J
J04AM08 Isoniazid, sulfamethoxazole, trimethoprim and pyridoxine
[J04AM] Combinations of drugs for treatment of tuberculosis
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
J04AM07 Rifampicin, ethambutol and isoniazid
[J04AM] Combinations of drugs for treatment of tuberculosis
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
J04AM06 Rifampicin, pyrazinamide, ethambutol and isoniazid
[J04AM] Combinations of drugs for treatment of tuberculosis
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
J04AM05 Rifampicin, pyrazinamide and isoniazid
[J04AM] Combinations of drugs for treatment of tuberculosis
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
J04AM04 Thioacetazone and isoniazid
[J04AM] Combinations of drugs for treatment of tuberculosis
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
J04AM03 Ethambutol and isoniazid
[J04AM] Combinations of drugs for treatment of tuberculosis
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
J04AM02 Rifampicin and isoniazid
[J04AM] Combinations of drugs for treatment of tuberculosis
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
J04AM01 Streptomycin and isoniazid
[J04AM] Combinations of drugs for treatment of tuberculosis
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
J04AC51 Isoniazid, combinations
[J04AC] Hydrazides
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
J04AC01 Isoniazid
[J04AC] Hydrazides
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 504.6 µM | 30 mins | mouse | liver mitochondria | Rh123 fluorescence (excitation 485 nm, emission 535 nm) are recorded using a fluorescence multi-well plate reader (mCICCP (20 µM) treatments was considered as the 100% baseline for ΔΨm loss) | decrease | EC20 | 36 |
| REDOX CYCLING | 278 | |||||||
| RESPIRATION | 59.8 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Rotenone (2µM) was used as 100% baseline for complex I inhibition. | decrease | EC20 | 36 |
| RESPIRATION | ND | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Oligomycin A (1µM) was used as 100% baseline for complex II inhibition. | Negative | EC20 | 36 |
| SWELLING | > 800 µM | 30 mins | mouse | liver mitochondria | swelling assay: Absorbance at 545 nm using a fluorescence multi-well plate reader (CaCl2 (50 µM) was considered as the 100% baseline for the swelling ) | increase | EC20 | 36 |
| Target | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| NADH:ubiquinone reductase | 59.8 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Rotenone (2µM) was used as 100% baseline for complex I inhibition. | inhibit | EC20 | 36 |
| Succinate dehydrogenase | ND | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Oligomycin A (1µM) was used as 100% baseline for complex II inhibition. | Negative | EC20 | 36 |
| Cytochrome c | > 400 µM | 30 mins | mouse | liver mitochondria | Cytochrome c release was evaluated using ELISA kit ( 20 µg/ml Alamethicin was used as 100% baseline) | release | EC20 | 36 |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
![]() |
Warning |
Aggregated GHS information provided by 368 companies from 11 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H302 (98.37%): Harmful if swallowed [Warning Acute toxicity, oral] H315 (92.12%): Causes skin irritation [Warning Skin corrosion/irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P264, P270, P280, P301+P312, P302+P352, P321, P330, P332+P313, P362, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
