| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 36.41±10.82 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | human | HepG2 | MMP assay | Negative | IC50 | 163 | ||
| MEMBRANE POTENTIAL | rat | hepatocytes | MMP assay | Negative | IC50 | 163 | ||
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
![]() ![]() |
Warning |
Aggregated GHS information provided by 48 companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H315 (83.33%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (83.33%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (83.33%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H351 (10.42%): Suspected of causing cancer [Warning Carcinogenicity] H412 (10.42%): Harmful to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P261, P264, P271, P273, P280, P281, P302+P352, P304+P340, P305+P351+P338, P308+P313, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| rat | LD50 | oral | > 1600mg/kg (1600mg/kg) | Kodak Company Reports. Vol. 21MAY1971, | |
| 040B457 | 1H-BENZIMIDAZOLE,5-NITRO- | 1H-Benzimidazole, 5-nitro- |
| 1H-Benzimidazole, 6-nitro- | 1h-benzimidazole,6-nitro- | 2ZM |
| 4msa | 4n9c | 5(6)-Nitrobenzimidazole |
| 5(6)-nitro-benzimidazole | 5-NITROBENZIMIDAZOLE | 5-Nitro-1H-benzimidazole |
| 5-Nitro-1H-benzoimidazole | 5-nitro-1H-1,3-benzimidazole | 5-nitro-1H-1,3-benzodiazole |
| 5-nitro-1H-benzo[d]imidazole | 5-nitro-benzimidazole | 5-nitrobenzoimidazol |
| 5-nitrobenzoimidazole | 6-Nitro-1H-benzimidazole | 6-Nitro-1H-benzoimidazole |
| 6-Nitro-benzimidazole | 6-Nitrobenzimidazole | 6-nitro-1H-1,3-benzodiazole |
| 89843-47-0 | 94-52-0 | A7V95AYT2T |
| AB1001576 | AC-11286 | ACMC-209rse |
| AE-641/30196001 | AI3-52609 | AK-86195 |
| AKOS000275609 | AKOS003790796 | AKOS015970456 |
| AM808099 | ANW-40284 | ANW-46429 |
| AS-46775 | BB 0219456 | BBL007924 |
| BCP26862 | BDBM50208881 | Benzimidazole, 5(or 6)-nitro- (6CI,7CI) |
| Benzimidazole, 5-nitro- | Benzimidazole, 5-nitro- (8CI) | Benzimidazole, 6-nitro- |
| CAS-94-52-0 | CCRIS 442 | CHEMBL164921 |
| CTK2I9581 | CTK3J0760 | DB-057506 |
| DSSTox_CID_965 | DSSTox_GSID_20965 | DSSTox_RID_75893 |
| DTXSID8020965 | EINECS 202-341-2 | EU-0067493 |
| F0020-1984 | FT-0620702 | HMS3079A05 |
| HSDB 2864 | InChI=1/C7H5N3O2/c11-10(12)5-1-2-6-7(3-5)9-4-8-6/h1-4H,(H,8,9; | KS-00000WQW |
| L-1302 | LS-1964 | MCULE-7385886412 |
| MFCD00005604 | MLS002637666 | N0152 |
| NCGC00091868-01 | NCGC00091868-02 | NCGC00091868-03 |
| NCGC00091868-04 | NCGC00091868-05 | NCGC00091868-06 |
| NCGC00256398-01 | NCGC00259233-01 | NCI-C01912 |
| NSC 3068 | NSC 58858 | NSC-3068 |
| NSC-58858 | NSC3068 | NSC58858 |
| Oprea1_525754 | Oprea1_664147 | PubChem7543 |
| Q27273738 | RTR-032834 | SBB046252 |
| SC-07411 | SCHEMBL271340 | SMR001305771 |
| SR-01000394488 | SR-01000394488-1 | ST2406329 |
| ST45061660 | STK299272 | T8309 |
| TC-135174 | TR-032834 | Tox21_201684 |
| Tox21_302828 | UNII-A7V95AYT2T | V2292 |
| W-100194 | WLN: T56 BM DNJ HNW | XPAZGLFMMUODDK-UHFFFAOYSA-N |
| ZINC4693007 |
| CAS Number | 27896-84-0, 89843-47-0, 94-52-0 |
| PubChem Compound | 7195 |