D0672 | 2-hydroxy-4-methoxybenzophenone
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | human | qHTS-HepG2 | MMP assay | Negative | IC50 | 163 | ||
| MEMBRANE POTENTIAL | human | HepG2 | MMP assay | Negative | IC50 | 163 | ||
| MEMBRANE POTENTIAL | 50.14±18.89 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Warning |
Aggregated GHS information provided by 1835 companies from 23 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 140 of 1835 companies. For more detailed information, please visit ECHA C&L website Of the 21 notification(s) provided by 1695 of 1835 companies with hazard statement code(s): H315 (83.66%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (83.66%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (82.6%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H411 (16.81%): Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P271, P273, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P391, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H315: Causes skin irritation [Warning Skin corrosion/irritation] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335: May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] |
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H317: May cause an allergic skin reaction [Warning Sensitization, Skin] |
P261, P272, P280, P302+P352, P321, P333+P313, P363, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| rat | LD50 | oral | 7400mg/kg (7400mg/kg) | Journal of the American College of Toxicology. Vol. 2(5), Pg. 35, 1983. | |
| mouse | LD50 | intraperitoneal | 300mg/kg (300mg/kg) | National Technical Information Service. Vol. AD277-689, | |
| (2-Hydroxy-4-methoxyphenyl)phenylmethanone | (2-hydroxy-4-methoxy-phenyl)-phenyl-methanone | (2-hydroxy-4-methoxyphenyl)(phenyl) methanone |
| (2-hydroxy-4-methoxyphenyl)(phenyl)methanone | (2-hydroxy-4-methoxyphenyl)-phenylmethanone | 1-(cyclopropylcarbonyl)-N-(4-ethoxyphenyl)-3,3-dimethylindoline-5-sulfonamide |
| 131-57-7 | 2-Benzoyl-5-methoxyphenol | 2-HYDROXY-4-METHOXYBENZOPHENONE |
| 2-HYDROXY-4-METHOXYBENZOPHENONE (OXYBENZONE) | 2-Hydroxy-4-methoxybenzophenone 10 microg/mL in Cyclohexane | 2-Hydroxy-4-methoxybenzophenone, 98% |
| 2-Hydroxy-4-methoxybenzophenone, certified reference material, TraceCERT(R) | 2-hydroxy-4-methoxy benzophenone | 2-hydroxy-4-methoxy-benzophenone |
| 2-hydroxy-4-methoxyphenyl phenyl ketone | 4-Methoxy-2-hydroxybenzophenone | 95OOS7VE0Y |
| AB00052063 | AB00052063_13 | AC-11987 |
| ACMC-1BVPH | AE-848/01549044 | AI3-23644 |
| AK-57650 | AKOS000120532 | ALBB-021277 |
| ANW-19363 | AS-13616 | Advastab 45 |
| Anuvex | BBL003220 | BCP25880 |
| BDBM50253134 | BIDD:ER0353 | BPBio1_000742 |
| BRD-K59037100-001-05-5 | BRD-K59037100-001-09-7 | BRN 1913145 |
| BSPBio_000674 | BSPBio_002155 | Benzophenone 3 |
| Benzophenone, 2-hydroxy-4-methoxy- | Benzophenone-3 | Benzophenone-3 (Bp-3) |
| C14285 | CAS-131-57-7 | CCG-40226 |
| CCRIS 1078 | CHEBI:34283 | CHEMBL1625 |
| CS-3186 | CTK0H4604 | Certified Reference Material |
| Chimassorb 90 | Cyasorb UV 9 | Cyasorb UV 9 Light Absorber |
| D05309 | DB01428 | DSSTox_CID_2405 |
| DSSTox_GSID_22405 | DSSTox_RID_76576 | DTXSID3022405 |
| DXGLGDHPHMLXJC-UHFFFAOYSA-N | DivK1c_000184 | DuraScreen |
| DuraScreen (Salt/Mix) | EC 205-031-5 | EINECS 205-031-5 |
| Epitope ID:131795 | Escalol 567 | Eusolex 4360 |
| FT-0612546 | H2437 | HMBP |
| HMS1570B16 | HMS1920D16 | HMS2091L16 |
| HMS2097B16 | HMS2424P09 | HMS3714B16 |
| HMS500J06 | HSDB 4503 | HY-A0067 |
| I956 | IDI1_000184 | InChI=1/C14H12O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-9,15H,1H; |
| KAHSCREEN BZ-3 | KBio1_000184 | KBio2_001529 |
| KBio2_004097 | KBio2_006665 | KBio3_001655 |
| KBioGR_000906 | KBioSS_001529 | KSC174M0J |
| Kopben-3 | LS-742 | MCULE-2222013605 |
| MFCD00008387 | MLS000039797 | MLS001055487 |
| MOB | MOD | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- |
| NCGC00016394-01 | NCGC00016394-02 | NCGC00016394-03 |
| NCGC00016394-04 | NCGC00016394-05 | NCGC00016394-06 |
| NCGC00016394-07 | NCGC00016394-08 | NCGC00016394-10 |
| NCGC00065306-03 | NCGC00065306-04 | NCGC00065306-05 |
| NCGC00065306-06 | NCGC00256323-01 | NCGC00259534-01 |
| NCI-C60957 | NINDS_000184 | NSC 7778 |
| NSC-757260 | NSC-7778 | NSC757260 |
| NSC7778 | Neo heliopan BB | Ongrostab HMB |
| Oprea1_174131 | Oxibenzona | Oxibenzona [INN-Spanish] |
| Oxibenzonum | Oxybenzon | Oxybenzone [USAN:USP:INN] |
| Oxybenzone, Pharmaceutical Secondary Standard | Oxybenzone, United States Pharmacopeia (USP) Reference Standard | Oxybenzone, analytical standard |
| Oxybenzonum | Oxybenzonum [INN-Latin] | Pharmakon1600-01500451 |
| PreSun 15 (Salt/Mix) | Prestwick0_000887 | Prestwick1_000887 |
| Prestwick2_000887 | Prestwick3_000887 | PubChem3274 |
| Q-200287 | Q518114 | RTR-004325 |
| SBB056669 | SBI-0051470.P003 | SCHEMBL15551 |
| SMR000035344 | SPBio_001135 | SPBio_002893 |
| SPECTRUM1500451 | SR-01000610567 | SR-01000610567-2 |
| SR-01000610567-4 | ST029243 | ST2407894 |
| STK057962 | Solaquin (Salt/Mix) | Spectra-sorb UV 9 |
| Spectrum2_001008 | Spectrum3_000538 | Spectrum4_000463 |
| Spectrum5_001337 | Spectrum_001049 | Sunscreen UV-15 |
| Syntase 62 | TR-004325 | TRA0043295 |
| Tox21_110418 | Tox21_110418_1 | Tox21_201985 |
| Tox21_302852 | UF 3 | UNII-95OOS7VE0Y |
| UV 9 | Usaf cy-9 | Uvinul 9 |
| Uvinul M 40 | Uvinul M40 | Uvistat 24 |
| WLN: 1OR CQ DVR | Z1945708085 | ZINC136138 |
| component of Caraloe snow & sun lip balm (Salt/Mix) | component of Presun 23 (Salt/Mix) | component of Presun 29 (Salt/Mix) |
| component of Presun 30 (Salt/Mix) | oxybenzone | s4691 |