Drug
D0811 | bithionol
D
P
P02BX01 Bithionol
[P02BX] Other antitrematodal agents
[P02B] ANTITREMATODALS
[P02] ANTHELMINTICS
[P] Antiparasitic products, insecticides and repellents
D10AB01 Bithionol
[D10AB] Preparations containing sulfur
[D10A] ANTI-ACNE PREPARATIONS FOR TOPICAL USE
[D10] ANTI-ACNE PREPARATIONS
[D] Dermatological drugs
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 0.66±0.52 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 0.97 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 2.47±1.39 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Danger |
Aggregated GHS information provided by 193 companies from 2 notifications to the ECHA C&L Inventory. H300 (100%): Fatal if swallowed [Danger Acute toxicity, oral] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P264, P270, P301+P310, P321, P330, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| rat | LD50 | oral | 492mg/kg (492mg/kg) | Pesticide Chemicals Official Compendium, Association of the American Pesticide Control Officials, Inc., 1966. Vol. -, Pg. 136, 1966. | |
| 2,2'-Dihydroxy-3,3',5,5'-tetrachlorodiphenyl sulfide | 2,2'-Dihydroxy-3,3',5,5'-tetrachlorodiphenylsulfide | 2,2'-Thio-bis(4,6-dichlorophenol) |
| 2,2'-Thiobis(4,6-dichlorophenol) | 2,2'-Thiobis[4,6-dichlorophenol] | 2,2'-sulfanediylbis(4,6-dichlorophenol) |
| 2,3',5,5'-tetrachlorodiphenyl sulfide | 2,4-dichloro-6-(3,5-dichloro-2-hydroxy-phenyl)sulfanyl-phenol | 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfanylphenol |
| 2,4-dichloro-6-[(3,5-dichloro-2-hydroxy-phenyl)thio]phenol | 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)thio]phenol | 2-Hydroxy-3,5-dichlorophenyl sulfide |
| 2-Hydroxy-3,5-dichlorophenyl sulphide | 2-[3,5-bis(chloranyl)-2-oxidanyl-phenyl]sulfanyl-4,6-bis(chloranyl)phenol | 6-(3,5-dichloro-2-hydroxyphenylthio)-2,4-dichlorophenol |
| 6068AF | 97-18-7 | A14941 |
| A1B988 | ACMC-209s88 | AI3-50518 |
| AK546901 | AKOS015856712 | AMT77LS62O |
| ANW-40854 | ARONIS27111 | Actamer |
| B1T | BDBM36880 | BIS(2-HYDROXY-3,5-DICHLOROPHENYL)SULFIDE |
| BRD-K39120595-304-03-9 | BRN 2003535 | BSPBio_001918 |
| Bidiphen | Bis(2-hydroxy-3,5-dichlorophenyl) sulfide | Bis(3,5-dichloro-2-hydroxyphenyl) sulfide |
| Bisoxyphen | Bithin | Bithin (TN) |
| Bithional | Bithionol (JAN/INN) | Bithionol [INN:BAN:JAN:NF] |
| Bithionol [INN:BAN:JAN] | Bithionol sulfide | Bithionol, >=98% (HPLC) |
| Bithionol, VETRANAL(TM), analytical standard | Bithionolate | Bithionolum |
| Bithionolum [INN-Latin] | Bitin | Bitionol |
| Bitionol [INN-Spanish] | C07967 | C12H6Cl4O2S |
| CAS-97-18-7 | CCRIS 2043 | CHEBI:3131 |
| CHEMBL290106 | CP 3438 | CS-3874 |
| CTK8B2783 | Caswell No. 852 | D 26 |
| D00802 | DB04813 | DSSTox_CID_1342 |
| DSSTox_GSID_21342 | DSSTox_RID_76096 | DTXSID9021342 |
| DivK1c_000639 | EINECS 202-565-0 | EPA Pesticide Chemical Code 064201 |
| FT-0707601 | GTPL2338 | HMS501P21 |
| HSDB 6380 | HY-17592 | IDI1_000639 |
| InChI=1/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H; | JFIOVJDNOJYLKP-UHFFFAOYSA- | JFIOVJDNOJYLKP-UHFFFAOYSA-N |
| KBio1_000639 | KBio2_000508 | KBio2_003076 |
| KBio2_005644 | KBio3_001418 | KBioGR_000694 |
| KBioSS_000508 | KS-000048LK | KSC-19-055 |
| KUC106451N | LS-2022 | Lorothidol |
| Lorothiodol | MCULE-6591279983 | MFCD00055727 |
| MLS000028403 | NCGC00018163-01 | NCGC00018163-02 |
| NCGC00018163-03 | NCGC00018163-04 | NCGC00018163-05 |
| NCGC00018163-06 | NCGC00018163-07 | NCGC00018163-08 |
| NCGC00018163-09 | NCGC00018163-10 | NCGC00021272-04 |
| NCGC00021272-05 | NCGC00021272-06 | NCGC00256573-01 |
| NCGC00257938-01 | NCI-C60628 | NINDS_000639 |
| NSC 47129 | NSC-47129 | NSC-9872 |
| NSC47129 | NSC9872 | Neopellis |
| Nobacter | Oprea1_473080 | PHENOL, 2,2'-THIOBIS(4,6-DICHLORO)- |
| Phenol, 2,2'-thiobis(4,6-dichloro- | Phenol, 2,2'-thiobis[4,6-dichloro- | Phenol,2'-thiobis[4,6-dichloro- |
| Prevenol | Q-200730 | Q4918862 |
| QTL1_000014 | REGID_for_CID_2406 | RTR-030210 |
| SBB071906 | SBI-0051298.P003 | SC-46723 |
| SCHEMBL64385 | SMR000058374 | SPBio_000126 |
| ST45027186 | STL257451 | Spectrum2_000113 |
| Spectrum3_000319 | Spectrum4_000257 | Spectrum5_000922 |
| Spectrum_000088 | TKhsd | TR-030210 |
| Tox21_110832 | Tox21_110832_1 | Tox21_200384 |
| Tox21_302919 | UNII-AMT77LS62O | Usaf B-22 |
| Vancide BL | WLN: QR BG DG FSR BQ CG EG | XL 7 |
| XL-7 | ZINC608213 | bis (2-hydroxy-3,5-dichlorophenyl)-sulphide |
| bithionol | cid_2406 | s4552 |