![]() ![]() |
Danger |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H361: Suspected of damaging fertility or the unborn child [Warning Reproductive toxicity] H370: Causes damage to organs [Danger Specific target organ toxicity, single exposure] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H402: Harmful to aquatic life [Hazardous to the aquatic environment, acute hazard] H412: Harmful to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P260, P264, P270, P273, P281, P301+P312, P307+P311, P308+P313, P314, P321, P330, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| rabbit | LD50 | intramuscular | 155mg/kg (155mg/kg) | Schweizerische Zeitschrift fuer Tuberkulose und Pneumonologie. Vol. 9, Pg. 226, 1952. | |
| guinea pig | LD50 | oral | 255mg/kg (255mg/kg) | Schweizerische Zeitschrift fuer Tuberkulose und Pneumonologie. Vol. 9, Pg. 226, 1952. | |
| mouse | LD50 | intraperitoneal | 100mg/kg (100mg/kg) | National Technical Information Service. Vol. AD277-689, | |
| rabbit | LD50 | subcutaneous | 135mg/kg (135mg/kg) | Schweizerische Zeitschrift fuer Tuberkulose und Pneumonologie. Vol. 9, Pg. 226, 1952. | |
| cat | LD50 | intraperitoneal | 325mg/kg (325mg/kg) | Klinische Wochenscrift. Vol. 30, Pg. 959, 1952. | |
| mouse | LD50 | intravenous | 149mg/kg (149mg/kg) | behavioral: convulsions or effect on seizure threshold | Journal of Pharmacology and Experimental Therapeutics. Vol. 122, Pg. 110, 1958. |
| man | LDLo | oral | 116mg/kg (116mg/kg) | Journal of Analytical Toxicology. Vol. 16, Pg. 57, 1992. | |
| rat | LD50 | intravenous | 365mg/kg (365mg/kg) | Arzneimittel-Forschung. Drug Research. Vol. 26, Pg. 409, 1976. | |
| mouse | LD50 | oral | 133mg/kg (133mg/kg) | American Review of Tuberculosis. Vol. 65, Pg. 376, 1952. | |
| man | TDLo | oral | 430mg/kg (430mg/kg) | Neurology. Vol. 20, Pg. 299, 1970. | |
| rat | LD50 | oral | 1250mg/kg (1250mg/kg) | Arzneimittel-Forschung. Drug Research. Vol. 26, Pg. 409, 1976. | |
| dog | LD50 | oral | 50mg/kg (50mg/kg) | American Review of Tuberculosis. Vol. 65, Pg. 392, 1952. | |
| rat | LD50 | intramuscular | 400mg/kg (400mg/kg) | behavioral: convulsions or effect on seizure threshold | Therapie. Vol. 8, Pg. 62, 1953. |
| guinea pig | LD50 | intravenous | 220mg/kg (220mg/kg) | gastrointestinal: "hypermotility, diarrhea" | Archiv fuer Toxikologie. Vol. 22, Pg. 80, 1966. |
| infant | TDLo | oral | 91mg/kg (91mg/kg) | Pediatrics. Vol. 95, Pg. 700, 1995. | |
| women | TDLo | oral | 12mg/kg/2D-I (12mg/kg) | Neurology. Vol. 34, Pg. 703, 1984. | |
| rabbit | LD50 | intraperitoneal | 147mg/kg (147mg/kg) | Schweizerische Zeitschrift fuer Tuberkulose und Pneumonologie. Vol. 9, Pg. 226, 1952. | |
| child | TDLo | oral | 125mg/kg (125mg/kg) | Annals of Emergency Medicine. Vol. 17, Pg. 73, 1988. | |
| rat | LD50 | intraperitoneal | 335mg/kg (335mg/kg) | Schweizerische Zeitschrift fuer Tuberkulose und Pneumonologie. Vol. 9, Pg. 226, 1952. | |
| rabbit | LD50 | intravenous | 94mg/kg (94mg/kg) | behavioral: convulsions or effect on seizure threshold | American Review of Tuberculosis. Vol. 65, Pg. 376, 1952. |
