D0771 | alpha-1,2,3,4,5,6-hexachlorocyclohexane
P
P03AB02 Lindane
[P03AB] Chlorine containing products
[P03A] ECTOPARASITICIDES, INCL. SCABICIDES
[P03] ECTOPARASITICIDES, INCL. SCABICIDES, INSECTICIDES AND REPELLENTS
[P] Antiparasitic products, insecticides and repellents
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 49.00±6.35 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | human | HepG2 | MMP assay | Negative | IC50 | 163 | ||
| MEMBRANE POTENTIAL | 39.81±0.00 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
    |
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H312: Harmful in contact with skin [Warning Acute toxicity, dermal] H332: Harmful if inhaled [Warning Acute toxicity, inhalation] H362: May cause harm to breast-fed children [Reproductive toxicity, effects on or via lactation] H373 **: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P201, P260, P261, P263, P264, P270, P271, P273, P280, P301+P310, P302+P352, P304+P312, P304+P340, P308+P313, P312, P314, P321, P322, P330, P363, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
Aggregated GHS information provided by 8 companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 1 of 8 companies. For more detailed information, please visit ECHA C&L website Of the 3 notification(s) provided by 7 of 8 companies with hazard statement code(s): H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] H312 (71.43%): Harmful in contact with skin [Warning Acute toxicity, dermal] H351 (71.43%): Suspected of causing cancer [Warning Carcinogenicity] H400 (71.43%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410 (71.43%): Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P264, P270, P273, P280, P281, P301+P310, P302+P352, P308+P313, P312, P321, P322, P330, P363, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H312: Harmful in contact with skin [Warning Acute toxicity, dermal] H351: Suspected of causing cancer [Warning Carcinogenicity] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P264, P270, P273, P280, P281, P301+P310, P302+P352, P308+P313, P312, P321, P322, P330, P363, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H311: Toxic in contact with skin [Danger Acute toxicity, dermal] H320: Causes eye irritation [Warning Serious eye damage/eye irritation] H332: Harmful if inhaled [Warning Acute toxicity, inhalation] H350: May cause cancer [Danger Carcinogenicity] H360: May damage fertility or the unborn child [Danger Reproductive toxicity] H370: Causes damage to organs [Danger Specific target organ toxicity, single exposure] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P260, P261, P264, P270, P271, P273, P280, P281, P301+P310, P302+P352, P304+P312, P304+P340, P305+P351+P338, P307+P311, P308+P313, P312, P314, P321, P322, P330, P337+P313, P361, P363, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H311: Toxic in contact with skin [Danger Acute toxicity, dermal] H331: Toxic if inhaled [Danger Acute toxicity, inhalation] H335: May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H351: Suspected of causing cancer [Warning Carcinogenicity] H361: Suspected of damaging fertility or the unborn child [Warning Reproductive toxicity] H370: Causes damage to organs [Danger Specific target organ toxicity, single exposure] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] |
P201, P202, P260, P261, P264, P270, P271, P280, P281, P301+P310, P302+P352, P304+P340, P307+P311, P308+P313, P311, P312, P314, P321, P322, P330, P361, P363, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H310: Fatal in contact with skin [Danger Acute toxicity, dermal] H320: Causes eye irritation [Warning Serious eye damage/eye irritation] H332: Harmful if inhaled [Warning Acute toxicity, inhalation] H351: Suspected of causing cancer [Warning Carcinogenicity] H370: Causes damage to organs [Danger Specific target organ toxicity, single exposure] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] |
P201, P202, P260, P261, P262, P264, P270, P271, P280, P281, P301+P310, P302+P350, P304+P312, P304+P340, P305+P351+P338, P307+P311, P308+P313, P310, P312, P314, P321, P322, P330, P337+P313, P361, P363, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
