Drug
D0823 | butylparaben
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 19.00±0.00 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 35.48 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | rat | hepatocytes | MMP assay | Negative | IC50 | 163 | ||
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Warning |
Aggregated GHS information provided by 1135 companies from 11 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 543 of 1135 companies. For more detailed information, please visit ECHA C&L website Of the 9 notification(s) provided by 592 of 1135 companies with hazard statement code(s): H315 (93.24%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (93.24%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (89.02%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| mouse | LD50 | oral | 13200mg/kg (13200mg/kg) | Nippon Eiseigaku Zasshi. Japanese Journal of Hygiene. Vol. 28, Pg. 463, 1973. | |
| mouse | LD50 | intraperitoneal | 230mg/kg (230mg/kg) | sense organs and special senses: lacrimation: eye | Journal of the Society of Cosmetic Chemists. Vol. 28, Pg. 357, 1977. |
| 27K | 3QPI1U3FV8 | 4-(Butoxycarbonyl)phenol |
| 4-Hydroxybenzoic acid butyl ester | 4-Hydroxybenzoic acid, butyl ester | 4-Hydroxybenzoic acid-n-butyl ester |
| 4-Hydroxybenzoic acid-n-butyl ester 100 microg/mL in Acetonitrile | 4mg9 | 5434-74-2 |
| 94-26-8 | A16382 | AB00513951 |
| AB00513951_09 | ACMC-209rr1 | AI3-02930 |
| AK113821 | AKOS000121421 | ANW-40235 |
| AS-14309 | Aseptoform butyl | B3771 |
| BDBM23448 | BIDD:ER0231 | BPBio1_000780 |
| BRD-K08287586-001-03-6 | BRD-K08287586-001-08-5 | BRN 1103741 |
| BSPBio_000708 | BUTYL PARA HYDROXY BENZOATE | BUTYLPARABEN |
| Benzoic acid, 4-hydroxy-, butyl ester | Benzoic acid, p-hydroxy-, butyl ester | Butoben |
| Butyl //p//-Hydroxybenzoate | Butyl 4-?Hydroxybenzoate(Butyl Paraben) | Butyl 4-hydroxybenzoate |
| Butyl 4-hydroxybenzoate, 99+% | Butyl 4-hydroxybenzoate, >=99% | Butyl 4-hydroxybenzoate, >=99.0% (GC) |
| Butyl 4-hydroxybenzoate, SAJ first grade, >=99.0% | Butyl Par asept | Butyl butex |
| Butyl chemosept | Butyl p-hydroxybenzoate | Butyl paraben |
| Butyl parahydroxybenzoate | Butyl parahydroxybenzoate (JP15) | Butyl parahydroxybenzoate (JP17) |
| Butyl parahydroxybenzoate (TN) | Butyl parasept | Butyl tegosept |
| Butyl-Parasept | Butylparaben (NF) | Butylparaben (TN) |
| Butylparaben [NF] | Butylparaben [USAN] | CAS-94-26-8 |
| CCG-213596 | CCRIS 2462 | CHEBI:88542 |
| CHEMBL459008 | CS-4783 | CTK5A0578 |
| Caswell No. 130A | D01420 | DB14084 |
| DS-010619 | DSSTox_CID_209 | DSSTox_GSID_20209 |
| DSSTox_RID_75434 | DTXSID3020209 | EINECS 202-318-7 |
| EPA Pesticide Chemical Code 061205 | F0266-0124 | FEMA 2203 |
| FEMA No. 2203 | FEMA Number 2203 | FT-0623315 |
| HMS1570D10 | HMS2094A21 | HMS2097D10 |
| HMS2220G15 | HMS3327P04 | HMS3714D10 |
| HSDB 286 | HY-B1431 | InChI=1/C11H14O3/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h4-7,12H,2-3,8H2,1H; |
| K716 | KS-00000FUE | LS-1961 |
| Lexgard B | MCULE-3352613586 | MFCD00016478 |
| MLS000575004 | MLS002154054 | MLS002303045 |
| MP-2138 | N-Butyl-P-Hydroxybenzoate,(S) | NCGC00016354-01 |
| NCGC00016354-02 | NCGC00016354-03 | NCGC00016354-04 |
| NCGC00016354-05 | NCGC00016354-06 | NCGC00016354-07 |
| NCGC00016354-11 | NCGC00091142-01 | NCGC00091142-02 |
| NCGC00254294-01 | NCGC00259334-01 | NSC 8475 |
| NSC-759303 | NSC-8475 | NSC759303 |
| NSC8475 | Nipabutyl | Pharmakon1600-01505995 |
| Preserval B | Prestwick0_000894 | Prestwick1_000894 |
| Prestwick2_000894 | Prestwick3_000894 | Q3302873 |
| QFOHBWFCKVYLES-UHFFFAOYSA-N | RTX-012272 | SBB060338 |
| SBI-0206946.P001 | SCHEMBL3647 | SMR000462402 |
| SPBio_002917 | SPF | SR-01000389296 |
| SR-01000389296-1 | SR-01000389296-3 | ST2412715 |
| ST50405535 | Solbrol B | TRA0049963 |
| Tegosept B | Tegosept Butyl | Tox21_110393 |
| Tox21_110393_1 | Tox21_201785 | Tox21_300332 |
| UNII-3QPI1U3FV8 | W-100204 | WLN: QR DVO4 |
| Z291799028 | ZINC1586769 | butyl p-hydroxy benzoate |
| butyl-p-hydroxybenzoate | cid_7184 | n-Butyl hydroxybenzoate |
| n-Butyl p-hydroxybenzoate | n-Butyl paraben | n-Butyl parahydroxybenzoate |
| n-Butyl-4-hydroxybenzoate | n-Butyl-p-hydroxybenzoate | n-Butyl-paraben |
| n-butyl 4-hydroxybenzoate | p-Hydroxy butyl benzoate | p-Hydroxybenzoic acid butyl ester |
| p-Hydroxybenzoic acid n-butyl ester | p-Hydroxybenzoic acid, butyl ester | p-Hydroxybenzoic acid, n-butyl ester |
| p-Hydroxybenzoic butyl ester | s4584 |
| DrugBank Name | butylparaben |
| DrugBank | DB14084 |
| CAS Number | 1216904-65-2, 1416711-53-9, 3609-53-8, 36457-20-2, 5434-74-2, 94-26-8 |
| PubChem Compound | 7184 |
| KEGG Drug | D01420 |
| ChEBI | 88542 |