| women | TDLo | oral | 90200ug/kg/7D (90.2mg/kg) | Pediatrics. Vol. 97, Pg. 782, 1996. | |
| guinea pig | LD50 | subcutaneous | 195mg/kg (195mg/kg) | Schweizerische Zeitschrift fuer Tuberkulose und Pneumonologie. Vol. 9, Pg. 226, 1952. | |
| human | LDLo | oral | 100mg/kg (100mg/kg) | peripheral nerve and sensation: structural change in nerve or sheath | American Review of Respiratory Disease. Vol. 105, Pg. 206, 1972. |
| mouse | LD50 | subcutaneous | 125mg/kg (125mg/kg) | behavioral: convulsions or effect on seizure threshold | Yakugaku Zasshi. Journal of Pharmacy. Vol. 81, Pg. 1225, 1961. |
| rat | LD50 | subcutaneous | 329mg/kg (329mg/kg) | Journal of Pharmacology and Experimental Therapeutics. Vol. 119, Pg. 444, 1957. | |
| rabbit | LD50 | oral | 250mg/kg (250mg/kg) | Arzneimittel-Forschung. Drug Research. Vol. 12, Pg. 22, 1962. | |
| women | TDLo | oral | 99300ug/kg (99.3mg/kg) | Pediatrics. Vol. 95, Pg. 700, 1995. | |
| rabbit | LD50 | intracrebral | > 12mg/kg (12mg/kg) | Schweizerische Zeitschrift fuer Tuberkulose und Pneumonologie. Vol. 9, Pg. 226, 1952. | |
| child | TDLo | oral | 3600mg/kg/43W (3600mg/kg) | Canadian Medical Association Journal. Vol. 148, Pg. 49, 1993. | |
| child | TDLo | oral | 195mg/kg (195mg/kg) | Japanese Journal of Toxicology. Vol. 12, Pg. 225, 1999. | |
| guinea pig | LD50 | intraperitoneal | 195mg/kg (195mg/kg) | Klinische Wochenscrift. Vol. 30, Pg. 959, 1952. | |
| mouse | LD50 | intramuscular | 137mg/kg (137mg/kg) | American Review of Tuberculosis. Vol. 65, Pg. 376, 1952. | |
| man | TDLo | oral | 100mg/kg/3W-C (100mg/kg) | American Review of Respiratory Disease. Vol. 106, Pg. 849, 1972. | |
| man | LDLo | oral | 523mg/kg/17W- (523mg/kg) | JAMA, Journal of the American Medical Association. Vol. 176, Pg. 877, 1961. | |
| guinea pig | LD50 | intramuscular | 255mg/kg (255mg/kg) | Schweizerische Zeitschrift fuer Tuberkulose und Pneumonologie. Vol. 9, Pg. 226, 1952. | |
| women | TDLo | oral | 11250mg/kg (11250mg/kg) | Anaesthesia. Vol. 47, Pg. 781, 1992. | |
| man | TDLo | oral | 39mg/kg/9D-I (39mg/kg) | skin and appendages (skin): "dermatitis, other: after systemic exposure" | Southern Medical Journal. Vol. 75, Pg. 81, 1982. |
| 101033-EP2272832A1 | 101033-EP2272972A1 | 101033-EP2272973A1 |
| 101033-EP2277872A1 | 101033-EP2295053A1 | 101033-EP2298776A1 |
| 101033-EP2301544A1 | 10319-EP2272972A1 | 10319-EP2272973A1 |
| 10319-EP2274983A1 | 10319-EP2275102A1 | 10319-EP2275401A1 |
| 10319-EP2277872A1 | 10319-EP2280000A1 | 10319-EP2280012A2 |
| 10319-EP2281563A1 | 10319-EP2289510A1 | 10319-EP2289876A1 |
| 10319-EP2295407A1 | 10319-EP2295411A1 | 10319-EP2295416A2 |
| 10319-EP2295433A2 | 10319-EP2298312A1 | 10319-EP2298736A1 |
| 10319-EP2298747A1 | 10319-EP2298748A2 | 10319-EP2301536A1 |
| 10319-EP2301538A1 | 10319-EP2301924A1 | 10319-EP2305640A2 |
| 10319-EP2305642A2 | 10319-EP2305808A1 | 10319-EP2308852A1 |
| 10319-EP2311455A1 | 10319-EP2311824A1 | 10319-EP2311830A1 |
| 10319-EP2314584A1 | 10319-EP2316452A1 | 10319-EP2316459A1 |
| 10319-EP2380872A1 | 4-(Hydrazinocarbonyl)pyridine | 4-Pyridinecarbonylhydrazine |
| 4-Pyridinecarboxylic acid hydrazide | 4-Pyridinecarboxylic acid, hydrazide | 4-Pyridinecarboxylic hydrazide |
| 4-Pyridylcarbonyl hydrazide | 4-Pyridylcarbonylhydrazide | 4-pyridinecarbohydrazide |
