Compound
D0685 | 2-propenal,3,3-diphenyl-
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 41.19±19.34 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 56.23 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 17.12±23.88 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Warning |
Aggregated GHS information provided by 38 companies from 1 notifications to the ECHA C&L Inventory. H317 (100%): May cause an allergic skin reaction [Warning Sensitization, Skin] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P272, P280, P302+P352, P321, P333+P313, P363, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| .beta.,.beta.-Diphenylacrolein | .beta.-Phenylcinnamaldehyde | 1210-39-5 |
| 13702-35-7 | 2-Propenal, 3,3-diphenyl- | 2-Propenal,3,3-diphenyl- |
| 2-Propenal,3-diphenyl- | 3,3-DIPHENYL-PROPENAL | 3,3-Diphenylacrolein |
| 3,3-Diphenylacrylaldehyde | 3,3-di(phenyl)prop-2-enal | 3,3-diphenyl-2-propenal |
| 3,3-diphenyl-acrylaldehyde | 3,3-diphenylprop-2-enal | 3,3-diphenylpropenal |
| 4CH-003027 | AK113172 | AKOS015967370 |
| ALBB-024946 | AM20080963 | AX8116598 |
| Acrolein, 3,3-diphenyl- | Acrolein,3-diphenyl- | CAS-1210-39-5 |
| CHEMBL3182992 | CS-W007723 | CTK4B2151 |
| DA-19780 | DB-042371 | DS-6112 |
| DSSTox_CID_29066 | DSSTox_GSID_49210 | DSSTox_RID_83285 |
| DTXSID2049210 | EINECS 214-913-9 | FT-0636941 |
| FT-0654363 | InChI=1/C15H12O/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H; | LS11784 |
| MCULE-4194811760 | MWAFWBDWAWZJGK-UHFFFAOYSA- | MWAFWBDWAWZJGK-UHFFFAOYSA-N |
| NCGC00260346-01 | NSC 87895 | NSC-87895 |
| NSC87895 | R1160 | SBB069595 |
| SCHEMBL376723 | ST24041120 | ST45028078 |
| TX-013351 | Tox21_202800 | UNII-UT7JVZ5FZQ |
| UT7JVZ5FZQ | ZINC2003723 | ZX-AN023460 |
| b-PHENYLCINNAMALDEHYDE | beta,beta-Diphenylacrolein | beta-Phenylcinnamaldehyde |
| beta-phenyl-cinnamaldehyde | diphenylacrolein |
| CAS Number | 1210-39-5, 13702-35-7, 13849-91-7 |
| PubChem Compound | 71027 |