D0682 | 2-nitrofluorene
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 12.19±0.86 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 50.12 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 38.15±9.22 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Warning |
Aggregated GHS information provided by 39 companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H351 (100%): Suspected of causing cancer [Warning Carcinogenicity] H411 (100%): Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P273, P281, P308+P313, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
 |
Warning |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H341: Suspected of causing genetic defects [Warning Germ cell mutagenicity] H351: Suspected of causing cancer [Warning Carcinogenicity] |
P201, P202, P264, P270, P281, P301+P312, P308+P313, P330, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| mouse | LD50 | intraperitoneal | 1600mg/kg (1600mg/kg) | JNCI, Journal of the National Cancer Institute. Vol. 62, Pg. 911, 1979. | |
| 191LL4U4GZ | 2-NITRO-9H-FLUORENE | 2-Nitrofluorene |
| 2-Nitrofluorene 10 microg/mL in Cyclohexane | 2-Nitrofluorene, 98% | 2-nitrofluoren |
| 4-05-00-02149 (Beilstein Handbook Reference) | 4CH-015292 | 607-57-8 |
| 9H-Fluorene, 2-nitro- | A832870 | AC-4870 |
| ACMC-1B201 | AI3-08839 | AK-57140 |
| AKOS005615788 | ANW-33568 | AX8077722 |
| BIDD:ER0571 | BR-57140 | BRD-K88965984-001-01-2 |
| BRN 1877983 | C10923 | CAS-607-57-8 |
| CCRIS 1189 | CHEBI:1224 | CHEMBL351487 |
| CTK2F3171 | DB-050480 | DS-1243 |
| DSSTox_CID_971 | DSSTox_GSID_20971 | DSSTox_RID_75898 |
| DTXSID2020971 | EINECS 210-138-5 | FR-2617 |
| FT-0613196 | Fluorene, 2-nitro- | Fluorene, 2-nitro- (8CI) |
| HSDB 2111 | InChI=1/C13H9NO2/c15-14(16)11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H; | KS-000017GT |
| L327 | LS-1446 | M-7527 |
| MCULE-3008908721 | MFCD00001117 | N0201 |
| NCGC00164223-01 | NCGC00164223-02 | NCGC00256317-01 |
| NCGC00259314-01 | NSC 5182 | NSC-5182 |
| NSC5182 | Oprea1_262781 | Q-101155 |
| Q4596909 | RTR-020944 | SBB067185 |
| SC-44637 | SCHEMBL644332 | ST2417125 |
| ST4029907 | STK755573 | TR-020944 |
| TRA0043762 | Tox21_201765 | Tox21_302770 |
| UNII-191LL4U4GZ | WLN: L B656 HHJ ENW | XFOHWECQTFIEIX-UHFFFAOYSA-N |
| ZINC63322 |