Compound
D0722 | 4,4'-thiodiphenol
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 21.08±2.70 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 25.12 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 24.70±9.79 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Danger |
Aggregated GHS information provided by 53 companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H314 (81.13%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] H319 (16.98%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P337+P313, P363, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| mouse | LD50 | oral | 5500mg/kg (5500mg/kg) | Toksikologiya Novykh Promyshlennykh Khimicheskikh Veshchestv. Toxicology of New Industrial Chemical Substances. For English translation, see TNICS*. Vol. 13, Pg. 154, 1973. | |
| rabbit | LD50 | skin | > 10250mg/kg (10250mg/kg) | BIOFAX Industrial Bio-Test Laboratories, Inc., Data Sheets. Vol. A408, Pg. 1971, | |
| rat | LD50 | oral | 3362mg/kg (3362mg/kg) | BIOFAX Industrial Bio-Test Laboratories, Inc., Data Sheets. Vol. A408, Pg. 1971, | |
| 2664-63-3 | 4,4 -Thiobisphenol | 4,4'-Dihydroxy diphenyl sulfide |
| 4,4'-Dihydroxydiphenyl sulfide | 4,4'-Dihydroxydiphenyl sulfide | 4,4'-Dihydroxydiphenyl sulfide;4,4'-Thiobisphenol |
| 4,4'-Dihydroxydiphenylsulfide | 4,4'-Dioxydiphenyl sulfide | 4,4'-Dioxydiphenylsulfide |
| 4,4'-Thio-diphenol | 4,4'-Thiobis[phenol] | 4,4'-Thiobisphenol |
| 4,4'-Thiodiphenol | 4,4'-Thiodiphenol, 99% | 4,4'-sulfanediyldiphenol |
| 4,4'-thiobis- | 4,4'-thiobis-phenol | 4,4-Dihydroxydiphenyl sulfide |
| 4,4-Dihydroxydiphenylsulfide | 4,4-Thiobis-phenol | 4,4-Thiodiphenol |
| 4,4\'-thiodiphenol | 4,4`-Thiodiphenol | 4-(4-hydroxyphenyl)sulfanylphenol |
| 4-(4-hydroxyphenylthio)phenol | 4-Hydroxyphenyl sulfide | 4-[(4-hydroxyphenyl)sulfanyl]phenol |
| A8K | AB01333629-02 | AB1008427 |
| AC-16455 | ACMC-1CRZX | AKOS000120152 |
| AM84852 | ANW-26033 | BIDD:ER0084 |
| Bis(4-hydroxyphenyl) sulfide | Bis(4-hydroxyphenyl) sulfide | Bis(4-oxyphenyl)sulfide |
| Bis(p-hydroxhphenyl) sulfide | CAS-2664-63-3 | CHEBI:38957 |
| CHEMBL3183502 | CTK1A1977 | D1356 |
| DB-022669 | DFS | DSSTox_CID_27936 |
| DSSTox_GSID_47960 | DSSTox_RID_82688 | DTXSID9047960 |
| EINECS 220-197-9 | F0902-7612 | FT-0623039 |
| InChI=1/C12H10O2S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,13-14H; | J-514035 | KS-00000VTG |
| LS-105157 | MCULE-5935535273 | MFCD00002349 |
| NCGC00248889-01 | NCGC00248889-02 | NCGC00258526-01 |
| NGN288M6MM | NSC 203030 | NSC-203030 |
| NSC203030 | Oprea1_271899 | PHENOL, 4,4'-THIODI- |
| Phenol, 4,4'-thiobis- | Phenol,4'-thiobis- | Phenol,4'-thiodi- |
| PubChem15288 | Q141 | Q27118057 |
| RTR-012050 | SCHEMBL29726 | SR-01000596915 |
| SR-01000596915-1 | ST029271 | STK672128 |
| STR04624 | Sulfide, bis(4-hydroxyphenyl) | TDP |
| TR-012050 | Thiobisphenol | Tox21_200973 |
| UNII-NGN288M6MM | VWGKEVWFBOUAND-UHFFFAOYSA- | VWGKEVWFBOUAND-UHFFFAOYSA-N |
| Z1262327553 | ZINC136154 | p,p'-Dihydroxydiphenyl sulfide |