| 4-pyridinecarbohydrazide(Isoniazid) | 40687-EP2298761A1 | 40687-EP2311830A1 |
| 5015 R.P | 5015 R.P. | 5015 RP |
| 54-85-3 | AB00052025 | AB00052025-20 |
| AB00052025-21 | AB00052025_22 | AB00052025_23 |
| AB00052025_24 | AB00052025_25 | AB1009474 |
| ACMC-209ljq | AE-641/02310003 | AI3-23936 |
| AK-46317 | AKOS000119062 | ANW-32196 |
| ARONIS25141 | AZT + Isoniazid | Abdizide |
| Andrazide | Anidrasona | Antimicina |
| Antituberkulosum | Armacide | Armazid |
| Armazide | Atcotibine | Azuren |
| BB 0240534 | BBL008409 | BCP13791 |
| BDBM50336507 | BIDD:GT0140 | BP 5015 |
| BPBio1_000025 | BPBio1_001322 | BRD-K87202646-001-26-8 |
| BSPBio_000021 | BSPBio_002204 | Bacillin |
| Biomol-NT_000288 | C07054 | C6H7N3O |
| CAS-54-85-3 | CCG-39710 | CCRIS 351 |
| CHEBI:6030 | CHEMBL64 | CPD000059082 |
| CS-2371 | Cedin | Cedin (Aerosol) |
| Cemidon | Chemiazid | Chemidon |
| Continazine | Cortinazine | Cotinazin |
| Cotinizin | D00346 | DB00951 |
| DSSTox_CID_755 | DSSTox_GSID_20755 | DSSTox_RID_75771 |
| DTXSID8020755 | Defonin | Dibutin |
| Diforin | Dinacrin | Ditubin |
| DivK1c_000070 | Dow-Isoniazid | EINECS 200-214-6 |
| Ebidene | Epitope ID:141801 | Eralon |
| Ertuban | Eutizon | Evalon |
| F0391-0007 | FRS-3 | FSR 3 |
| FSR-3 | FT-0627424 | Fetefu |
| Fimalene | GINK | HIA |
| HMS1568B03 | HMS1920H09 | HMS2089I16 |
| HMS2091N19 | HMS2095B03 | HMS2234G04 |
| HMS3259E19 | HMS3373O01 | HMS3655L03 |
| HMS3712B03 | HMS500D12 | HSDB 1647 |
| HY-B0329 | Hid rasonil | Hidranizil |
| Hidrasonil | Hidrulta | Hidrun |
| Hycozid | Hydra | Hydrazid |
| Hydrazide | Hyozid | Hyzyd |
| I.A.I | I.A.I. | I0138 |
| IDI1_000070 | INH | INH |
| INHd20 | ISONICOTINIC ACID HYDRAZIDE(ISONIAZIDE) | Ido-tebin |
| Idrazide dell'acido isonicotinico | Idrazide dell'acido isonicotinico [Italian] | Idrazil |
| In-73 | InChI=1/C6H7N3O/c7-9-6(10)5-1-3-8-4-2-5/h1-4H,7H2,(H,9,10 | Inah |
| Inh-Burgthal | Inizid | Iscotin |
| Isidrina | Ismazide | Isobicina |
| Isocid | Isocidene | Isocotin |
| Isohydrazide | Isokin | Isolyn |
| Isonerit | Isonex | Isoniacid |
| Isoniazid (JP17/USP/INN) | Isoniazid (Tubizid) | Isoniazid SA |
| Isoniazid [INN:BAN:JAN] | Isoniazid [USP:INN:BAN:JAN] | Isoniazid daily for 9 months |
| Isoniazid(Tubizid) | Isoniazid, European Pharmacopoeia (EP) Reference Standard | Isoniazid, Pharmaceutical??Secondary??Standard;??Certified??Reference??Material |
| Isoniazid, United States Pharmacopeia (USP) Reference Standard | Isoniazid, Vetec(TM) reagent grade, 98% | Isoniazid, analytical standard, >=99% (TLC) |
| Isoniazid, certified reference material, TraceCERT(R) | Isoniazida | Isoniazida [INN-Spanish] |
| Isoniazide | Isoniazidum | Isoniazidum [INN-Latin] |
| Isonicazide | Isonicid | Isonico |
| Isonicotan | Isonicotil | Isonicotinhydrazid |
| Isonicotinic acid hydrazide | Isonicotinic acid hydrazide | Isonicotinic acid hydrazide (Isoniazid) |
| Isonicotinic acid hydrazide(Isoniazid) | Isonicotinic acid hydrazide, 99% | Isonicotinic hydrazide |
| Isonicotinic hydrazide | Isonicotinohydrazide | Isonicotinoyl hydrazide |
| Isonicotinoylhydrazine | Isonicotinsaeurehydrazid | Isonicotinsaeurehydrazid [German] |
| Isonicotinyl hydrazide | Isonicotinylhydrazide | Isonicotinylhydrazine |
| Isonide | Isonidrin | Isonikazid |
| Isonilex | Isonin | Isonindon |
