D0793 | benzidine
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 24.34±4.50 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 15.85 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 2.51±3.54 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
   |
Danger |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H350: May cause cancer [Danger Carcinogenicity] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P264, P270, P273, P281, P301+P312, P308+P313, P330, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
Aggregated GHS information provided by 63 companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] H350 (100%): May cause cancer [Danger Carcinogenicity] H400 (100%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410 (100%): Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P264, P270, P273, P281, P301+P312, P308+P313, P330, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H350: May cause cancer [Danger Carcinogenicity] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P264, P270, P273, P281, P301+P312, P308+P313, P330, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H341: Suspected of causing genetic defects [Warning Germ cell mutagenicity] H350: May cause cancer [Danger Carcinogenicity] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] |
P201, P202, P260, P264, P270, P281, P301+P312, P308+P313, P314, P330, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| mouse | LD50 | oral | 214mg/kg (214mg/kg) | National Technical Information Service. Vol. PB214-270, | |
| mouse | LD50 | intraperitoneal | 110mg/kg (110mg/kg) | Progress in Mutation Research. Vol. 1, Pg. 682, 1981. | |
| rat | LD50 | oral | 309mg/kg (309mg/kg) | National Technical Information Service. Vol. PB214-270, | |
| dog | LDLo | oral | 200mg/kg (200mg/kg) | Archiv fuer Experimentelle Pathologie und Pharmakologie. Vol. 58, Pg. 167, 1907. | |
| rabbit | LDLo | oral | 200mg/kg (200mg/kg) | Archiv fuer Experimentelle Pathologie und Pharmakologie. Vol. 58, Pg. 167, 1907. | |
| (1,1'-Biphenyl)-4,4'-diamine | 092B875 | 1,1'-Biphenyl-4,4'-Diamine |
| 2X02101HVF | 4'-Amino[1,1'-biphenyl]-4-ylamine # | 4'-Amino[1,1'-biphenyl]-4-ylamine (ACD/Name 4.0) |
| 4, 4'-Biphenylenediamine | 4,4'-Benzidine | 4,4'-Benzidine 10 microg/mL in Acetonitrile |
| 4,4'-Benzidine 100 microg/mL in Acetonitrile | 4,4'-Benzidine 100 microg/mL in Methanol | 4,4'-Bianiline |
| 4,4'-Biphenyldiamine | 4,4'-Biphenylenediamine | 4,4'-Diamino-1,1'-biphenyl |
| 4,4'-Diaminobiphenyl | 4,4'-Diaminodiphenyl | 4,4'-Diphenylenediamine |
| 4-(4-aminophenyl)aniline | 4-(4-aminophenyl)phenylamine | 4-13-00-00364 (Beilstein Handbook Reference) |
| 4.4'- diaminobiphenyl | 92-87-5 | A844372 |
| AC-907/25014310 | AI3-00140 | AKOS000118878 |
| ALBB-005944 | ANW-44091 | ARONIS24425 |
| AS-17227 | Acetoacet para Phenetidine | BBL013163 |
| BENZIDINE | BENZIDINE (SEE ALSO BENZIDINEDIHYDROCHLORIDE 531-85-1) | BIDD:GT0832 |
| BIPHENYL,4,4'-DIAMINO | BRN 0742770 | Bensidine |
| Benzidin | Benzidin [Czech] | Benzidina |
| Benzidina [Italian] | Benzidine (and its salts) | Benzidine 2000 microg/mL in Dichloromethane |
| Benzidine 2000 microg/mL in Dichloromethane, Second Source | Benzidine [UN1885] [Poison] | Benzidine [UN1885] [Poison] |
| Benzidine base | Benzidine, >=98.0% (N) | Benzidine, ISOPAC(R), >=98.0% (N) |
| Benzidine, analytical standard | Benzidine, purum p.a., >=98.0% (N) | Benzioine |
| Benzydyna | Benzydyna [Polish] | Biphenyl, 4,4'-diamino- |
| Biphenyl,4'-diamino- | Biphenyl,4,4'-diamino- | C.I. 37225 |
| C.I. Azoic Diazo Component 112 | C16444 | CAS-92-87-5 |
| CCG-202856 | CCRIS 71 | CHEBI:80495 |
| CHEMBL15901 | CI 37225 | CI Azoic diazo component 112 |
| CTK3I6733 | DB-057341 | DSSTox_CID_137 |
| DSSTox_GSID_20137 | DSSTox_RID_75390 | DTXSID2020137 |
| EINECS 202-199-1 | F1679-0261 | Fast Corinth Base B |
| HFACYLZERDEVSX-UHFFFAOYSA-N | HMS3091M16 | HSDB 948 |
| IDI1_009986 | IFLab1_004231 | InChI=1/C12H12N2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H,13-14H; |
| KM3148 | KS-000011M2 | LS-1939 |
| MCULE-2044272330 | MFCD00039765 | MLS002303016 |
| NCGC00091340-01 | NCGC00091340-02 | NCGC00091340-03 |
| NCGC00254474-01 | NCGC00259908-01 | NCI-C03361 |
| NSC 146476 | NSC-146476 | NSC146476 |
| Oprea1_312205 | Q410066 | RCRA waste no. U021 |
| RCRA waste number U021 | SBB060240 | SC-65115 |
| SCHEMBL29021 | SMR000033596 | SR-01000596939 |
| SR-01000596939-1 | ST24046012 | ST45137851 |
| STK317796 | T991 | TC-132836 |
| Tox21_202359 | Tox21_300405 | UN 1885 |
| UN1885 | UNII-2X02101HVF | W-204254 |
| WLN: ZR DR DZ | ZINC265747 | [1,1'-Biphenyl]-4,4'-diamine |
| [1,1'-Biphenyl]-4,4'-diamine, hydrochloride (1:2) | [1,1'-biphenyl]-4,4'-diamine (ACD/Name 4.0) | [1,4'-diamine |
| [4-(4-aminophenyl)-phenyl]-amine | biphenyl -4,4'-ylenediamine | biphenyl-4,4'-diamine |
| p,p'-Bianiline | p,p'-Diaminobiphenyl | p,p'-Dianiline |
| p,p'-diaminodiphenyl | p,p-Bianiline | p-Benzidine |
| p-Diaminodiphenyl | {[1,} 1'-Biphenyl]-4,4'-diamine |