D0596 | 1,4-dihydroxyanthracene-9,10-dione
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 5.24±3.43 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 8.91 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 4.81±8.07 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Warning |
Aggregated GHS information provided by 2140 companies from 12 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 6 of 2140 companies. For more detailed information, please visit ECHA C&L website Of the 10 notification(s) provided by 2134 of 2140 companies with hazard statement code(s): H315 (96.63%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (96.72%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (96.63%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| 1,10-Anthracenedione, 4,9-dihydroxy- | 1,4 Dihydroxy-Anthraquinone | 1,4 dihydroxyanthraquinone |
| 1,4-Anthracenedione, 9,10-dihydroxy- | 1,4-DIHYDROXY-9,10-ANTHRACENEDIONE | 1,4-Dihydroxy-9,10-anthracene-dione |
| 1,4-Dihydroxy-9,10-anthraquinone | 1,4-Dihydroxy-anthraquinone | 1,4-Dihydroxyanthra-9,10-quinone |
| 1,4-Dihydroxyanthra-9,10-quinone # | 1,4-Dihydroxyanthrachinon | 1,4-Dihydroxyanthrachinon [Czech] |
| 1,4-Dihydroxyanthraquinone | 1,4-Dihydroxyanthraquinone(Crude) | 1,4-Dihydroxyanthraquinone, 96% |
| 1,4-Dihydroxyanthraquinone, purum, >=98.0% (HPLC), powder, red-brown | 1,4-Dioxyanthraquinone | 1,4-Dioxyanthraquinone [Russian] |
| 1,4-Doa | 1,4-Doa [Russian] | 1,4-dihydroxy-anthracene-9,10-dione |
| 1,4-dihydroxyanthracene-9,10-dione | 103220-12-8 | 38572-74-6 |
| 38572-75-7 | 4,9-dihydroxy-1,10-anthraquinone | 81-64-1 |
| 8S496ZV3CS | 9, 1,4-dihydroxy- | 9,10-Anthracenedione, 1,4-dihydroxy- |
| 9,10-Dihydroxy-1,4-anthraquinone | AB1002106 | AC-11267 |
| ACMC-209uj4 | ACon1_000101 | AE-641/02529036 |
| AI3-17616 | AK155883 | AKOS001595052 |
| ANW-43838 | AS-14244 | Anthraquinone, 1,4-dihydroxy- |
| BB0294638 | BBL010354 | BDBM50240382 |
| C.I. 58050 | CAS-81-64-1 | CCG-48149 |
| CCRIS 3524 | CHEBI:37487 | CHEMBL17594 |
| CI 58050 | CTK1B4776 | CTK1B4777 |
| CTK3J0718 | Chinizarin | D0243 |
| DSSTox_CID_24464 | DSSTox_GSID_44464 | DSSTox_RID_80248 |
| DTXSID8044464 | EC 201-368-7 | EINECS 201-368-7 |
| F1565-0160 | FT-0657575 | GUEIZVNYDFNHJU-UHFFFAOYSA-N |
| HSDB 5242 | InChI=1/C14H8O4/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6,15-16; | K456 |
| KS-00000C2P | KSC490O1R | LS-20669 |
| MCULE-3130863142 | MEGxp0_001867 | MFCD00001209 |
| Macrolex Orange GG | NCGC00160196-01 | NCGC00160196-02 |
| NCGC00255951-01 | NCI60_001089 | NSC 15367 |
| NSC 646569 | NSC-15367 | NSC-229036 |
| NSC-40899 | NSC-646569 | NSC15367 |
| NSC229036 | NSC40899 | NSC646569 |
| PubChem10115 | Q906609 | Quinizarin |
| Quinizarin (Sublimed) | Quinizarin, 96% | Quinizarine |
| Quinzarine | RTR-031317 | SBB069501 |
| SC-06850 | SCHEMBL160038 | SCHEMBL2639287 |
| SR-01000108129 | SR-01000108129-1 | SR-01000637713-1 |
| ST24036851 | ST50330576 | STK264108 |
| Smoke Orange R | Solvent Orange 86 | TR-031317 |
| TRA0070047 | Tox21_302041 | UNII-8S496ZV3CS |
| W-104202 | WLN: L C666 BV IVJ DQ GQ | ZINC3847495 |