| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 30.73±11.46 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | human | HepG2 | MMP assay | Negative | IC50 | 163 | ||
| MEMBRANE POTENTIAL | 44.84±16.33 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
![]() ![]() |
Warning |
Aggregated GHS information provided by 43 companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H302 (90.7%): Harmful if swallowed [Warning Acute toxicity, oral] H312 (90.7%): Harmful in contact with skin [Warning Acute toxicity, dermal] H332 (90.7%): Harmful if inhaled [Warning Acute toxicity, inhalation] H351 (88.37%): Suspected of causing cancer [Warning Carcinogenicity] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P261, P264, P270, P271, P280, P281, P301+P312, P302+P352, P304+P312, P304+P340, P308+P313, P312, P322, P330, P363, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| 2-Cyanonaphtalene | 2-Naphthalenecarbonitrile | 5-20-07-00326 (Beilstein Handbook Reference) |
| 6-Nitro-quinoline | 6-Nitroquinoline | 6-Nitroquinoline, 98% |
| 6-nitro quinoline | 613-50-3 | 7033583N3J |
| A15691 | AB0020539 | AB1007161 |
| AC-5110 | AC-907/25014227 | ACMC-1BCWL |
| ACN-036036 | ACT06145 | AI3-08863 |
| AK-30062 | AKOS000131406 | ANW-75512 |
| BBL034646 | BCP27373 | BR-30062 |
| BRN 0136138 | CAS-613-50-3 | CCRIS 456 |
| CHEMBL353078 | CS-W017512 | DB-012204 |
| DSSTox_CID_984 | DSSTox_GSID_20984 | DSSTox_RID_75906 |
| DTXSID1020984 | EBD22708 | EINECS 210-346-6 |
| F0848-0299 | FT-0621280 | InChI=1/C9H6N2O2/c12-11(13)8-3-4-9-7(6-8)2-1-5-10-9/h1-6; |
| J-200080 | KS-00000FOK | KSC183E1L |
| LS-7561 | LS20704 | M-2734 |
| MCULE-5295943927 | MFCD00006799 | N0252 |
| NCGC00248666-01 | NCGC00258062-01 | NSC 4141 |
| NSC-4141 | NSC4141 | Oprea1_316994 |
| Oprea1_756562 | PubChem20822 | Q27265819 |
| QUINOLINE, 6-NITRO- | RTC-062234 | SBB069204 |
| SC-26712 | SCHEMBL366012 | SMHPLBXIVNQFBA-UHFFFAOYSA-N |
| SR-01000473458 | SR-01000473458-1 | ST24029835 |
| ST50036739 | STL426671 | STR06205 |
| SY008973 | TC-062234 | TRA0029722 |
| Tox21_200508 | UNII-7033583N3J | V1443 |
| ZINC331721 | ZLC0063 | zlchem 253 |
| CAS Number | 613-50-3 |
| PubChem Compound | 11945 |