Compound
D0610 | 1h-benzo[de]isoquinoline-1,3(2h)-dione
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 8.31±3.47 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 14.13 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 5.56±8.92 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Warning |
Aggregated GHS information provided by 123 companies from 3 notifications to the ECHA C&L Inventory. Reported as not meeting GHS hazard criteria by 84 of 123 companies. For more detailed information, please visit ECHA C&L website Of the 2 notification(s) provided by 39 of 123 companies with hazard statement code(s): H302 (97.44%): Harmful if swallowed [Warning Acute toxicity, oral] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P264, P270, P301+P312, P330, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| 1,2-Dihydrobenzo[cd]indol-2-one, tech | 1,3-dioxo-1H-benz[de]isoquinoline | 1,8 naphthalimide |
| 1,8-Naphthalenedicarboximide | 1,8-Naphthalimide | 1,8-Naphthalimide, 99% |
| 1.8-naphthalimide | 1H-Benz(de)isoquinoline-1,3(2H)-dione | 1H-Benz[de]isoquinoline-1,3(2H)-dione |
| 1H-Benzo[de]isoquinoline-1,3(2H)-dione | 1H-Benzo[de]isoquinoline-1,3(2H)-dione # | 2,3-dihydro-1H-benz[de]isoquinoline-1,3-dione |
| 2,3-dihydro-1H-benzo[de]isoquinoline-1,3-dione | 3-AZATRICYCLO[7.3.1.0?,(1)(3)]TRIDECA-1(13),5,7,9,11-PENTAENE-2,4-DIONE | 3-azatricyclo[7.3.1.0,(1)(3)]trideca-1(13),5,7,9,11-pentaene-2,4-dione |
| 3ess | 81-83-4 | A840204 |
| AC-10624 | AKOS000266805 | BBL013164 |
| BDBM50106194 | BTB12933 | Benzo[de]isoquinoline-1,3-dione |
| CAS-81-83-4 | CHEMBL339586 | CTK3E8107 |
| DSSTox_CID_24731 | DSSTox_GSID_44731 | DSSTox_RID_80428 |
| DTXSID0044731 | EC 201-379-7 | EINECS 201-379-7 |
| FT-0607055 | GI0TV19GBN | H2950 |
| HMS1607L09 | InChI=1/C12H7NO2/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13-11/h1-6H,(H,13,14,15); | K912 |
| KS-00000WKL | KSC448C0P | MCULE-8827702793 |
| MFCD00006920 | N0456 | NCGC00256025-01 |
| NSC 11011 | NSC-11011 | NSC11011 |
| Naphthalene-1,8-dicarboximide | Naphthalimide | Naphthalimide (8CI) |
| Oprea1_068295 | Oprea1_308401 | Q-200093 |
| Q27279115 | SBB038560 | SCHEMBL2487811 |
| SCHEMBL57038 | ST45024436 | STK874285 |
| STR06670 | Tox21_301585 | UNII-GI0TV19GBN |
| XJHABGPPCLHLLV-UHFFFAOYSA- | XJHABGPPCLHLLV-UHFFFAOYSA-N | ZINC24215 |
| CAS Number | 130-00-7, 81-83-4 |
| PubChem Compound | 66491 |