Aggregated GHS information provided by 9 companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 1 of 9 companies. For more detailed information, please visit ECHA C&L website Of the 4 notification(s) provided by 8 of 9 companies with hazard statement code(s): H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] H311 (25%): Toxic in contact with skin [Danger Acute toxicity, dermal] H312 (75%): Harmful in contact with skin [Warning Acute toxicity, dermal] H330 (25%): Fatal if inhaled [Danger Acute toxicity, inhalation] H351 (75%): Suspected of causing cancer [Warning Carcinogenicity] H400 (75%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410 (75%): Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P260, P264, P270, P271, P273, P280, P281, P284, P301+P310, P302+P352, P304+P340, P308+P313, P310, P312, P320, P321, P322, P330, P361, P363, P391, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
Aggregated GHS information provided by 9 companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 1 of 9 companies. For more detailed information, please visit ECHA C&L website Of the 4 notification(s) provided by 8 of 9 companies with hazard statement code(s): H301 (75%): Toxic if swallowed [Danger Acute toxicity, oral] H302 (25%): Harmful if swallowed [Warning Acute toxicity, oral] H312 (75%): Harmful in contact with skin [Warning Acute toxicity, dermal] H351 (75%): Suspected of causing cancer [Warning Carcinogenicity] H400 (75%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410 (75%): Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P264, P270, P273, P280, P281, P301+P310, P301+P312, P302+P352, P308+P313, P312, P321, P322, P330, P363, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
Aggregated GHS information provided by 164 companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 1 of 164 companies. For more detailed information, please visit ECHA C&L website Of the 6 notification(s) provided by 163 of 164 companies with hazard statement code(s): H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] H312 (97.55%): Harmful in contact with skin [Warning Acute toxicity, dermal] H332 (100%): Harmful if inhaled [Warning Acute toxicity, inhalation] H362 (100%): May cause harm to breast-fed children [Reproductive toxicity, effects on or via lactation] H373 (100%): Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] H400 (100%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410 (100%): Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P260, P261, P263, P264, P270, P271, P273, P280, P301+P310, P302+P352, P304+P312, P304+P340, P308+P313, P312, P314, P321, P322, P330, P363, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H312: Harmful in contact with skin [Warning Acute toxicity, dermal] H332: Harmful if inhaled [Warning Acute toxicity, inhalation] H362: May cause harm to breast-fed children [Reproductive toxicity, effects on or via lactation] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P201, P260, P261, P263, P264, P270, P271, P273, P280, P301+P310, P302+P352, P304+P312, P304+P340, P308+P313, P312, P314, P321, P322, P330, P363, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H312: Harmful in contact with skin [Warning Acute toxicity, dermal] H332: Harmful if inhaled [Warning Acute toxicity, inhalation] H351: Suspected of causing cancer [Warning Carcinogenicity] H362: May cause harm to breast-fed children [Reproductive toxicity, effects on or via lactation] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P260, P261, P263, P264, P270, P271, P273, P280, P281, P301+P310, P302+P352, P304+P312, P304+P340, P308+P313, P312, P314, P321, P322, P330, P363, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H312: Harmful in contact with skin [Warning Acute toxicity, dermal] H351: Suspected of causing cancer [Warning Carcinogenicity] H362: May cause harm to breast-fed children [Reproductive toxicity, effects on or via lactation] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P260, P263, P264, P270, P273, P280, P281, P301+P310, P302+P352, P308+P313, P312, P314, P321, P322, P330, P363, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H312: