin | Motrin (TN) | Motrin IB |
| Motrin IB Gelcaps | Motrin IB Gelcaps (Salt/Mix) | Mynosedin |
| N4,N4' -Di(naphthalen-1-yl)-N4,N4' -bis(4-vinylphenyl)biphenyl-4,4'-diamine | NC00458 | NCGC00015529-04 |
| NCGC00015529-05 | NCGC00015529-06 | NCGC00015529-07 |
| NCGC00015529-08 | NCGC00015529-09 | NCGC00015529-10 |
| NCGC00015529-12 | NCGC00015529-13 | NCGC00015529-14 |
| NCGC00015529-15 | NCGC00015529-18 | NCGC00089819-02 |
| NCGC00089819-03 | NCGC00089819-04 | NCGC00089819-05 |
| NCGC00089819-06 | NCGC00089819-07 | NCGC00256416-01 |
| NCGC00258935-01 | NCGC00261376-01 | NCI60_002065 |
| NINDS_000887 | NSC 256857 | NSC-256857 |
| NSC-757073 | NSC256857 | NSC757073 |
| Nagifen-D | Napacetin | Narfen |
| Neo-Helvagit | Neo-Mindol | Neobrufen |
| Nerofen | Noalgil | Nobafon |
| Nobfelon | Nobfen | Nobgen |
| Noritis | Novadol | Novo Dioxadol |
| Novo-Profen | Novogent | Novoprofen |
| Nuprilan | Nuprin | Nurofen |
| Nurofen Meltlets | Opera_ID_554 | Optifen |
| Opturem | Oralfene | Ostarin |
| Ostofen | Ozonol | Paduden |
| Panafen | Pantrop | Paxofen |
| Pedea | PediaProfen | Pediatric Advil |
| Perofen | Perrigo ibuprofen | Pharmakon1600-01500347 |
| Proartinal | Profen | Proflex |
| Propanoic acid, 2-(4-isobutylphenyl) | Provon | PubChem16054 |
| Q186969 | Quadrax | R.D. 13621 |
| RD 13621 | RTR-006580 | Racemic ibuprofen |
| Rafen | Ranofen | Rebugen |
| Relcofen | Rhinadvil | Rofen |
| Roidenin | Rufen | Rufin |
| Rupan | SAM002264619 | SB19113 |
| SBB064160 | SBI-0050669.P004 | SC-18867 |
| SCHEMBL3001 | SMR000058184 | SPBio_000178 |
| SPECTRUM1500347 | SR-01000000214 | SR-01000000214-13 |
| SR-01000000214-2 | SR-01000000214-4 | ST-1482 |
| ST024750 | ST24032335 | STK177358 |
| SW203738-2 | Sadefen | Salivia |
| Salprofen | Schmerz-Dolgit | Seclodin |
| Sednafen | Seklodin | Seskafen |
| Sine-Aid IB Caplets (Salt/Mix) | Siyafen | Solpaflex |
| Solufen | Spectrum2_000129 | Spectrum3_000465 |
| Spectrum4_000015 | Spectrum5_000862 | Spectrum_000849 |
| Stelar | Sugafen | Suprafen |
| Suspren | Syntofene | TR-006580 |
| TRA0047278 | Tab-Profen | Tabalon |
| Tabalon 400 | Tatanal | Tempil |
| Tofen | Togal N | Tonal |
| Tox21_110170 | Tox21_110170_1 | Tox21_201384 |
| Tox21_302829 | Tox21_500691 | Trauma-Dolgit Gel |
| Trendar | U 18573 | U-18,573 |
| U-18573 | UCB 79171 | Unipron |
| Upfen | Uprofen | Urem |
| VUFB 9649 | WLN: QVY&R DIY | Z1695709473 |
| ZAG-1701 | Zafen | Zofen |
| [(+/-)-2-(4-Isobutylphenyl)-propionic Acid | alpha-(4-Isobutylphenyl)propionate | alpha-(4-Isobutylphenyl)propionic acid |
| alpha-(4-isobutylphenyl)-propionic acid | alpha-(p-isobutylphenyl)-propionic acid | alpha-(p-isobutylphenyl)propionic acid |
| alpha-Methyl-4-(2-methylpropyl)benzeneacetic acid | alpha-Methyl-4-(2-methylpropyl)benzeneacetic acid | alpha-Methyl-4-(isobutyl)phenylacetic acid |
| alpha-p-Isobutylphenylpropionate | alpha-p-Isobutylphenylpropionic acid | duralbuprofen |
| ibuprofen | p-Isobutyl-2-phenylpropionate | p-Isobutyl-2-phenylpropionic acid |
| p-Isobutylhydratropate | p-Isobutylhydratropic acid | p-Isobutylhydratropic acid |
| p-isobutyl-hydratropic acid | s1638 |
| DrugBank Name | Ibuprofen |
| DrugBank | DB01050 |
| CAS Number | 1010396-31-2, 1216459-54-9, 141505-32-0, 15687-27-1, 51146-56-6, 51146-57-7, 58560-75-1 |
| PubChem Compound | 3672 |
| KEGG Compound ID | C01588 |
| KEGG Drug | D00126 |
| PubChem.Substance | 46507255 |
| ChEBI | 5855 |
| PharmGKB | PA449957 |
| ChemSpider | 3544 |
| BindingDB | 50009859.0 |
| TTD | DAP000780 |
| Wikipedia | Ibuprofen |
| DPD | 2609 |