D0664 | 2-aminoanthracene
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 4.71±1.92 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 3.55 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 0.18±0.20 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Warning |
Aggregated GHS information provided by 43 companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H315 (90.7%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (90.7%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (88.37%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H341 (11.63%): Suspected of causing genetic defects [Warning Germ cell mutagenicity] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P261, P264, P271, P280, P281, P302+P352, P304+P340, P305+P351+P338, P308+P313, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| .beta.-Aminoanthracene | 2-ANTHRACENAMINE | 2-Aminoanthracene |
| 2-Aminoanthracene 10 microg/mL in Cyclohexane | 2-Aminoanthracene, 96% | 2-Aminoanthracene, technical, >=90% (HPLC) |
| 2-Anthracenamide | 2-Anthracylamine | 2-Anthramine |
| 2-Anthramine (8CI) | 2-Anthranamine | 2-Anthrylamine |
| 2-aminoanthracen | 613-13-8 | 613A138 |
| 6173AF | 8240818JGU | A833154 |
| ACMC-209mrd | AI3-52501 | AKOS004904683 |
| ANW-33767 | Anthracene, 2-amino | BIDD:ER0574 |
| BIDD:GT0166 | BRN 2209414 | C-08571 |
| C14417 | CAS-613-13-8 | CC-09107 |
| CCRIS 22 | CHEBI:34260 | CHEMBL83154 |
| CTK2F4266 | DB-053837 | DSSTox_CID_4458 |
| DSSTox_GSID_24458 | DSSTox_RID_77406 | DTXSID2024458 |
| EINECS 210-330-9 | FT-0611224 | HMS3039P14 |
| HSDB 4041 | InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2; | KS-00001772 |
| LS-1467 | MCULE-3149525306 | MFCD00003582 |
| MLS002302986 | NCGC00091622-01 | NCGC00091622-02 |
| NCGC00091622-03 | NCGC00257001-01 | NCGC00259116-01 |
| NSC 400535 | NSC-400535 | NSC400535 |
| Q26841182 | RTR-021126 | SBB003612 |
| SCHEMBL103680 | SMR001307303 | ST45026846 |
| STR04539 | TR-021126 | Tox21_201567 |
| Tox21_303299 | UNII-8240818JGU | WLN: L C666J EZ |
| YCSBALJAGZKWFF-UHFFFAOYSA- | YCSBALJAGZKWFF-UHFFFAOYSA-N | ZINC1593346 |
| anthracen-2-amine | beta-Aminoanthracene |