Harmful in contact with skin [Warning Acute toxicity, dermal] H351: Suspected of causing cancer [Warning Carcinogenicity] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P264, P270, P273, P280, P281, P301+P310, P302+P352, P308+P313, P312, P321, P322, P330, P363, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H312: Harmful in contact with skin [Warning Acute toxicity, dermal] H351: Suspected of causing cancer [Warning Carcinogenicity] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P264, P270, P273, P280, P281, P301+P310, P302+P352, P308+P313, P312, P321, P322, P330, P363, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| rat | LD50 | oral | 76mg/kg (76mg/kg) | Special Publication of the Entomological Society of America. Vol. 78-1, Pg. 11, 1978. | |
| hamster | LD50 | intraperitoneal | 640mg/kg (640mg/kg) | Archives of Toxicology. Vol. 58, Pg. 152, 1986. | |
| mouse | LD50 | intraperitoneal | 125mg/kg (125mg/kg) | Soviet Genetics. English translation of GNKAA5. Vol. 2, Pg. 80, 1966. | |
| hamster | LD50 | oral | 360mg/kg (360mg/kg) | European Journal of Toxicology and Environmental Hygiene. Vol. 7, Pg. 159, 1974. | |
| child | TDLo | oral | 180mg/kg (180mg/kg) | "Clinical Memoranda on Economic Poisons," U.S. Dept. HEW, Public Health Service, Communicable Disease Center, Atlanta, GA, 1956Vol. -, Pg. 1, 1956. | |
| rat | LD50 | skin | 414mg/kg (414mg/kg) | Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 55(7), Pg. 87, 1990. | |
| rabbit | LD50 | subcutaneous | 75mg/kg (75mg/kg) | U.S. Public Health Service Publication. Vol. 414, Pg. 273, 1955. | |
| guinea pig | LDLo | oral | 1400mg/kg (1400mg/kg) | Medizinische Monatsschrift. Vol. 4, Pg. 25, 1950. | |
| man | TDLo | skin | 20mg/kg/6W-I (20mg/kg) | American Journal of Diseases of Children. Vol. 141, Pg. 125, 1987. | |
| rat | LC50 | inhalation | 690mg/m3/4H (690mg/m3) | Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 56(2), Pg. 80, 1991. | |
| rat | LD50 | unreported | 125mg/kg (125mg/kg) | Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 28(8), Pg. 29, 1963. | |
| dog | LD50 | oral | 40mg/kg (40mg/kg) | Special Publication of the Entomological Society of America. Vol. 78-1, Pg. 11, 1978. | |
| dog | LDLo | intravenous | 7500ug/kg (7.5mg/kg) | Tieraerztliche Umschau. Vol. 5, Pg. 61, 1950. | |
| cat | LD50 | oral | 25mg/kg (25mg/kg) | "Toxicometric Parameters of Industrial Toxic Chemicals Under Single Exposure," Izmerov, N.F., et al., Moscow, Centre of International Projects, GKNT, 1982Vol. -, Pg. 72, 1982. | |
| rabbit | LD50 | skin | 50mg/kg (50mg/kg) | Quarterly Bulletin--Association of Food and Drug Officials of the United States. Vol. 16, Pg. 3, 1952. | |
| rabbit | LDLo | intravenous | 4500ug/kg (4.5mg/kg) | Journal of Pharmacology and Experimental Therapeutics. Vol. 92, Pg. 140, 1948. | |
| mouse | LD50 | intracrebral | 60mg/kg (60mg/kg) | behavioral: convulsions or effect on seizure threshold | Toxicology Letters. Vol. 60, Pg. 289, 1992. |
| quail | LD50 | oral | 120mg/kg (120mg/kg) | Pesticide Manual. Vol. 9, Pg. 452, 1991. | |
| mouse | LD50 | oral | 44mg/kg (44mg/kg) | Journal of Economic Entomology. Vol. 65, Pg. 632, 1972. | |
| rat | LD50 | oral | 100mg/kg (100mg/kg) | Archiv fuer Toxikologie. Vol. 22, Pg. 115, 1966. | |
| guinea pig | LD50 | oral | 127mg/kg (127mg/kg) | Federation Proceedings, Federation of American Societies for Experimental Biology. Vol. 6, Pg. 386, 1947. | |
| chicken | LD50 | oral | 597mg/kg (597mg/kg) | Poultry Science. Vol. 60, Pg. 2599, 1981. | |
| rabbit | LD50 | oral | 60mg/kg (60mg/kg) | Journal of Hygiene, Epidemiology, Microbiology, and Immunology. Vol. 22, Pg. 115, 1978. | |
| bird - wild | LD50 | oral | 56mg/kg (56mg/kg) | Toxicology and Applied Pharmacology. Vol. 21, Pg. 315, 1972. | |
| rat | LD50 | intraperitoneal | 35mg/kg (35mg/kg) | Naunyn-Schmiedeberg's Archiv fuer Experimentelle Pathologie und Pharmakologie. Vol. 212, Pg. 463, 1951. | |
| human | LDLo | oral | 840mg/kg (840mg/kg) | Gekkan Yakuji. Pharmaceuticals Monthly. Vol. 34, Pg. 1232, 1992. | |
