| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| ELECTRON TRANSPORT CHAIN | affect | 80 | ||||||
| Target | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| iron-sulfur clusters | inhibitor | 80 | ||||||
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
![]() ![]() |
Danger |
Aggregated GHS information provided by 49 companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H301 (93.88%): Toxic if swallowed [Danger Acute toxicity, oral] H315 (97.96%): Causes skin irritation [Warning Skin corrosion/irritation] H317 (10.2%): May cause an allergic skin reaction [Warning Sensitization, Skin] H319 (97.96%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (81.63%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P270, P271, P272, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P333+P313, P337+P313, P362, P363, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| .alpha.,.beta.-Dithioglycerol | 004D864 | 1,2-Dimercapto-3-propanol |
| 1,2-Dithioglycerol | 1-Propanol, 2,3-dimercapto | 1-Propanol, 2,3-dimercapto- |
| 1-Propanol,3-dimercapto- | 2, 3-dimercaptopropanol | 2,3 -dimercapto-1-propanol |
| 2,3-Dimercapro | 2,3-Dimercapto-1-propanol | 2,3-Dimercapto-1-propanol, 97.0-100.5% |
| 2,3-Dimercapto-1-propanol, >=98% (iodometric) | 2,3-Dimercaptol-1-propanol | 2,3-Dimercaptopropan-1-ol |
| 2,3-Dimercaptopropanol | 2,3-Disulfanyl-1-propanol # | 2,3-Dithiopropanol |
| 2,3-Mercaptopropan-1-ol | 2,3-Mercaptopropanol | 2,3-bis(sulfanyl)propan-1-ol |
| 2,3-dimercapto-propan-1-ol | 2,3-disulfanylpropan-1-ol | 3-Hydroxy-1,2-propanedithiol |
| 4-01-00-02770 (Beilstein Handbook Reference) | 59-52-9 | AB00051971_02 |
| ACMC-1AQYA | AI3-61820 | AKOS015895110 |
| ANW-33288 | Anti-Lewisite | Antoxol |
| BAL | BAL (TN) | BAL in Oil |
| BCP18145 | BDBM50103608 | BRN 1732058 |
| British Anti-Lewisite | British antilewisite | C-00943 |
| C02924 | C3H8OS2 | CAS-59-52-9 |
| CC-26872 | CCG-39156 | CCRIS 3616 |
| CHEBI:64198 | CHEMBL1597 | CS-0013059 |
| CTK3J1382 | D00167 | D0621 |
| DB-053404 | DB06782 | DIMERCAPROL |
| DMP (VAN) | DSSTox_CID_20461 | DSSTox_GSID_40461 |
| DSSTox_RID_79496 | DTXSID5040461 | Dicaptol |
| Dimercaprol (JP17/USP/INN) | Dimercaprol [INN:BAN:JAN] | Dimercaprol [USP:INN:BAN:JAN] |
| Dimercaprol propanol | Dimercaprolo | Dimercaprolo [DCIT] |
| Dimercaprolum | Dimercaprolum [INN-Latin] | Dimercaptol |
| Dimercaptopropanol (VAN) | Dimerkaprol | Dimerkaprol [Czech] |
| Dimersol | Dithioglycerine | Dithioglycerol |
| Dithioglycerol (VAN) | DivK1c_000997 | EINECS 200-433-7 |
| FCH1115700 | FT-0625021 | Glycerol, 1,2-dithio- |
| Glycerol,2-dithio- | HMS503G15 | HSDB 4004 |
| HY-B1285 | IDI1_000997 | InChI=1/C3H8OS2/c4-1-3(6)2-5/h3-6H,1-2H; |
| KBio1_000997 | KBio2_002516 | KBio2_005084 |
| KBio2_007652 | KBioGR_001890 | KBioSS_002524 |
| LS-122148 | MFCD00004864 | NCGC00013216-01 |
| NCI60_001345 | NINDS_000997 | NSC 39515 |
| NSC 4646 | NSC-39515 | NSC-4646 |
| NSC-760094 | NSC16865 | NSC39515 |
| NSC4646 | NSC760094 | Panobal |
| Pharmakon1600-01500252 | Q413968 | RTR-037211 |
| SBI-0051351.P002 | SCHEMBL15969 | SPBio_001036 |
| SR-05000001839 | SR-05000001839-1 | Spectrum2_001218 |
| Spectrum4_001275 | Spectrum5_001622 | Spectrum_001965 |
| Sulfactin | Sulfactin (VAN) | TR-037211 |
| TRA0055820 | Tox21_110014 | Usaf me-1 |
| W-105317 | WLN: SH1YSH1Q | WQABCVAJNWAXTE-UHFFFAOYSA-N |
| alpha,beta-Dithioglycerol | dimercaptopropanol | dithiopropanol |