D0654 | 2,6-diaminopyridine
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 31.28±10.35 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 35.48 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 20.88±15.73 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Danger |
Aggregated GHS information provided by 117 companies from 14 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H301 (99.15%): Toxic if swallowed [Danger Acute toxicity, oral] H312 (34.19%): Harmful in contact with skin [Warning Acute toxicity, dermal] H315 (91.45%): Causes skin irritation [Warning Skin corrosion/irritation] H317 (13.68%): May cause an allergic skin reaction [Warning Sensitization, Skin] H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (90.6%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P270, P271, P272, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P333+P313, P337+P313, P362, P363, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| mouse | LD50 | intraperitoneal | 100mg/kg (100mg/kg) | Journal of Medicinal Chemistry. Vol. 8, Pg. 296, 1965. | |
| mouse | LD50 | intravenous | 56mg/kg (56mg/kg) | U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#00146, | |
| 118352-40-2 | 141-86-6 | 141-86-6 2,6-diaminopyridine |
| 19234-EP2289868A1 | 19234-EP2314576A1 | 2, 6-Diaminopyridine |
| 2,6-Diamino pyridine | 2,6-Diaminopyridine | 2,6-Diaminopyridine, 98% |
| 2,6-Diaminopyridine, Vetec(TM) reagent grade, 98% | 2,6-diamino-pyridine | 2,6-diaminopyrdine |
| 2,6-pyridinediamine | 2-Pyridinamine, 1,6-dihydro-6-imino-, (E)- (9CI) | 26-DAP |
| 26D | 48996-EP2308833A2 | 48996-EP2311823A1 |
| 5-22-11-00255 (Beilstein Handbook Reference) | 6-amino-2-iminopyridine | AB1005198 |
| AC-10706 | AC-907/25014391 | ACMC-209cn1 |
| ACT07294 | AI3-18054 | AK-33251 |
| AKOS000119875 | AM20070129 | ANW-20651 |
| BBL011548 | BCP27453 | BIDD:GT0354 |
| BR-33251 | BRN 0108513 | CAS-141-86-6 |
| CCRIS 6682 | CHEMBL339234 | CS-W020019 |
| CTK0H5126 | D1154 | DAP (amine) |
| DB-013980 | DSSTox_CID_20127 | DSSTox_GSID_40127 |
| DSSTox_RID_79444 | DTXSID0040127 | EINECS 205-507-2 |
| F8881-0498 | FT-0610533 | InChI=1/C5H7N3/c6-4-2-1-3-5(7)8-4/h1-3H,(H4,6,7,8; |
| K89AB8CKG6 | KS-00000A2K | KSC175C2N |
| LS-131134 | MCULE-6883306972 | MFCD00006329 |
| NCGC00249093-01 | NCGC00257467-01 | NCGC00259203-01 |
| NSC 1921 | NSC-1921 | NSC1921 |
| PS-9269 | PubChem15371 | Q-200205 |
| Q15725608 | RTR-032282 | SBB004340 |
| SC-25615 | SCHEMBL64599 | ST24032301 |
| ST51046568 | STL146681 | STR00979 |
| TR-032282 | TRA0087203 | Tox21_201654 |
| Tox21_303403 | UNII-K89AB8CKG6 | VHNQIURBCCNWDN-UHFFFAOYSA-N |
| WLN: T6NJ BZ FZ | WT555 | Z1250100664 |
| ZINC333587 | pyridine, 2,6-diamino- | pyridine-2,6-diamine |
| pyridine-2,6-diyldiamine |
| CAS Number | 118352-39-9, 118352-40-2, 141-86-6, 14338-93-3 |
| PubChem Compound | 8861 |