| cat | LDLo | unreported | 50mg/kg (50mg/kg) | Pharmacology and Toxicology. English translation of FATOAO. Vol. 22, Pg. 273, 1959. | |
| mouse | LCLo | inhalation | 120mg/m3/6H (120mg/m3) | Gigiena Truda i Professional'nye Zabolevaniya. Labor Hygiene and Occupational Diseases. Vol. 8(10), Pg. 55, 1964. | |
| mammal (species unspecified) | LD50 | unreported | 300mg/kg (300mg/kg) | Gigiena Truda i Professional'nye Zabolevaniya. Labor Hygiene and Occupational Diseases. Vol. 17(3), Pg. 32, 1973. | |
| child | TDLo | oral | 111mg/kg (111mg/kg) | behavioral: convulsions or effect on seizure threshold | Archives of Environmental Health. Vol. 25, Pg. 374, 1972. |
| women | TDLo | skin | 19mg/kg/1H-I (19mg/kg) | Annals of Emergency Medicine. Vol. 24, Pg. 972, 1994. | |
| man | TCLo | inhalation | 400ug/kg/3D (0.4mg/kg) | Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 49(10), Pg. 26, 1984. | |
| mouse | LD50 | oral | 59mg/kg (59mg/kg) | Pesticide Manual. Vol. 9, Pg. 452, 1991. | |
| rat | LD50 | skin | 900mg/kg (900mg/kg) | "Wirksubstanzen der Pflanzenschutz und Schadlingsbekampfungsmittel," Perkow, W., Berlin, Verlag Paul Parey, 1971-1976Vol. -, Pg. -, 1971/1976. | |
| (+)-alpha-HCH | (-)-alpha-HCH | (.+/-.)-.alpha.-Hexachlorocyclohexane |
| (1.alpha.,3.alpha.,4.beta.,5.alpha.,6.beta.)-1,2,3,4,5,6-Hexachlorocyclohexane | (1.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta)-1,2,3,4,5,6-Hexachlorocyclohexane | (1R,2R,3R,4R,5S,6S)-1,2,3,4,5,6-hexachlorocyclohexane |
| (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-hexachlorocyclohexane | (1R,2S,3r,4R,5S,6r)-1,2,3,4,5,6-hexachlorocyclohexane | (1R,2S,3r,4R,5S,6s)-1,2,3,4,5,6-Hexachlorocyclohexane |
| (1R,2r,3S,4R,5s,6S)-1,2,3,4,5,6-hexachlorocyclohexane | (1a,2a,3a,4ss,5a,6ss)-1,2,3,4,5,6-hexachlorocyclohexane | (1a,2a,3a,4ss,5ss,6ss)-1,2,3,4,5,6-hexachlorocyclohexane |
| (1a,2a,3b,4a,5b,6b)-1,2,3,4,5,6-Hexachlorocyclohexane | (1a,2a,3ss,4a,5ss,6ss)-1,2,3,4,5,6-hexachlorocyclohexane | (1a,2ss,3a,4ss,5a,6ss)-1,2,3,4,5,6-hexachlorocyclohexane |
| (1alpha,2alpha,3alpha,4alpha,5alpha,6alpha)-1,2,3,4,5,6-Hexachlorocyclohexane | (1alpha,2alpha,3alpha,4alpha,5alpha,6beta)-1,2,3,4,5,6-Hexachlorocyclohexane | (1alpha,2alpha,3alpha,4alpha,5beta,6beta)-1,2,3,4,5,6-Hexachlorocyclohexane |
| (1alpha,2alpha,3alpha,4beta,5alpha,6beta)-1,2,3,4,5,6-Hexachlorocyclohexane | (1alpha,2alpha,3alpha,4beta,5beta,6beta)-1,2,3,4,5,6-Hexachlorocyclohexane | (1alpha,2alpha,3beta,4alpha,5alpha,6beta)-1,2,3,4,5, 6-hexachlorocyclohexane |
| (1alpha,2alpha,3beta,4alpha,5alpha,6beta)-1,2,3,4,5,6-hexachlorocyclohexane | (1alpha,2alpha,3beta,4alpha,5beta,6beta)-1,2,3,4,5,6-Hexachlorocyclohexane | (1alpha,2alpha,3beta,4beta,5alpha,6beta)-1,2,3,4,5,6-hexachlorocyclohexane |
| (1alpha,2beta,3alpha,4beta,5alpha,6beta)-1,2,3,4,5,6-Hexachlorocyclohexane | (1r,2R,3S,4r,5R,6S)-1,2,3,4,5,6-hexachlorocyclohexane | (1r,2R,3S,4s,5R,6S)-1,2,3,4,5,6-hexachlorocyclohexane |
| (1r,2c,3c,4t,5c,6t)-1,2,3,4,5,6-hexachlorocyclohexane | (1r,2c,3t,4c,5c,6t)-1,2,3,4,5,6-hexachlorocyclohexane | (1r,2c,3t,4t,5c,6t)-1,2,3,4,5,6-hexachlorocyclohexane |
| (1r,2r,3r,4r,5r,6r)-1,2,3,4,5,6-hexachlorocyclohexane | (1r,2t,3c,4t,5c,6t)-1,2,3,4,5,6-hexachlorocyclohexane | (1s,2R,3R,4s,5S,6S)-1,2,3,4,5,6-hexachlorocyclohexane |
| .alpha.-1,2,3,4,5,6-Hexachlorcyclohexane | .alpha.-1,2,3,4,5,6-Hexachlorocyclohexane | .alpha.-BHC |
| .alpha.-Benzene hexachloride | .alpha.-HCH | .alpha.-Hexachloran |
| .alpha.-Hexachlorane | .alpha.-Hexachlorcyclohexane | .alpha.-Hexachlorocyclohexane |
| .alpha.-Lindane | .beta.-Hexachlorocyclohexane | .delta.,1,2,3,4,5,6-Hexachlorocyclohexane |
| .delta.,2,3,4,5,6-Hexachlorocyclohexane | .delta.-(aeeee)-1,2,3,4,5,6-Hexachlorocyclohexane | .delta.-(aeeee)-1,3,4,5,6-Hexachlorocyclohexane |
| .delta.-BHC | .delta.-Benzene hexachloride | .delta.-HCH |
| .delta.-Hexachlorocyclohexane | .delta.-Lindane | .epsilon.-Hexachlorocyclohexane |
| .gamma.-1,2,3,4,5,6-Hexachlorocyclohexane | .gamma.-BHC | .gamma.-Benzene hexachloride |
| .gamma.-Benzohexachloride | .gamma.-HCH | .gamma.-Hexachloran |
| .gamma.-Hexachlorane | .gamma.-Hexachlorobenzene | .gamma.-Hexachlorocyclohexane |
