Drug
D0391 | Pyrazinamide
J
J04AM06 Rifampicin, pyrazinamide, ethambutol and isoniazid
[J04AM] Combinations of drugs for treatment of tuberculosis
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
J04AM05 Rifampicin, pyrazinamide and isoniazid
[J04AM] Combinations of drugs for treatment of tuberculosis
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
J04AK01 Pyrazinamide
[J04AK] Other drugs for treatment of tuberculosis
[J04A] DRUGS FOR TREATMENT OF TUBERCULOSIS
[J04] ANTIMYCOBACTERIALS
[J] Antiinfectives for systemic use
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | > 400 µM | 30 mins | mouse | liver mitochondria | Rh123 fluorescence (excitation 485 nm, emission 535 nm) are recorded using a fluorescence multi-well plate reader (mCICCP (20 µM) treatments was considered as the 100% baseline for ΔΨm loss) | decrease | EC20 | 36 |
| RESPIRATION | 107.5 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Rotenone (2µM) was used as 100% baseline for complex I inhibition. | decrease | EC20 | 36 |
| RESPIRATION | 190.9 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Oligomycin A (1µM) was used as 100% baseline for complex II inhibition. | decrease | EC20 | 36 |
| SWELLING | > 400 µM | 30 mins | mouse | liver mitochondria | swelling assay: Absorbance at 545 nm using a fluorescence multi-well plate reader (CaCl2 (50 µM) was considered as the 100% baseline for the swelling ) | increase | EC20 | 36 |
| Target | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| NADH:ubiquinone reductase | 107.5 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Rotenone (2µM) was used as 100% baseline for complex I inhibition. | inhibit | EC20 | 36 |
| Succinate dehydrogenase | 190.9 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Oligomycin A (1µM) was used as 100% baseline for complex II inhibition. | inhibit | EC20 | 36 |
| Cytochrome c | > 400 µM | 30 mins | mouse | liver mitochondria | Cytochrome c release was evaluated using ELISA kit ( 20 µg/ml Alamethicin was used as 100% baseline) | release | EC20 | 36 |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Danger |
Aggregated GHS information provided by 54 companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 2 of 54 companies. For more detailed information, please visit ECHA C&L website Of the 1 notification(s) provided by 52 of 54 companies with hazard statement code(s): H310 (100%): Fatal in contact with skin [Danger Acute toxicity, dermal] H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] H330 (100%): Fatal if inhaled [Danger Acute toxicity, inhalation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P260, P262, P264, P270, P271, P280, P284, P302+P350, P302+P352, P304+P340, P310, P320, P321, P322, P332+P313, P361, P362, P363, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| 2-Carbamylpyrazine | 2-Carbamylpyrazine ;Aldinamid ;Aldinamide | 2-Pyrazinecarboxamide |
| 2-carbamyl pyrazine | 2-pyrazine carboxamide | 2-pyrazinecarboxylic acid amide; |
| 2KNI5N06TI | 5-25-04-00178 (Beilstein Handbook Reference) | 98-96-4 |
| AB00052083 | AB00052083-16 | AB00052083_17 |
| AB00052083_18 | AB0008224 | AB2000278 |
| AC-907/25014068 | ACMC-20aive | ACT01761 |
| AK-94813 | AKOS000120280 | ANW-75384 |
| AZT + Pyrazinamide combination | Aldinamid | Aldinamide |
| B2122 | BB 0253141 | BBL010592 |
| BCP30257 | BDBM228814 | BIDD:GT0228 |
| BPBio1_000515 | BRN 0112306 | BSPBio_000467 |
| BSPBio_002572 | Braccopiral | C01956 |
| C5H5N3O | CAS- 98-96-4 | CAS-98-96-4 |
| CCG-39243 | CCRIS 545 | CHEBI:45285 |
| CHEMBL614 | CPD000036662 | CS-2260 |
| Certified Reference Material | Corsazinmid | D-50 |
| D-50 (VAN) | D00144 | DB-002866 |
| DB00339 | DRG 0124 | DSSTox_CID_1215 |
| DSSTox_GSID_21215 | DSSTox_RID_76014 | DTXSID9021215 |
| Dipimide | DivK1c_000241 | EBD430 |
