D0619 | 1-nitronaphthalene
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 59.74±7.06 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | human | HepG2 | MMP assay | Negative | IC50 | 163 | ||
| MEMBRANE POTENTIAL | 45.86±14.67 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
     |
Danger |
Aggregated GHS information provided by 56 companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H228 (78.57%): Flammable solid [Danger Flammable solids] H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] H315 (21.43%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (21.43%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (21.43%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H351 (21.43%): Suspected of causing cancer [Warning Carcinogenicity] H411 (32.14%): Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P210, P240, P241, P261, P264, P270, P271, P273, P280, P281, P301+P310, P302+P352, P304+P340, P305+P351+P338, P308+P313, P312, P321, P330, P332+P313, P337+P313, P362, P370+P378, P391, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| .alpha.-Nitronaphthalene | 1-NITRONAPHTHALENE | 1-Nitro-4-phenylbenzene;4-nitro-1-biphenyl;4-nitro-bipheny |
| 1-Nitro-Naphthalene | 1-Nitronaftalen | 1-Nitronaftalen [Czech] |
| 1-Nitronaphthalene 10 microg/mL in Cyclohexane | 1-Nitronaphthalene, 99% | 1-Nitronaphthalene, BCR(R) certified Reference Material |
| 1-Nitronaphthalene, purum, >=98.0% (GC) | 1-Nitronaphthaline | 1-nitronapthalene |
| 27254-36-0 | 86-57-7 | A24106 |
| A51NP1DL2T | AC-29181 | ACMC-1CJ12 |
| AE-562/40180003 | AI3-00477 | AKOS000120000 |
| BRN 1867714 | C14040 | CAS-86-57-7 |
| CCRIS 450 | CHEBI:34104 | CHEMBL165373 |
| CTK1A4858 | DB-056461 | DB-056938 |
| DSSTox_CID_978 | DSSTox_GSID_20978 | DSSTox_RID_75901 |
| DTXSID7020978 | EINECS 201-684-5 | FT-0608156 |
| HSDB 2887 | InChI=1/C10H7NO2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7; | KS-000011H3 |
| KSC204Q5R | LS-1855 | LS-94800 |
| MCULE-5592798733 | MFCD00003913 | Mononitronaphthalene |
| N0212 | NCGC00091715-01 | NCGC00091715-02 |
| NCGC00091715-03 | NCGC00256373-01 | NCGC00258958-01 |
| NCI-C01956 | NE10285 | NITRONAPHTHALENE |
| NSC 9584 | NSC-9584 | NSC9584 |
| Naphthalene, 1-nitro- | Naphthalene, alpha-nitro- | Naphthalene, mononitro- |
| Naphthalene, nitro- | Nitrol | Nitrol (VAN) |
| Nitrol (pesticide) | Nitronaphthalene [UN2538] [Flammable solid] | Nitronaphthalene [UN2538] [Flammable solid] |
| Nitronaphthalin | Q14848739 | RJKGJBPXVHTNJL-UHFFFAOYSA-N |
| RTR-026964 | SBB057510 | SC-74516 |
| SCHEMBL57184 | ST50406229 | STR03423 |
| TR-026964 | TRA0050251 | Tox21_201407 |
| Tox21_302759 | UN2538 | UNII-A51NP1DL2T |
| WLN: L66J BNW | ZINC1700069 | alpha-Nitronaphthalene |
| alpha-nitro-naphthalene | nitro-naphthalene |