| .gamma.-Lindane | 1,2,3,4,5,6-.gamma.-Hexachlorocyclohexane | 1,2,3,4,5,6-HCH |
| 1,2,3,4,5,6-Hexachlorocyclohexane | 1,2,3,4,5,6-Hexachlorocyclohexane (.gamma.) | 1,2,3,4,5,6-Hexachlorocyclohexane (HCH) |
| 1,2,3,4,5,6-Hexachlorocyclohexane (all stereo isomers) | 1,2,3,4,5,6-Hexachlorocyclohexane (all stereo isomers, including lindane) | 1,2,3,4,5,6-Hexachlorocyclohexane (gamma-Isomer) |
| 1,2,3,4,5,6-Hexachlorocyclohexane (mixture of isomers) | 1,2,3,4,5,6-Hexachlorocyclohexane gamma isomer | 1,2,3,4,5,6-Hexachlorocyclohexane, (1.alpha.,2.alpha.,3.alpha.,4.beta.,5.alpha.,6.beta.)- |
| 1,2,3,4,5,6-Hexachlorocyclohexane, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.beta.,6.beta.)- | 1,2,3,4,5,6-Hexachlorocyclohexane, gamma-isomer | 1,2,3,4,5,6-hexachloro-cyclohexane |
| 1,2,3,4,5,6-hexachlorocyclohexane (1alpha,2alpha,3beta,4alpha,5alpha,6beta) | 1,2,3,4,5,6-hexachlorocyclohexane, alpha isomer | 1,3,4,5,6-Hexachlorcyclohexane, .beta. isomer |
| 1,3,4,5,6-Hexachlorocyclohexane, .gamma. isomer | 1-.alpha.,2-.alpha.,3-.beta.,4-.alpha.,5-.beta.,6-.beta.-Hexachlorocyclohexane | 1-alpha,2-alpha,3-alpha,4-beta,5-alpha,6-beta-Hexachlorocyclohexane |
| 1-alpha,2-beta,3-alpha,4-beta,5-alpha,6-beta-Hexachlorocyclohexane | 1.alpha.,2.alpha.,3.alpha.,4.beta.,5.alpha.,6.beta.-Hexachlorocyclohexane | 119911-69-2 |
| 119911-70-5 | 135764-EP2275422A1 | 135764-EP2292608A1 |
| 1a,2a,3b,4a,5b,6b-Hexachlorocyclohexane | 1a,2b,3a,4b,5a,6b-hexachlorocyclohexane | 1alpha,2alpha,3beta,4alpha,5alpha,6beta-Hexachlorocyclohexane |
| 1alpha,2alpha,3beta,4alpha,5beta,6beta-Hexachlorocyclohexane | 2-05-00-00011 (Beilstein Handbook Reference) | 319-84-6 |
| 319-85-7 | 319-86-8 | 4-05-00-00056 (Beilstein Handbook Reference) |
| 4-05-00-00058 (Beilstein Handbook Reference) | 4-05-00-00060 (Beilstein Handbook Reference) | 4-05-00-00061 (Beilstein Handbook Reference) |
| 5477B350EK | 55963-79-6 | 58-89-9 |
| 59NEE7PCAB | 608-73-1 | 6108-10-7 |
| 6108-11-8 | 6108-12-9 | 6108-13-0 |
| 7644AF | AB00052031_02 | AC-11679 |
| AI3-07796 | AI3-08601 | AI3-09232 |
| AI3-09233 | AI3-09234 | AI3-15109 |
| AKOS015903494 | AKOS015914103 | AKOS024390982 |
| ALPHA-HEXACHLOROCYCLOHEXANE | Aalindan | Aficide |
| Agrisol G-20 | Agrocide | Agrocide 2 |
| Agrocide 6G | Agrocide 7 | Agrocide III |
| Agrocide WP | Agronexit | Ameisenatod |
| Ameisenmittel merck | Ameisentod | Aparasin |
| Aphtiria | Aphtitria | Aplidal |
| Arbitex | Arcotal S | Atlas steward |
| BBH | BDBM50410525 | BETA-HEXACHLOROCYCLOHEXANE |
| BHC | BHC (alpha-, beta-, gamma-) | BHC (insecticide) |
| BHC .alpha. | BHC or HCH | BHC(.gamma.) |
| BHC, .delta. | BHC-.alpha. isomer | BHC-.delta. isomer |
| BIDD:ER0090 | BIDD:ER0091 | BIDD:ER0449 |
| BIDD:ER0558 | BIDD:GT0634 | BIDD:PXR0097 |
| BRN 1907331 | BRN 1907334 | BRN 1907337 |
| BRN 1907338 | BRN 3195880 | BSPBio_002479 |
| Ben-Hex | Benhexachlor | Benhexol |
| Bentox 10 | Benzanex | Benzene Hexachloride (gamma-Isomer) |
| Benzene Hexachloride, .gamma. | Benzene Hexachloride, gamma | Benzene hexachloride |
| Benzene hexachloride (Ambiguous) | Benzene hexachloride, all isomers | Benzene hexachloride-.alpha.-isomer |
| Benzene hexachloride-alpha-isomer | Benzene hexachloride-gamma isomer | Benzene-1,2,3,4,5,6-hexachloride ((Ambiguous) |
| Benzene-1,2,3,4,5,6-hexachloride (Ambiguous) | Benzenehexachloride, mixed isomers | Benzenehexachloride-alpha-isomer |
| Benzex | Beta-1,2,3,4,5,6-hexachlorocyclohexane | Bexol |
| Borer Spray | C-18255 | C06988 |
| C07075 | C15214 | C18738 |
| C6H6Cl6 | CAS-319-84-6 | CAS-319-85-7 |
| CAS-319-86-8 | CAS-58-89-9 | CAS-608-73-1 |
| CC-02682 | CCG-39862 | CCRIS 1449 |
| CCRIS 327 | CCRIS 328 | CCRIS 329 |
| CHEBI:24536 | CHEBI:28428 | CHEBI:32888 |
| CHEBI:39095 | CHEBI:39096 | CHEMBL1200921 |
| CHEMBL15891 | CHEMBL1714528 | CHEMBL1874247 |
| CHEMBL2272381 | CHEMBL389022 | Caswell No. 079 |
| Caswell No. 527 | Celanex | Certified Reference Material |
| Chloresene | Codechine | Cyclohexane, .alpha.-1,2,3,4,5,6-hexachloro- |
| Cyclohexane, .delta.,1,2,3,4,5,6-hexachloro- | Cyclohexane, 1,2,3,4,5,6-hexachloro- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.alpha.,4.beta.,5.alpha.,6.beta.)- |
| Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.alpha.,4.beta.,5.beta.,6.beta.)- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.alpha.,6.beta.)- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta.,4.alpha.,5.beta.,6.beta.)- |
| Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.beta.,3.alpha.,4.beta.,5.alpha.,6.beta.)- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1alpha,2alpha,3alpha,4alpha,5alpha,6alpha)- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1alpha,2alpha,3alpha,4alpha,5alpha,6beta)- |
| Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1alpha,2alpha,3alpha,4alpha,5beta,6beta)- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1alpha,2alpha,3alpha,4beta,5alpha,6beta)- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1alpha,2alpha,3alpha,4beta,5beta,6beta)- |
| Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1alpha,2alpha,3beta,4alpha,5alpha,6beta)- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1alpha,2alpha,3beta,4alpha,5beta,6beta)- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, (1alpha,2beta,3alpha,4beta,5alpha,6beta)- |
| Cyclohexane, 1,2,3,4,5,6-hexachloro-, (mixed isomers) | Cyclohexane, 1,2,3,4,5,6-hexachloro-, .alpha.- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, .alpha.-isomer |
| Cyclohexane, 1,2,3,4,5,6-hexachloro-, .beta.- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, .delta.- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, .delta.-isomer |
| Cyclohexane, 1,2,3,4,5,6-hexachloro-, .gamma.- | Cyclohexane, 1,2,3,4,5,6-hexachloro-, .gamma.-isomer | Cyclohexane, 1,2,3,4,5,6-hexachloro-, alpha- |
| Cyclohexane, 1,2,3,4,5,6-hexachloro-, alpha-isomer | Cyclohexane, 1,2,3,4,5,6-hexachloro-, beta-isomer | Cyclohexane, 1,2,3,4,5,6-hexachloro-, delta- |
| Cyclohexane, 1,2,3,4,5,6-hexachloro-, delta- (8CI) | Cyclohexane, 1,2,3,4,5,6-hexachloro-, delta-isomer | Cyclohexane, 1,2,3,4,5,6-hexachloro-, gamma- |
| Cyclohexane, 1,2,3,4,5,6-hexachloro-, gamma-isomer | Cyclohexane, beta-1,2,3,4,5,6-hexachloro- | Cyclohexane, delta-1,2,3,4,5,6-hexachloro- |
| Cyclohexane, l,2,3,4,5,6-hexachloro-, (1alpha,2alpha,3beta,4alpha,5beta,6beta)- | Cyclohexane,1,2,3,4,5,6-hexachloro- | Cyclohexane,2,3,4,5,6-hexachloro- |
| Cyclohexane,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.alpha.,4.beta.,5.alpha.,6.beta.)- | Cyclohexane,2,3,4,5,6-hexachloro-, .delta.- | Cyclohexane,2,3,4,5,6-hexachloro-, .delta.-isomer |
| D00360 | DB00431 | DELTA-HEXACHLOROCYCLOHEXANE |
| DOL GRANULE | DSSTox_CID_4134 | DSSTox_CID_684 |
| DSSTox_CID_685 | DSSTox_CID_686 | DSSTox_CID_687 |
| DSSTox_GSID_20684 | DSSTox_GSID_20685 | DSSTox_GSID_20686 |
| DSSTox_GSID_20687 | DSSTox_GSID_24134 | DSSTox_RID_75732 |
| DSSTox_RID_75733 | DSSTox_RID_75734 | DSSTox_RID_75735 |
| DTXSID0024135 | DTXSID2020684 | DTXSID2020686 |
| DTXSID5024134 | DTXSID7020685 | DTXSID7020687 |
| Detmol Extract | Detmol Extrakt | Detmol-extrakt |
| Detox 25 | Devoran | DivK1c_000701 |
| Dolmix | Drill tox-spezial aglukon | Drilltox-Spezial Aglukon |
| EINECS 200-401-2 | EINECS 206-270-8 | EINECS 206-271-3 |
| EINECS 206-272-9 | EINECS 210-168-9 | EINECS 228-068-9 |
| ENT 7,796 | ENT 8,601 | ENT 9,232 |
| ENT 9,233 | ENT 9,234 | EPA Pesticide Chemical Code 009001 |
| Entomoxan | Eso derm | Esoderm |
| Exagama | FCH1320285 | FT-0603490 |
| FT-0606175 | FT-0647466 | Fenoform forte |
| Forlin | Forst-nexen | G-BHC-.delta. |
| GAMMA-HEXACHLORO-CYCLOHEXANE | Gallogama | Gamacarbatox |
| Gamacid | Gamacide | Gamacide 20 |
| Gamaphex | Gamene | Gamiso |
| Gamma Benzene Hydrochloride | Gamma-mean 400 | Gammahexa |
| Gammahexane | Gammalin | Gammalin 20 |
| Gammallin | Gammaterr | Gammaxene |
| Gammex | Gammexane | Gammopaz |
| Gamtox | Geobilan | Geolin G 3 |
| Gexane | Gyben | H.C.H |
| H.C.H. | HCH | HCH (alpha) |
| HCH (beta) | HCH (technical) | HCH (technical) 10 microg/mL in Isooctane |
| HCH [BSI] | HCH [ISO] | HCH, PESTANAL(R), analytical standard, mixture of isomers (alpha:beta:gamma:delta=1:1:1:1); |
| HCH, technical grade | HCH, technical grade [Hexachlorocyclohexanes] | HCH-.alpha. |
