D0684 | 2-phenylphenol
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 17.90±1.41 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 28.18 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 53.18±4.32 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Warning |
H315: Causes skin irritation [Warning Skin corrosion/irritation] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335: May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] |
P261, P264, P271, P273, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P391, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
Aggregated GHS information provided by 726 companies from 19 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (99.72%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (100%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H400 (100%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P271, P273, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P391, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
  |
Danger |
H314: Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] H335: May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H341: Suspected of causing genetic defects [Warning Germ cell mutagenicity] H351: Suspected of causing cancer [Warning Carcinogenicity] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] |
P201, P202, P260, P261, P264, P271, P273, P280, P281, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P308+P313, P310, P312, P321, P363, P391, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H315: Causes skin irritation [Warning Skin corrosion/irritation] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] |
P264, P280, P302+P352, P305+P351+P338, P321, P332+P313, P337+P313, and P362; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| cat | LD50 | oral | 500mg/kg (500mg/kg) | FAO Nutrition Meetings Report Series. Vol. 38A, Pg. 47, 1965. | |
| rat | LD50 | oral | 656mg/kg (656mg/kg) | Kenkyu Nenpo--Tokyo-toritsu Eisei Kenkyusho. Annual Report of Tokyo Metropolitan Research Laboratory of Public Health. Vol. 30, Pg. 57, 1979. | |
| mouse | LD50 | oral | 683mg/kg (683mg/kg) | Kenkyu Nenpo--Tokyo-toritsu Eisei Kenkyusho. Annual Report of Tokyo Metropolitan Research Laboratory of Public Health. Vol. 30, Pg. 54, 1979. | |
| (1,1'-Biphenyl)-2-ol | (1,1'-Biphenyl)-2-ol, chlorinated | (1,1-Biphenyl)-2-ol |
| 1,1'-BIPHENYL-2-OL | 1,1'-Biphenyl-2-ol | 1-Hydroxy-2-phenylbenzene |
| 1322-20-9 | 2-Biphenylol | 2-Fenylfenol |
| 2-Fenylfenol [Czech] | 2-HYDROXYBIPHENYL (2-PHENYLPHENOL) | 2-Hydroxy-1,1'-biphenyl |
| 2-Hydroxybifenyl | 2-Hydroxybifenyl [Czech] | 2-Hydroxybiphenyl |
| 2-Hydroxydiphenyl | 2-Hyroxybiphenyl | 2-PHENYLPHENOL |
| 2-Phenyl phenol | 2-Phenylphenol | 2-Phenylphenol |
| 2-Phenylphenol 10 microg/mL in Acetonitrile | 2-Phenylphenol 10 microg/mL in Cyclohexane | 2-Phenylphenol 100 microg/mL in Acetone |
| 2-Phenylphenol [BSI:ISO] | 2-Phenylphenol, 99% | 2-Phenylphenol, 99+% |
| 2-Phenylphenol, >=99%, FG | 2-Phenylphenol, BSI, ISO | 2-Phenylphenol, PESTANAL(R), analytical standard |
| 2-hydroxy biphenyl | 2-phenyl-phenol | 4-06-00-04579 (Beilstein Handbook Reference) |
| 61788-42-9 | 90-43-7 | AC-10362 |
| ACMC-1BW0D | AI3-00062 | AKOS000118750 |
| ANW-75569 | Amocid (TN) | Anthrapole 73 |
| BB 0223993 | BBL022484 | BDBM50308551 |
| BIDD:ER0664 | BRN 0606907 | Biphenyl, 2-hydroxy- |
| Biphenyl-2-o1 | Biphenyl-2-ol | Biphenylol |
| C02499 | C12H10O | CAS-90-43-7 |
| CCRIS 1388 | CH9; | CHEBI:17043 |
| CHEMBL108829 | Caswell No. 623AA | D08367 |
| D343Z75HT8 | DSSTox_CID_1151 | DSSTox_GSID_21151 |
| DSSTox_RID_75978 | DTXSID2021151 | Dowicide |
| Dowicide 1 | Dowicide 1 antimicrobial | Dowicide A |
| E231 | EC 201-993-5 | EINECS 201-993-5 |
| EINECS 262-974-5 | EPA Pesticide Chemical Code 064103 | F0001-2206 |
| FEMA 3959 | FT-0654846 | H2987 |
| HSDB 1753 | Hydroxdiphenyl | Hydroxy-2-ph enylbenzene |
| Hydroxy-2-phenylbenzene | Hydroxybiphenyl | InChI=1/C12H10O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,13 |
| Invalon OP | KS-00000UUP | KSC175S4N |
| Kiwi lustr 277 | LLEMOWNGBBNAJR-UHFFFAOYSA-N | LS-1912 |
| LS10222 | Lyorthol | MCULE-6514278919 |
| MFCD00002208 | MLS002415765 | Manusept |
| NCGC00091595-01 | NCGC00091595-02 | NCGC00091595-03 |
| NCGC00091595-04 | NCGC00091595-05 | NCGC00091595-06 |
| NCGC00254582-01 | NCGC00259964-01 | NCI-C50351 |
| NSC 1548 | NSC-1548 | NSC1548 |
| Nectryl | Nipacide OPP | O-PHENYLPHENOL |
| OPP | OPP [pesticide] | OPP? |
| Orthohydroxydiphenyl | Orthophenyl phenol | Orthophenylphenol |
| Orthoxenol | P0200 | PS-8698 |
| Phenol, o-phenyl- | Phenyl-2 phenol | Phenyl-2 phenol [ISO-French] |
| Phenylphenol | Phenylphenol (ortho-) | Preventol 3041 |
| Preventol O extra | PubChem8909 | Q209467 |
| RTR-030950 | Remol TRF | Rotoline |
| SBB060430 | SCHEMBL29811 | SMR000778031 |
| SR-01000944520 | SR-01000944520-1 | ST24022380 |
| ST50406167 | STK177354 | STR07240 |
| Stellisept | TR-030950 | Tetrosin OE-N |
| Tetrosin oe | Torsite | Tox21_202415 |
| Tox21_300674 | Tumescal 0PE | Tumescal OPE |
| UNII-9P55LV4O0G component LLEMOWNGBBNAJR-UHFFFAOYSA-N | UNII-D343Z75HT8 | Usaf ek-2219 |
| W-100332 | WLN: QR BR | Xenol |
| Z1262254253 | ZINC968134 | [1,1''-biphenyl]-2-ol |
| [1,1'-Biphenyl]-2-ol | o-Biphenylol | o-Diphenylol |
| o-Hydroxybiphenyl | o-Hydroxydiphenyl | o-Phenyl phenol |
| o-Phenylphenol, cosmetic grade | o-Xenol | o-Xonal |
| o-phenyl-phenol | o-phenylphenate | ortho-Phenylphenol |
| ortho-phenylphenate | orthohydroxydipbenyl | sodium o-phenylphenoate |
| sodium ortho-phenylphenol |