Compound
D1009 | n,nφ-diethylcarbanilide
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 21.69±38.23 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | human | HepG2 | MMP assay | Negative | IC50 | 163 | ||
| MEMBRANE POTENTIAL | 13.11±16.35 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Warning |
Aggregated GHS information provided by 80 companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] H412 (100%): Harmful to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P264, P270, P273, P301+P312, P330, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| mouse | LD50 | intraperitoneal | 200mg/kg (200mg/kg) | National Technical Information Service. Vol. AD277-689, | |
| mouse | LD50 | oral | 2500mg/kg (2500mg/kg) | lungs, thorax, or respiration: cyanosis | Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 41(5), Pg. 21, 1976. |
| rat | LD50 | oral | 2750mg/kg (2750mg/kg) | lungs, thorax, or respiration: cyanosis | Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 41(5), Pg. 21, 1976. |
| 1,3-Diethyl-1,3-difenylmocovina | 1,3-Diethyl-1,3-difenylmocovina [Czech] | 1,3-Diethyl-1,3-diphenylurea |
| 1,3-Diethyl-1,3-diphenylurea, 99% | 1,3-Diethylcarbanilide | 1,3-Diethyldiphenylurea |
| 1,3-diethyl-1,3-di(phenyl)urea | 1,3-diethyl-1,3-diphenyl-urea | 4169Z9SDJG |
| 6400AF | 85-98-3 | AI3-01942 |
| AKOS015913312 | AS-59399 | BRN 2751977 |
| Bis(N-ethyl-N-phenyl)urea | Bis-(N-ethyl-N-fenyl)mocovina | Bis-(N-ethyl-N-fenyl)mocovina [Czech] |
| C-51905 | CAS-85-98-3 | CCRIS 4618 |
| CHEMBL1566472 | CTK5F6126 | Carbamite |
| Carbanilide, N,N'-diethyl- | Carbanilide,N'-diethyl- | Centralite |
| Centralite 1 | Centralite I | Centralite-1 |
| Centralite1 | D0485 | DB-056891 |
| DSSTox_CID_5040 | DSSTox_GSID_25040 | DSSTox_RID_77635 |
| DTXSID8025040 | EC 201-645-2 | EINECS 201-645-2 |
| Ethyl centralite | FT-0623546 | GL5447 |
| HMS3039F11 | InChI=1/C17H20N2O/c1-3-18(15-11-7-5-8-12-15)17(20)19(4-2)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3; | LS-1850 |
| MCULE-6917831209 | MFCD00035794 | MLS002415749 |
| N,N'-Diethyl-N,N'-diphenylurea | N,N'-Diethylcarbanilide | N,N'-Diethyldiphenylurea |
| N,N'-Diphenyl-N,N'-diethylurea | N,N-Diethylcarbanilide | N-ethyl(ethylphenylamino)-N-benzamide |
| NCGC00091392-01 | NCGC00091392-02 | NCGC00257923-01 |
| NSC 44038 | NSC-28779 | NSC-44038 |
| NSC28779 | NSC44038 | PZIMIYVOZBTARW-UHFFFAOYSA- |
| PZIMIYVOZBTARW-UHFFFAOYSA-N | Q5062193 | SCHEMBL263716 |
| SMR001370912 | ST51038243 | Tox21_200369 |
| UNII-4169Z9SDJG | USAF EK-1047 | Urea, 1,3-diethyl-1,3-diphenyl- |
| Urea, N,N'-diethyl-N,N'-diphenyl- | Urea,3-diethyl-1,3-diphenyl- | Urea,N'-diethyl-N,N'-diphenyl- |
| Urea,N,N'-diethyl-N,N'-diphenyl- | W-104072 | WLN: 2NR&VN2&R |
| ZINC3875598 | s-Diethyldiphenylurea | sym-Diethyldiphenylurea |
| CAS Number | 143556-24-5, 85-98-3, 92427-59-3 |
| PubChem Compound | 6828 |