| HCH-.delta. | HEXACHLOROCYCLOHEXANE (MIXTURE) | HGI |
| HMS1923K17 | HMS2091E05 | HMS2230C24 |
| HMS2231A06 | HMS3369J21 | HMS502D03 |
| HSDB 1606 | HSDB 6029 | HSDB 6183 |
| HSDB 6184 | HSDB 646 | HY-A0085 |
| Hcch | Heclotox | Hexablanc |
| Hexachlor | Hexachloran | Hexachlorane |
| Hexachlorcyclohexan | Hexachlorcyclohexan [German] | Hexachlorocyclohexane (all isomers) |
| Hexachlorocyclohexane (mixed isomers) | Hexachlorocyclohexane (q-isomer) | Hexachlorocyclohexane (technical grade) |
| Hexachlorocyclohexane (z-isomer) | Hexachlorocyclohexane [h-isomer] | Hexachlorocyclohexane, Technical |
| Hexachlorocyclohexane, alpha- | Hexachlorocyclohexane, beta- | Hexachlorocyclohexane, delta- |
| Hexachlorocyclohexane, gamma isomer | Hexachlorocyclohexane, gamma- | Hexachlorocyclohexane, gamma-isomer |
| Hexachlorocyclohexane, technical grade | Hexachlorocyclohexane,.gamma.-isomer | Hexachlorocyclohexane-Alpha |
| Hexachlorocyclohexane-Beta | Hexachlorocyclohexanes | Hexachlorzyklohexan |
| Hexamul | Hexapoudre | Hexatox |
| Hexaverm | Hexcidum | Hexicide |
| Hexyclan | Hilbeech | Hortex |
| Hungaria L7 | IDI1_000701 | IVM9A2N49K |
| InChI=1/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6 | Inexit | Isatox |
| Isot ox | Isotox | J-018587 |
| J-018588 | J-018589 | JLYXXMFPNIAWKQ-GNIYUCBRSA-N |
| JLYXXMFPNIAWKQ-GPIVLXJGSA-N | JLYXXMFPNIAWKQ-LKPKBOIGSA-N | JLYXXMFPNIAWKQ-UHFFFAOYSA-N |
| Jacutin | KBio1_000701 | KBio2_002464 |
| KBio2_005032 | KBio2_007600 | KBio3_001979 |
| KBioGR_001199 | KBioSS_002471 | KWELL (TN) |
| Kanodane | Kokotine | Kwell |
| Kwell-R | LINDANE (BENZENE HEXACHLOROIDE-GAMMA ISOMER) | LS-185311 |
| LS-193399 | LS-193400 | LS-193401 |
| LS-242 | LS-56881 | LS-7424 |
| LS-7425 | LS-7426 | Lacco HI lin |
| Lasochron | Latka 666 | Latka 666 [Czech] |
| Lendine | Lentox | Lidenal |
| Lindafor | Lindagam | Lindagrain |
| Lindagranox | Lindalo | Lindam ul |
| Lindamul | Lindan | Lindane (USP/INN) |
| Lindane [Hexachlorocyclohexanes] | Lindane [USAN:INN:BAN] | Lindane [USAN:USP:INN:BAN] |
| Lindane, 97% | Lindane, PESTANAL(R), analytical standard | Lindane, Pharmaceutical Secondary Standard |
| Lindane, United States Pharmacopeia (USP) Reference Standard | Lindane,(S) | Lindano |
| Lindano [INN-Spanish] | Lindanum | Lindanum [INN-Latin] |
| Lindapoudre | Lindaterra | Lindatox |
| Lindex | Lindosep | Lintox |
| Linvur | Lorexane | MFCD00135947 |
| MLS001333088 | MLS001335969 | MLS001335970 |
| MLS001361319 | Mglawik L | Milbol 49 |
| Mszycol | Murfume grain store smoke | NCGC00094546-01 |
| NCGC00094546-02 | NCGC00094546-03 | NCGC00094546-04 |
| NCGC00094546-05 | NCGC00094546-06 | NCGC00094546-07 |
| NCGC00094546-08 | NCGC00094546-09 | NCGC00094546-10 |
| NCGC00094546-11 | NCGC00159386-02 | NCGC00159386-03 |
| NCGC00159386-04 | NCGC00159386-05 | NCGC00163943-01 |
| NCGC00163943-02 | NCGC00163943-03 | NCGC00163943-04 |
| NCGC00163943-05 | NCGC00248792-01 | NCGC00254541-01 |
| NCGC00254855-01 | NCGC00256383-01 | NCGC00258230-01 |
| NCGC00259326-01 | NCGC00259618-01 | NCGC00259839-01 |
| NCGC00357135-01 | NCI-C00204 | NINDS_000701 |
| NSC 11808 | NSC-11807 | NSC-11808 |
| NSC-755895 | NSC-7909 | NSC-8093 |
| NSC11807 | NSC11808 | NSC755895 |
| NSC7909 | NSC8093 | Neo-scabicidol |
| Nexen fb | Nexit | Nexit Stark |
| Nexit-stark | Nexol E | Nexol-E |
| Nicochloran | Novigam | Novigan |
| Omnitox | Ovadziak | Owadziak |
| PLK | Pedraczak | Pflanzol |
| Pharmakon1600-00330071 | Q10860138 | Q23014122 |
| Q282003 | Q6445839 | Quellada |
| RCRA waste no. U129 | Rcra waste number U129 | SBB061412 |
| SBI-0051430.P003 | SCHEMBL10795898 | SCHEMBL140812 |
| SCHEMBL140813 | SCHEMBL25895 | SCHEMBL25896 |
| SCHEMBL472088 | SCHEMBL75689 | SCHEMBL7647849 |
| SCHEMBL8469477 | SCHEMBL9120917 | SMR000857321 |
| SMR000875266 | SPBio_001708 | SPECTRUM330071 |
| SR-05000001837 | SR-05000001837-1 | SR-05000001837-4 |
| ST51047431 | Sang gamma | Sang-.gamma. |
| Sang-gamma | Scabecid | Scabene |
| Silvanol | Spectrum2_001864 | Spectrum3_000860 |
| Spectrum4_000700 | Spectrum5_001586 | Spectrum_001929 |
| Spritz-rapidin | Spritzlindane | Spruehpflanzol |
