D0932 | fenticlor
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 2.15±0.36 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 5.48 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 13.88±8.84 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Danger |
Aggregated GHS information provided by 39 companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] H317 (97.44%): May cause an allergic skin reaction [Warning Sensitization, Skin] H318 (97.44%): Causes serious eye damage [Danger Serious eye damage/eye irritation] H335 (97.44%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H413 (97.44%): May cause long lasting harmful effects to aquatic life [Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P271, P272, P273, P280, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P332+P313, P333+P313, P362, P363, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| mouse | LDLo | intraperitoneal | 250mg/kg (250mg/kg) | "Summary Tables of Biological Tests," National Research Council Chemical-Biological Coordination Center. Vol. 7, Pg. 788, 1955. | |
| 2,2 -thiobis(4-chlorophenol) | 2,2'-Dihydroxy-5,5'-dichlorodiphenyl sulfide | 2,2'-Dihydroxy-5,5'-dichlorophenyl sulfide |
| 2,2'-THIOBIS(4-CHLORO- PHENOL) | 2,2'-THIOBIS(4-CHLOROPHENOL) | 2,2'-Thiobis4-chlorophenol |
| 2,2'-Thiobis[4-chlorophenol] | 2,2'-sulfanediylbis(4-chlorophenol) | 2,5'-dichlorodiphenyl sulfide |
| 2,5'-dichlorophenyl sulfide | 4,4'-dichloro-2,2'-thiodiphenol | 4-06-00-05645 (Beilstein Handbook Reference) |
| 4-chloranyl-2-(5-chloranyl-2-oxidanyl-phenyl)sulfanyl-phenol | 4-chloro-2-(5-chloro-2-hydroxy-phenyl)sulfanyl-phenol | 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol |
| 4-chloro-2-(5-chloro-2-hydroxyphenylthio)phenol | 4-chloro-2-[(5-chloro-2-hydroxy-phenyl)thio]phenol | 4-chloro-2-[(5-chloro-2-hydroxyphenyl)sulfanyl]phenol |
| 4-chloro-2-[(5-chloro-2-hydroxyphenyl)thio]phenol | 5,2'-dihydroxydiphenyl sulfide | 5,5'-Dichloro-2,2'-dihydroxydiphenyl sulfide |
| 97-24-5 | AB0013676 | ACMC-209s8a |
| AI3-08456 | AKOS000491331 | ALBB-012859 |
| ANUSOIHIIPAHJV-UHFFFAOYSA- | ANUSOIHIIPAHJV-UHFFFAOYSA-N | ANW-40856 |
| ARONIS001661 | AS-13478 | B0850 |
| BBL003411 | BDBM80984 | BRD-K19439093-001-01-0 |
| BRN 2057140 | Bis(2-hydroxy-5-chlorophenyl) sulfide | Bis(2-hydroxy-5-chlorophenyl)sulfide |
| Bis(5-chloro-2-hydroxyphenyl) Sulfide | C12H8Cl2O2S | CAS-97-24-5 |
| CCG-37773 | CCRIS 4731 | CHEBI:556580 |
| CHEMBL473535 | CR 305 | CTK8B2784 |
| Caswell No. 851 | D 25 | D 25 (VAN) |
| D 25-Antimykotikum | D04164 | D61659OVD0 |
| DB-022656 | DSSTox_CID_6137 | DSSTox_GSID_26137 |
| DSSTox_RID_78031 | DTXSID4026137 | EINECS 202-568-7 |
| EPA Pesticide Chemical Code 064209 | Epitope ID:131793 | FT-0683643 |
| Fentichlor | Fenticlor | Fenticlor (USAN/INN) |
| Fenticlor [USAN:INN:BAN] | Fenticloro | Fenticloro [INN-Spanish] |
| Fenticlorum | Fenticlorum [INN-Latin] | HL 1050 |
| HMS1540I04 | I412 | InChI=1/C12H8Cl2O2S/c13-7-1-3-9(15)11(5-7)17-12-6-8(14)2-4-10(12)16/h1-6,15-16H; |
| KS-0000134I | KS-00003V2Q | KSC-19-058 |
| KUC106499N | LS-2024 | MCULE-9101515986 |
| MLS002415676 | Meflorin | NCGC00013679 |
| NCGC00013679-02 | NCGC00013679-03 | NCGC00013679-04 |
| NCGC00013679-06 | NCGC00091879-01 | NCGC00091879-02 |
| NCGC00258514-01 | NCI55636 | NCI60_004363 |
| NCIStruc1_000386 | NCIStruc2_000549 | NSC 4112 |
| NSC 55636 | NSC-4112 | NSC-55636 |
| NSC4112 | NSC55636 | Novex |
| Oksid | Oprea1_024834 | Oprea1_589846 |
| Ovitrol | Ph 549 | Phenol, 2,2'-thiobis(4-chloro- |
| Phenol, 2,2'-thiobis[4-chloro- | Phenol,2'-thiobis[4-chloro- | Phentichlorum |
| PubChem15318 | Q5443595 | R1614 |
| S 7 | S 7 (VAN) | S 7 (antimycotic) |
| SCHEMBL23276 | SMR000145265 | SR-01000878241 |
| SR-01000878241-2 | ST029256 | ST24027234 |
| STK048543 | TR-031067 | TimTec1_002292 |
| Tox21_110031 | Tox21_110031_1 | Tox21_200961 |
| UNII-D61659OVD0 | VZ35833 | W-100113 |
| WLN: QR DG BSR BQ EG | ZINC136146 | bis-(2-hydroxy-5-chlorophenyl) sulfide |
| cid_7329 | component of Banish | component of Banish (Salt/Mix) |