| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 11.01±1.41 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 13.77 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 11.87±7.79 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
![]() |
Warning |
Aggregated GHS information provided by 72 companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 8 of 72 companies. For more detailed information, please visit ECHA C&L website Of the 6 notification(s) provided by 64 of 72 companies with hazard statement code(s): H302 (62.5%): Harmful if swallowed [Warning Acute toxicity, oral] H315 (29.69%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (39.06%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P264, P270, P280, P301+P312, P302+P352, P305+P351+P338, P321, P330, P332+P313, P337+P313, P362, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| 1,10-Anthracenedione, 2,9-dihydroxy- | 1,10-dihydroxy-2,9-anthraquinone | 1,2-Anthraquinonediol |
| 1,2-Dihydroxy anthraquinone | 1,2-Dihydroxy-9,10-anthracenedione | 1,2-Dihydroxy-9,10-anthraquinone |
| 1,2-Dihydroxy-anthraquinone | 1,2-Dihydroxyanthra-9,10-quinone | 1,2-Dihydroxyanthra-9,10-quinone # |
| 1,2-Dihydroxyanthrachinon | 1,2-Dihydroxyanthrachinon [Czech] | 1,2-Dihydroxyanthraquinone |
| 1,2-bis(oxidanyl)anthracene-9,10-dione | 1,2-dihydroxy-9,10-dihydroanthracene-9,10-dione | 1,2-dihydroxyanthracene-9,10-dione |
| 1322-60-7 | 140861-55-8 | 2,9-dihydroxy-1,10-anthraquinone |
| 4-08-00-03256 (Beilstein Handbook Reference) | 4CH-011256 | 60MEW57T9G |
| 72-48-0 | 9, 1,2-dihydroxy- | 9,10-Anthracenedione, 1,2-dihydroxy- |
| 9,10-Anthracenedione, dihydroxy- | 9,10-dihydroxy-1,2-anthraquinone | A837539 |
| AC-11708 | ACMC-20mzub | AE-641/00185064 |
| AI3-18244 | AK114182 | AKOS001639988 |
| ALIZARINE | ANW-36201 | ARONIS27045 |
| ATHRAQUINONES A | Alizarin | Alizarin (C.I. 58000) |
| Alizarin B | Alizarin Red | Alizarin, 97%, pure |
| Alizarin, Dye content 97 % | Alizarin, p.a. | Alizarina |
| Alizarine 3B | Alizarine B | Alizarine L paste |
| Alizarine Lake Red 2P | Alizarine Lake Red 3P | Alizarine Lake Red IPX |
| Alizarine NAC | Alizarine Paste 20 percent Bluish | Alizarine Red |
| Alizarine Red B | Alizarine Red B2 | Alizarine Red IP |
| Alizarine Red IPP | Alizarine Red L | Alizarine indicator |
| Alizarine paste 20% bluish | Alizarinprimeveroside | Alizerine NAC |
| Alizerine Red IPP | Anthraquinone, 1,2-dihydroxy- | Anthraquinonic |
| Az | BBL027327 | BB_NC-00489 |
| BDBM50206434 | BRD-K73191876-001-04-7 | BRN 1914037 |
| BSPBio_001704 | C-34292 | C.I. 58000 |
| C.I. 58000C | C.I. Mordant Red 11 | C.I. Mordant Red 11C |
| C.I. Pigment Red 83 | C.I. Pigment Red 83C | C01474 |
| CAS-72-48-0 | CBDivE_014227 | CC-02920 |
| CCG-38668 | CCRIS 3530 | CHEBI:16866 |
| CHEMBL55814 | CI 58000 | CS-0009103 |
| CTK0F1107 | CTK0I0351 | Certiqual Alizarine |
| Certiqual Alizarine D | D And C Orange Number 15 | D and C Orange No. 15 |
| D and C Orange Number 15D | D0242 | DIHYDROXY-9,10-ANTHRACENEDIONE |
| DSSTox_CID_25960 | DSSTox_GSID_45960 | DSSTox_RID_81256 |
| DTXSID5045960 | Deep Crimson Madder 10821 | Deep Crimson Madder 10821E |
| DivK1c_006416 | EINECS 200-782-5 | EN300-136088 |
| Eljon Madder | Eljon Madder M | Epitope ID:116187 |
| F0905-1727 | FS-3935 | FT-0621965 |
| GT5801 | HMS1923C03 | HMS3651P05 |
| HY-N0563 | Hystazarin | InChI=1/C14H8O4/c15-10-6-5-9-11(14(10)18)13(17)8-4-2-1-3-7(8)12(9)16/h1-6,15,18; |
| KBio1_001360 | KBio2_000866 | KBio2_003434 |
| KBio2_006002 | KBio3_001204 | KBioGR_002050 |
| KBioSS_000866 | KS-00000WZC | KS-000048JK |
| L933 | LN: L C666 BV IVJ EQ FQ1 | LS-20667 |
| MCULE-9793510419 | MFCD00001201 | MLS002207283 |
| Mitsui Alizarine B | Mitsui Alizarine BS | Mordant Red 11 |
| NCGC00095227-01 | NCGC00095227-02 | NCGC00095227-03 |
| NCGC00095227-04 | NCGC00095227-06 | NCI60_041501 |
| NE55861 | NSC 7212 | NSC-7212 |
| NSC7212 | Pigment red 83 | Pincoffin |
| Q267813 | RGCKGOZRHPZPFP-UHFFFAOYSA-N | RTR-023675 |
| Rubia | Rubia, alizarin crimson, 72-48-0 | SBB006481 |
| SCHEMBL18614 | SDCCGMLS-0066502.P001 | SMR001306798 |
| SPBio_000613 | SPECTRUM210850 | SR-05000002485 |
| SR-05000002485-1 | ST055352 | ST24020924 |
| STK801841 | SW101224-2 | Sanyo Carmine L2B |
| Sanyo Carmine l2BT | SpecPlus_000320 | Spectrum2_000397 |
| Spectrum3_000262 | Spectrum4_001555 | Spectrum5_000150 |
| Spectrum_000386 | TR-023675 | Tox21_111486 |
| Tox21_111486_1 | Turkey Red | Turkey Red (VAN) |
| Turkey Red W | UNII-60MEW57T9G | W-104489 |
| ZINC3860973 | alizarin crimson | crimson madder |
| rose madder | s2526 |