Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
---|---|---|---|---|---|---|---|---|
ELECTRON TRANSPORT CHAIN | 3 nM | NADH–Q | decrease | IC50 | 94 | |||
Target | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
---|---|---|---|---|---|---|---|---|
NADH:ubiquinone reductase | 3 nM | NADH–Q | inhibitor | IC50 | 94 | |||
Pictogram | Signal | Statements | Precautionary Statement Codes |
---|---|---|---|
![]() |
Warning |
Aggregated GHS information provided by 167 companies from 4 notifications to the ECHA C&L Inventory. Reported as not meeting GHS hazard criteria by 6 of 167 companies. For more detailed information, please visit ECHA C&L website Of the 2 notification(s) provided by 161 of 167 companies with hazard statement code(s): H302 (98.14%): Harmful if swallowed [Warning Acute toxicity, oral] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P264, P270, P301+P312, P330, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
((non-Isotopelabelled)Benzimidazole-13C6 | 1,3-Benzodiazole | 1,3-Diazaindene |
134823-EP2287165A2 | 134823-EP2287166A2 | 134823-EP2292612A2 |
134823-EP2292620A2 | 157198-80-6 | 1H-1,3-benzodiazole |
1H-Benzimidazole | 1H-Benzo[d]imidazole | 1H-Benzoimidazole |
1H-benzimidazol | 25950-EP2269978A2 | 25950-EP2269985A2 |
25950-EP2269991A2 | 25950-EP2284150A2 | 25950-EP2284151A2 |
25950-EP2284152A2 | 25950-EP2284153A2 | 25950-EP2284155A2 |
25950-EP2284156A2 | 25950-EP2284164A2 | 25950-EP2287140A2 |
25950-EP2287148A2 | 25950-EP2287150A2 | 25950-EP2289871A1 |
25950-EP2292590A2 | 25950-EP2295419A2 | 25950-EP2298732A1 |
25950-EP2298774A1 | 25950-EP2301912A2 | 25950-EP2301913A1 |
25950-EP2301914A1 | 25950-EP2301916A2 | 25950-EP2301918A1 |
25950-EP2301921A1 | 25950-EP2301926A1 | 25950-EP2305637A2 |
25950-EP2308832A1 | 25950-EP2308863A1 | 25950-EP2308875A1 |
25950-EP2309855A1 | 25950-EP2311796A1 | 25950-EP2311797A1 |
25950-EP2311798A1 | 25950-EP2311799A1 | 25950-EP2314558A1 |
25950-EP2371811A2 | 264-EP2269999A1 | 264-EP2270006A1 |
264-EP2270010A1 | 264-EP2270505A1 | 264-EP2271628A1 |
264-EP2272517A1 | 264-EP2272825A2 | 264-EP2272828A1 |
264-EP2272832A1 | 264-EP2274983A1 | 264-EP2275102A1 |
264-EP2275105A1 | 264-EP2275409A1 | 264-EP2275412A1 |
264-EP2277858A1 | 264-EP2280000A1 | 264-EP2280009A1 |
264-EP2281563A1 | 264-EP2281815A1 | 264-EP2281818A1 |
264-EP2281819A1 | 264-EP2281824A1 | 264-EP2284157A1 |
264-EP2284920A1 | 264-EP2287155A1 | 264-EP2289876A1 |
264-EP2292586A2 | 264-EP2292592A1 | 264-EP2292593A2 |
264-EP2292611A1 | 264-EP2292612A2 | 264-EP2294066A1 |
264-EP2295433A2 | 264-EP2298755A1 | 264-EP2298767A1 |
264-EP2298770A1 | 264-EP2298774A1 | 264-EP2301536A1 |
