Compound
D0595 | 1,4-diaminoanthraquinone
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 0.03±0.01 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 0.22 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 1.24±0.76 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
   |
Danger |
Aggregated GHS information provided by 142 companies from 13 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 30 of 142 companies. For more detailed information, please visit ECHA C&L website Of the 11 notification(s) provided by 112 of 142 companies with hazard statement code(s): H301 (81.25%): Toxic if swallowed [Danger Acute toxicity, oral] H302 (10.71%): Harmful if swallowed [Warning Acute toxicity, oral] H317 (87.5%): May cause an allergic skin reaction [Warning Sensitization, Skin] H373 (86.61%): Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P260, P261, P264, P270, P272, P280, P301+P310, P301+P312, P302+P352, P314, P321, P330, P333+P313, P363, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| rat | LD50 | intraperitoneal | 250mg/kg (250mg/kg) | Gigiena Truda i Professional'nye Zabolevaniya. Labor Hygiene and Occupational Diseases. Vol. 21(12), Pg. 27, 1977. | |
| rat | LD50 | oral | 5790mg/kg (5790mg/kg) | "Sbornik Vysledku Toxixologickeho Vysetreni Latek A Pripravku," Marhold, J.V., Institut Pro Vychovu Vedoucicn Pracovniku Chemickeho Prumyclu Praha, Czechoslovakia, 1972Vol. -, Pg. 121, 1972. | |
| 1,4 - diaminoanthraquinone | 1,4 -diaminoanthraquinone | 1,4-Anthraquinonyldiamine |
| 1,4-DIAMINO-9,10-ANTHRACENEDIONE | 1,4-Diamino anthraquinone | 1,4-Diamino-9,10-anthraquinone |
| 1,4-Diamino-9-10-anthraquinone | 1,4-Diamino-anthraquinone | 1,4-Diaminoanthra-9,10-quinone |
| 1,4-Diaminoanthra-9,10-quinone # | 1,4-Diaminoanthrachinon | 1,4-Diaminoanthrachinon [Czech] |
| 1,4-Diaminoanthraquinone | 1,4-Diaminoanthraquinone (leuco compound) | 1,4-Diaminoanthraquinone, technical grade, 90% |
| 1,4-Diaminoanthraquinone, technical, >=90% (HPLC) | 1,4-bis(azanyl)anthracene-9,10-dione | 1,4-diamino-9,10-dihydroanthracene-9,10-dione |
| 1,4-diaminoanthracene-9,10-dione | 1,4diaminoanthraquinone | 128-95-0 |
| 28D950 | 4-amino-9-hydroxy-1,10-anthraquinone 1-imine | 9, 1,4-diamino- |
| 9,10-Anthracenedione, 1,4-diamino- | 9,10-Dihydroxy-1,4-anthracenediimine | 9,10-dihydroxy-1,4-anthraquinone diimine |
| A805883 | AC-10621 | ACMC-1BT23 |
| AKOS000119645 | ANW-19098 | AS-17181 |
| Acetate Red Violet R | Acetoquinone Light Heliotrope NL | Acetylon Fast Red Violet R |
| Amacel heliotrope R | Amaplast Red Violet P 2R | Anthraquinone, 1,4-diamino- |
| Anthraquinone,4-diamino- | Artisil Direct Violet 2RP | Artisil Violet 2RP |
| BBL034621 | BDBM50094895 | C.I. 61100 |
| C.I. Disperse Violet 1 | C.I. Disperse Violet 9 | C.I. Solvent Violet 11 |
| CAS-128-95-0 | CCG-35461 | CCRIS 5603 |
| CHEMBL86771 | CTK0H4949 | Celanthrene Red Violet R |
| Celliton Fast Red Violet | Celliton Fast Red Violet R | Celliton Fast Red Violet RN |
| Celliton Fast Red Violet RNA-CF | Celliton Fast Violet R | Celliton Red Violet RN |
| Celutate Red Violet RH | Cibacet Violet 2R | Cibacet Violet E 2R |
| Cibacet Violet E2R | Cibacete Violet 2R | Cilla Fast Red Violet RN |
| D0075 | D3539 | DB-041913 |
| DSSTox_CID_21252 | DSSTox_GSID_41252 | DSSTox_RID_79664 |
| DTXSID2041252 | Diacelliton Fast Violet 5R | Disperse Violet K |
| Disperse violet 1 | Dispersive Violet K | Duranol Violet 2R |
| Duranol Violet 2R, 1,4-diamino- | Duranol Violet 2R,4-diamino- | EINECS 204-922-6 |
| FBMQNRKSAWNXBT-UHFFFAOYSA- | FBMQNRKSAWNXBT-UHFFFAOYSA-N | FT-0606834 |
| Fenacet Fast Violet 5R | Gracet Violet 2R | Grasol Violet R |
| InChI=1/C14H10N2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6H,15-16H2; | Interchem Acetate Red Violet RRLF | Interchem Acetate Violet R |
| Interchem Disperse Violet 2RH | Interchem Hisperse Violet 2RH | KS-00000Z2R |
| KSC174S4T | Krisolamine | LS-20651 |
| Leuco 1,4 Diamino Anthraquinone | Lurafix Red Violet RN | MCULE-9284874552 |
| MFCD00001224 | Microsetile Violet 3R | Mideton Fast Red Violet R |
| Miketon Fast Red Violet R | N21HDQ0TKN | NCGC00248139-01 |
| NCGC00254591-01 | NCI60_041728 | NCIMech_000274 |
| NCIOpen2_002876 | NE10085 | NSC 63807 |
| NSC 7833 | NSC-63807 | NSC-7833 |
| NSC63807 | NSC7833 | Nacelan Violet 4R |
| Nyloquinone Violet R | Oil Violet R | Oracet Violet 2R |
| Perliton Violet 3R | Q-200081 | Q27284401 |
| RTR-004036 | Resiren Violet TR | SBB057968 |
| SCHEMBL13219066 | SCHEMBL525762 | ST24026777 |
| ST51007289 | STK805481 | Seacyl Violet R |
| Sectacyl Violet propyl | Serisol Brilliant Violet 2R | Setacyl Violet P-R |
| Setacyl Violet R | Setile Violet 3R | Solvent Violet 11 |
| Sudan Violet | Supracet Brilliant Violet 3R | T543 |
| TR-004036 | Tox21_300683 | Transetile violet P 3R |
| UNII-N21HDQ0TKN | W-108369 | WLN: L C666 BV IVJ DZ GZ |
| ZINC3902902 |
| CAS Number | 128-95-0, 168681-27-4 |
| PubChem Compound | 31420 |