| Isonirit | Isoniton | Isonizida |
| Isonizide | Isotamine | Isotebe |
| Isotebezid | Isotinyl | Isozid |
| Isozide | Isozyd | KBio1_000070 |
| KBio2_001333 | KBio2_003901 | KBio2_006469 |
| KBio3_001424 | KBioGR_000423 | KBioSS_001333 |
| KS-00000JHE | KS-0000471R | KSC-27-048 |
| KUC109571N | L 1945 | LANIZID |
| LS-205 | Laniazid | Laniazid (TN) |
| Laniozid | MCULE-6324947959 | MFCD00006426 |
| MFCD00006426 (97%) | MLS000069444 | MLS001055327 |
| Mayambutol | Mybasan | NC00513 |
| NCGC00016244-01 | NCGC00016244-02 | NCGC00016244-03 |
| NCGC00016244-04 | NCGC00016244-05 | NCGC00016244-06 |
| NCGC00016244-07 | NCGC00016244-08 | NCGC00016244-09 |
| NCGC00016244-10 | NCGC00016244-11 | NCGC00016244-12 |
| NCGC00016244-14 | NCGC00016244-15 | NCGC00022648-03 |
| NCGC00022648-04 | NCGC00022648-05 | NCGC00022648-06 |
| NCGC00022648-07 | NCGC00254094-01 | NCGC00258919-01 |
| NINDS_000070 | NIZ | NSC 9659 |
| NSC-757078 | NSC-9659 | NSC757078 |
| NSC9659 | Neo-Tizide | Neoteben |
| Neoxin | Neumandin | Nevin |
| Niadrin | Nicazide | Nicetal |
| Nicizina | Niconyl | Nicotibina |
| Nicotibine | Nicotisan | Nicozide |
| Nidaton | Nidrazid | Nikozid |
| Niplen | Nitadon | Niteban |
| Nitebannsc 9659 | Nydrazid | Nyscozid |
| Opera_ID_454 | Oprea1_396155 | PS-4129 |
| Pelazid | Percin | Pharmakon1600-01500355 |
| Phthisen | Preparation 6424 | Prestwick0_000161 |
| Prestwick1_000161 | Prestwick2_000161 | Prestwick3_000161 |
| Prestwick_578 | Pycazide | Pyreazid |
| Pyricidin | Pyridicin | Pyrizidin |
| Q423169 | QRXWMOHMRWLFEY-UHFFFAOYSA-N | RP 5015 |
| RP-5015 | RTR-019381 | RU-EF-Tb |
| RY-EF-Tb | Raumanon | Razide |
| Retozide | Rifater (Salt/Mix) | Rimicid |
| Rimifon | Rimiphone | Rimitsid |
| Robiselin | Robisellin | Roxifen |
| SAM002554904 | SBB004195 | SBI-0051419.P003 |
| SC-12623 | SCHEMBL228 | SCHEMBL2998929 |
| SMR000059082 | SPBio_000094 | SPBio_001942 |
| SPECTRUM1500355 | SR-01000003025 | SR-01000003025-2 |
| SR-01000003025-3 | ST078858 | ST24025094 |
| STK086288 | STR00210 | SW196752-3 |
| SY010614 | Sanohidrazina | Sauterazid |
| Sauterzid | Soniazid,(S) | Spectrum2_000107 |
| Spectrum3_000472 | Spectrum4_000022 | Spectrum5_000876 |
| Spectrum_000853 | Stanozide | T7976 |
| TB-Phlogin | TB-Razide | TB-Vis |
| TR-019381 | Tebecid | Tebenic |
| Tebexin | Tebilon | Tebos |
| Teebaconin | Tekazin | Tibazide |
| Tibemid | Tibiazide | Tibinide |
| Tibison | Tibivis | Tibizide |
| Tibusan | Tisin | Tisiodrazida |
| Tizide | Tox21_113640 | Tox21_113640_1 |
| Tox21_201367 | Tox21_300193 | Tubazid |
| Tubazide | Tubeco | Tubecotubercid |
| Tuberian | Tubicon | Tubilysin |
| Tubizid | Tubomel | Tyvid |
| UNII-V83O1VOZ8L | UPCMLD0ENAT5791176:001 | Unicocyde |
| Unicozyde | Usaf cb-2 | V83O1VOZ8L |
| Vazadrine | Vederon | WLN: T6NJ DVMZ |
| Z58981801 | ZINC1590 | Zidafimia |
| Zinadon | Zonazide | [(4-Pyridinylcarbonyl)oxy]hydrazine |
| bacillen | bp 5 015 | component of Niadox (Salt/Mix) |
| isoco tin | isoniazid | isoniazid (inh) |
| isonicotinate hydrazide | isonicotinhydrazide | isonicotinic acid hydrazid |
| isonicotinic acid hydrazone | isonicotinicacid hydrazide | isonicotinoylhydrazide |
| isozid e | nidra zid | pyridine-4-carbohydrazide |
| pyridine-4-carboxylic acid hydrazide | rimif on | s1937 |
| tebemid | tubercid |