264-EP2301538A1 | 264-EP2301921A1 | 264-EP2301923A1 |
264-EP2301925A1 | 264-EP2301926A1 | 264-EP2301932A1 |
264-EP2302003A1 | 264-EP2305219A1 | 264-EP2305250A1 |
264-EP2305640A2 | 264-EP2305642A2 | 264-EP2305643A1 |
264-EP2305651A1 | 264-EP2305662A1 | 264-EP2305695A2 |
264-EP2305696A2 | 264-EP2305697A2 | 264-EP2305698A2 |
264-EP2305769A2 | 264-EP2308492A1 | 264-EP2308510A1 |
264-EP2308562A2 | 264-EP2308833A2 | 264-EP2308840A1 |
264-EP2308852A1 | 264-EP2308854A1 | 264-EP2308867A2 |
264-EP2308870A2 | 264-EP2309855A1 | 264-EP2311455A1 |
264-EP2311810A1 | 264-EP2311826A2 | 264-EP2311830A1 |
264-EP2311831A1 | 264-EP2311842A2 | 264-EP2314575A1 |
264-EP2314582A1 | 264-EP2314583A1 | 264-EP2314587A1 |
264-EP2315303A1 | 264-EP2315763A1 | 264-EP2316452A1 |
264-EP2316459A1 | 264-EP2371811A2 | 264-EP2371812A1 |
264-EP2372804A1 | 264-EP2377847A1 | 264-EP2378585A1 |
3-Azaindole | 4dsu | 5-23-06-00196 (Beilstein Handbook Reference) |
51-17-2 | 658-EP2281819A1 | 658-EP2298076A1 |
658-EP2298077A1 | 658-EP2301353A1 | 658-EP2305031A1 |
658-EP2305034A1 | 658-EP2305035A1 | 658-EP2305658A1 |
AB1003114 | ACMC-209ks6 | AI3-03737 |
AK109037 | AKOS000119163 | AM81999 |
ANW-31204 | Azindole | B0054 |
BBL007563 | BDBM7939 | BENZIMIDAZOLE |
BRN 0109682 | BZI | Benzimidazol |
Benzimidazole, 98% | Benziminazole | Benzoglyoxaline |
Benzoimidazole | C02009 | CAS-51-17-2 |
CCRIS 5967 | CHEBI:41275 | CHEMBL306226 |
CS-W019944 | CTK1H0637 | DB-002016 |
DB02962 | DSSTox_CID_4573 | DSSTox_GSID_24573 |
DSSTox_RID_77454 | DTXSID8024573 | E24GX49LD8 |
EINECS 200-081-4 | Epitope ID:140095 | F3366-5347 |
FT-0606545 | HMS2233D03 | HMS3370L16 |
HSDB 2797 | HTS027706 | HYZJCKYKOHLVJF-UHFFFAOYSA-N |
Hbim | Hbzim | InChI=1/C7H6N2/c1-2-4-7-6(3-1)8-5-9-7/h1-5H,(H,8,9 |
KS-00000KLW | KSC270M3P | LS-151 |
M020 | MCULE-8167283494 | MFCD00005585 |
MLS001066336 | N,N'-Methenyl-o-phenylenediamine | NCGC00091255-01 |
NCGC00091255-02 | NCGC00257173-01 | NCGC00259656-01 |
NSC 759 | NSC-759 | NSC759 |
PS-5765 | PubChem11074 | Q415190 |
RTR-018244 | SBB004294 | SC-15192 |
SCHEMBL5197771 | SCHEMBL6009 | SCHEMBL6010 |
SMR000471839 | ST2415489 | ST50214470 |
STK397462 | SY012765 | TR-018244 |
Tox21_202107 | Tox21_303321 | UNII-E24GX49LD8 |
W-105914 | WLN: T56 BM DNJ | ZINC331902 |
benz-imidazole | benzimidazole phase alphalpha | benzimidazole phase betaetha |
benzimidazole phase gammaamma | bezimidazole | o-Benzimidazole |
DrugBank Name | Benzimidazole |
DrugBank | DB02962 |
CAS Number | 4746-67-2, 51-17-2 |
PubChem Compound | 5798 |
KEGG Compound ID | C02009 |
ChEBI | 41275 |
ChemSpider | 5593 |
BindingDB | 7939.0 |
Wikipedia | Benzimidazole |