D0662 | 2-amino-5-nitrophenol
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 27.40±14.08 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 35.48 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 52.13±17.74 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
   |
Warning |
Aggregated GHS information provided by 2183 companies from 12 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H315 (95.97%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (99.91%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (95.92%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H351 (93.77%): Suspected of causing cancer [Warning Carcinogenicity] H411 (97.57%): Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P261, P264, P271, P273, P280, P281, P302+P352, P304+P340, P305+P351+P338, P308+P313, P312, P321, P332+P313, P337+P313, P362, P391, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H317: May cause an allergic skin reaction [Warning Sensitization, Skin] |
P261, P272, P280, P302+P352, P321, P333+P313, P363, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| rat | LD50 | intraperitoneal | > 800mg/kg (800mg/kg) | Journal of Toxicology and Environmental Health. Vol. 2, Pg. 657, 1977. | |
| rat | LD50 | oral | > 4gm/kg (4000mg/kg) | Journal of Toxicology and Environmental Health. Vol. 2, Pg. 657, 1977. | |
| 0149H05U82 | 1-hydroxy-2-amino-5-nitrobenzene | 121-88-0 |
| 2-AMINO-5-NITRO PHENOL | 2-AMINO-5-NITROPHENOL | 2-Amino-5-nitro-phenol |
| 2-Amino-5-nitrophenol, 95% | 2-Amino-5-nitrophenol, technical grade, 90% | 2-Hydroxy-4-nitroaniline |
| 2-amino 5-nitro phenol | 2-amino 5-nitrophenol | 2-amino5-nitrophenol |
| 2-azanyl-5-nitro-phenol | 2-hydroxy 4-nitro aniiine | 2-hydroxy 4-nitro aniline |
| 2-hydroxy 4nitro aniline | 2-hydroxy-4-nitro-aniline | 3-Hydroxy-4-aminonitrobenzene |
| 3-Nitro-6-aminophenol | 4-nitro 2-hydroxy aniline | 5-Nitro-2-aminophenol |
| 5-nitro 2-amino phenol | 5-nitro 2-aminophenol | 5-nitro-2-amino-1-hydroxybenzene |
| A804805 | AB1007368 | AC-2526 |
| ACMC-1BP6I | ACT00522 | AI3-52548 |
| AKOS000119830 | AKOS025395599 | ANW-17914 |
| AS-11963 | BBL016365 | BP-13475 |
| BR-30758 | BRN 0972974 | C.I. 76535 |
| C19322 | CAS-121-88-0 | CCRIS 754 |
| CHEBI:82384 | CHEMBL164989 | CI 76535 |
| CTK0H4886 | DB-027785 | DOPJTDJKZNWLRB-UHFFFAOYSA- |
| DOPJTDJKZNWLRB-UHFFFAOYSA-N | DSSTox_CID_63 | DSSTox_GSID_20063 |
| DSSTox_RID_75342 | DTXSID1020063 | EC 204-503-8 |
| EINECS 204-503-8 | F0020-1814 | FT-0611182 |
| HSDB 4168 | InChI=1/C6H6N2O3/c7-5-2-1-4(8(10)11)3-6(5)9/h1-3,9H,7H2; | KS-00000UNR |
| KSC174Q8N | LS-656 | M-7397 |
| MCULE-1718604716 | MFCD00007692 | N.C.I. C55970 |
| N.C.I. C55970 | N.C.I. C55970 | N0113 |
| NCGC00091650-01 | NCGC00091650-02 | NCGC00091650-03 |
| NCGC00091650-04 | NCI C55970 | NSC 7087 |
| NSC-7087 | NSC7087 | Phenol, 2-amino-5-nitro- |
| Phenol, 2-amino-5-nitro- (8CI) | Phenol, 2-amino-5-nitro- (8CI)(9CI) | PubChem8201 |
| Q27155913 | RTR-003543 | Rodol YBA |
| SBB058826 | SC-00608 | SCHEMBL123756 |
| SCHEMBL13176439 | ST2409555 | ST51038539 |
| STL140690 | TR-003543 | TRA0002074 |
| Tox21_400036 | UNII-0149H05U82 | Ursol Yellow Brown A |
| W-108448 | WLN: ZR BQ DNW | ZINC4253742 |