| Streunex | Submar | TAP 85 |
| TRI-6 | Technical HCH | Tox21_111294 |
| Tox21_200676 | Tox21_201777 | Tox21_202069 |
| Tox21_202290 | Tox21_300624 | Tox21_300953 |
| Tox21_302925 | Tox21_303873 | Trives-T |
| UNII-5477B350EK | UNII-5477B350EK component JLYXXMFPNIAWKQ-CDRYSYESSA-N | UNII-5477B350EK component JLYXXMFPNIAWKQ-GNIYUCBRSA-N |
| UNII-5477B350EK component JLYXXMFPNIAWKQ-LKPKBOIGSA-N | UNII-5477B350EK component JLYXXMFPNIAWKQ-SHFUYGGZSA-N | UNII-59NEE7PCAB |
| UNII-IVM9A2N49K | UNII-IVM9A2N49K component JLYXXMFPNIAWKQ-LKPKBOIGSA-N | UNII-IVM9A2N49K component JLYXXMFPNIAWKQ-SHFUYGGZSA-N |
| UNII-YM80ODM9PD | UNII-YV2D256Z3N | V0158 |
| Verindal ultra | Viton | WLN: L6TJ AG BG CG DG EG FG .delta. |
| YM80ODM9PD | YV2D256Z3N | ZINC100068484 |
| ZINC100076865 | ZINC100076868 | ZINC100899052 |
| ZINC1621 | ZINC245204924 | ZINC263584078 |
| a-Hexachlorocyclohexane (HCH, BHC) | alpha- BHC | alpha-1,2,3,4,5,6-Hexachlorocyclohexane |
| alpha-1,2,3,4,5,6-Hexachlorocyclohexane, 99% | alpha-BHC | alpha-Benzene hexachloride |
| alpha-Benzenehexachloride | alpha-HCH | alpha-HCH 10 microg/mL in Cyclohexane |
| alpha-HCH 100 microg/mL in Acetone | alpha-HCH 100 microg/mL in Cyclohexane | alpha-HCH 1000 microg/mL in Toluene |
| alpha-HCH 1000 microg/mL in n-Hexane | alpha-HCH [Hexachlorocyclohexanes] | alpha-HCH, PESTANAL(R), analytical standard |
| alpha-HCH, certified reference material, TraceCERT(R) | alpha-Hexachloran | alpha-Hexachlorane |
| alpha-Hexachlorcyclohexane | alpha-Hexachlorocyclohexanes | alpha-Lindane |
| am eisenatod | benzene hexachloride-gamma-isomer | benzene-cis-hexachloride |
| benzene-trans-hexachloride | beta-BHC | beta-BHC, analytical standard |
| beta-Benzene hexachloride | beta-HCH | beta-HCH 10 microg/mL in Cyclohexane |
| beta-HCH 100 microg/mL in Toluene | beta-HCH 1000 microg/mL in Toluene | beta-HCH [Hexachlorocyclohexanes] |
| beta-HCH solution, 100 mug/mL in methanol, PESTANAL(R), analytical standard | beta-HCH, PESTANAL(R), analytical standard | beta-Hexac hlorocyclohexane |
| beta-Hexachloran | beta-Hexachlorobenzene | beta-Hexachlorocyclohexanes |
| beta-Lindane | beta-isomer | cpd with unspecified stereochemistry |
| d-BHC | d-alpha-BHC | delta-(Aeeeee)-1,2,3,4,5,6-hexachlorocyclohexane |
| delta-BHC | delta-BHC, analytical standard | delta-BHC, vial of 100 mg, analytical standard |
| delta-Benzene hexachloride | delta-Benzenehexachloride | delta-HCH |
| delta-HCH 10 microg/mL in Cyclohexane | delta-HCH 100 microg/mL in Cyclohexane | delta-HCH 1000 microg/mL in Toluene |
| delta-HCH 1000 microg/mL in n-Hexane | delta-HCH, PESTANAL(R), analytical standard | delta-Lindane |
| epsilon-Benzene hexachloride | epsilon-Benzenehexachloride | epsilon-HCH |
| epsilon-HCH 10 microg/mL in Cyclohexane | epsilon-HCH 100 microg/mL in Cyclohexane | epsilon-HCH 100 microg/mL in Methanol |
| epsilon-Hexachlorocyclohexane | eta-BHC | eta-HCH |
| eta-Hexachlorocyclohexane | g-1,2,3,4,5,6-Hexachlorocyclohexane | gamma BHC |
| gamma Benzene hexachloride | gamma hexachlor | gamma-1,2,3,4,5,6-Hexachlorocyclohexane |
| gamma-:hexachlorocyclohexane | gamma-BHC | gamma-BHC (lindane) |
| gamma-BHC Benhexachlor | gamma-BHC, analytical standard | gamma-Benzene hexachloride |
| gamma-Benzenehexachloride | gamma-Benzohexachloride | gamma-HCH |
| gamma-HCH 10 microg/mL in Cyclohexane | gamma-HCH 100 microg/mL in Cyclohexane | gamma-HCH 1000 microg/mL in Methanol |
| gamma-HCH 1000 microg/mL in Toluene | gamma-HCH [Hexachlorocyclohexanes] | gamma-HCH or gamma-BHC |
| gamma-Hexachlorane | gamma-Hexachlorcyclohexanum | gamma-Hexachlorobenzene |
| gamma-Hexachlorocyclohexane [Lindane and other hexachlorocyclohexane isomers] | gamma-Hexachlorzyklohexan | gamma-Lindane |
| gamma-col | gamma-hexachlorocyclohexane | gamma-linda ne |
| hecoltox | hilbeec h | lindane |
| lindane (Gama-HCH) | lindane (gamma-HCH) | nexen-fb |
| nexi t-stark | t-HCH | technical Hexachlorocyclohexane |
| theta-BHC | theta-HCH | theta-Hexachlorocyclohexane |
| trans-1,2,3,4,5,6-hexachlorocyclohexane | trans-alpha-Benzenehexachloride | zeta-HCH |
| zeta-Hexachlorocyclohexane |