| EINECS 202-717-6 | EU-0101011 | Eprazin |
| FT-0659757 | Farmizina | GTPL7287 |
| HMS1569H09 | HMS1920N08 | HMS2092E09 |
| HMS2096H09 | HMS2235G17 | HMS3259O04 |
| HMS3263K03 | HMS3371G09 | HMS3655A10 |
| HMS3713H09 | HMS500M03 | HSDB 3576 |
| HY-B0271 | IDI1_000241 | IPEHBUMCGVEMRF-UHFFFAOYSA-N |
| InChI=1/C5H5N3O/c6-5(9)4-3-7-1-2-8-4/h1-3H,(H2,6,9 | Isopas | J10111 |
| KBio1_000241 | KBio2_001382 | KBio2_003950 |
| KBio2_006518 | KBio3_001792 | KBioGR_001851 |
| KBioSS_001382 | KS-00000B7D | KSC-27-052E |
| KSC449E8F | KUC109577N | LP01011 |
| LS-2053 | Lopac-P-7136 | Lopac0_001011 |
| Lynamide | M-7421 | MCULE-6846697749 |
| MFCD00006132 | MFCD00006132 (97+%) | MK 56 |
| MLS000069730 | MLS002222347 | NC00534 |
| NCGC00015833-01 | NCGC00015833-02 | NCGC00015833-03 |
| NCGC00015833-04 | NCGC00015833-05 | NCGC00015833-06 |
| NCGC00015833-07 | NCGC00015833-08 | NCGC00015833-09 |
| NCGC00015833-10 | NCGC00015833-11 | NCGC00015833-12 |
| NCGC00015833-15 | NCGC00015833-16 | NCGC00090695-01 |
| NCGC00090695-03 | NCGC00090695-04 | NCGC00090695-05 |
| NCGC00090695-06 | NCGC00090695-07 | NCGC00256336-01 |
| NCGC00259608-01 | NCGC00261696-01 | NCI-C01785 |
| NINDS_000241 | NSC 14911 | NSC-14911 |
| NSC-757304 | NSC14911 | NSC757304 |
| Novamid | Opera_ID_735 | P 7136 |
| P ezetamid | P0633 | PZA |
| PZA | Pezetamid | Pezetamid;Pyrafat;Zinamide;Tebrazid;Pyrafat;Pyrazinoic acid amide |
| Pharmakon1600-01500518 | Pharozinamide | Piraldina |
| Pirazimida | Pirazinamid | Pirazinamida |
| Pirazinamida [INN-Spanish] | Pirazinamide | Pirazinamide [DCIT] |
| Prazina | Prestwick0_000514 | Prestwick1_000514 |
| Prestwick2_000514 | Prestwick3_000514 | Prestwick_811 |
| Pyrafat | Pyramide | Pyrazide |
| Pyrazinamdie | Pyrazinamid | Pyrazinamide (JP17/USP/INN) |
| Pyrazinamide (Pyrazinoic acid amide) | Pyrazinamide (TN) | Pyrazinamide [INN:BAN:JAN] |
| Pyrazinamide [USP:INN:BAN:JAN] | Pyrazinamide(Pyrazinoic-acid-amide) | Pyrazinamide, 99% |
| Pyrazinamide, British Pharmacopoeia (BP) Reference Standard | Pyrazinamide, European Pharmacopoeia (EP) Reference Standard | Pyrazinamide, Pharmaceutical Secondary Standard |
| Pyrazinamide, United States Pharmacopeia (USP) Reference Standard | Pyrazinamide,(S) | Pyrazinamidum |
| Pyrazinamidum [INN-Latin] | Pyrazine carboxamide | Pyrazine-2-carboxylic acid amide |
| Pyrazineamide | Pyrazinecarboxamide, analytical standard | Pyrazinecarboxylic acid amide |
| Pyrazinoic acid am ide | Pyrazinoic acid amide | Pyrazinoic acid amide |
| Pyrizinamide | Q417571 | Rifafour |
| Rifafour e-200 | Rozide | SAM002554927 |
| SBB004276 | SBI-0050984.P004 | SC-46323 |
| SCHEMBL24102 | SMR000036662 | SPBio_001369 |
| SPBio_002388 | SPECTRUM1500518 | SR-01000076077 |
| SR-01000076077-1 | SR-01000076077-4 | SR-01000076077-6 |
| ST2413707 | ST45022155 | STK801661 |
| SW196945-3 | SY013550 | Spectrum2_001305 |
| Spectrum3_001046 | Spectrum4_001186 | Spectrum5_001026 |
| Spectrum_000902 | T 165 | TR-030381 |
| TS-01626 | Tebrazid | Tebrazio |
| Tisamid | Tox21_110237 | Tox21_110237_1 |
| Tox21_202059 | Tox21_302771 | Tox21_501011 |
| UNII-2KNI5N06TI | Unipyranamide | W-100059 |
| WLN: T6N DNJ BVZ | Z33546644 | ZINC2005 |
| Zinamide | Zinastat | pyrazinamida |
| pyrazinamide | pyrazinamide | pyrazine amide |
| pyrazine carboxylamide | pyrazine-2-carboxamide | pyrazine-2-carboximidic acid |
| pyrazinecarboxamide | pyrazinoic acid amide | s1762 |
| DrugBank Name | Pyrazinamide |
| DrugBank | DB00339 |
| CAS Number | 1246817-81-1, 4238-71-5, 98-96-4 |
| PubChem Compound | 1046 |
| KEGG Compound ID | C01956 |
| KEGG Drug | D00144 |
| PubChem.Substance | 46507478 |
| ChEBI | 45285 |
| PharmGKB | PA451182 |
| ChemSpider | 1017 |
| BindingDB | 228814.0 |
| TTD | DAP000660 |
| Wikipedia | Pyrazinamide |
| HET | PZA |
| DPD | 5937 |