Compound
D1017 | nitromide
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | human | qHTS-HepG2 | MMP assay | Negative | IC50 | 163 | ||
| MEMBRANE POTENTIAL | human | HepG2 | MMP assay | Negative | IC50 | 163 | ||
| MEMBRANE POTENTIAL | rat | hepatocytes | MMP assay | Negative | IC50 | 163 | ||
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Warning |
Aggregated GHS information provided by 42 companies from 2 notifications to the ECHA C&L Inventory. H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P264, P270, P301+P312, P330, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| chicken | LD50 | intraperitoneal | 280mg/kg (280mg/kg) | Toxicology and Applied Pharmacology. Vol. 7, Pg. 488, 1965. | |
| turkey | LD50 | oral | 1150mg/kg (1150mg/kg) | Toxicology and Applied Pharmacology. Vol. 7, Pg. 488, 1965. | |
| chicken | LD50 | oral | 900mg/kg (900mg/kg) | Toxicology and Applied Pharmacology. Vol. 7, Pg. 488, 1965. | |
| rat | LD50 | intraperitoneal | 320mg/kg (320mg/kg) | Toxicology and Applied Pharmacology. Vol. 7, Pg. 488, 1965. | |
| rat | LD50 | oral | 1250mg/kg (1250mg/kg) | Toxicology and Applied Pharmacology. Vol. 7, Pg. 488, 1965. | |
| 121-81-3 | 3, 5-Dinitrobenzamide | 3,5-DINITRO BENZAMIDE |
| 3,5-Dinitrobenzamide | 3,5-Dinitrobenzamide, 97% | 4-09-00-01351 (Beilstein Handbook Reference) |
| 5264AH | 9DUJ3CMK8S | A-8855 |
| A804791 | AB0004874 | AB00052054_04 |
| ACMC-20anc0 | ACT07882 | AKOS001434379 |
| AS-57407 | BRD-K76381435-001-02-9 | BRD-K76381435-001-04-5 |
| BRN 1981935 | BSPBio_002077 | Benzamide, 3,5-dinitro- |
| C7H5N3O5 | CAS-121-81-3 | CCG-39929 |
| CHEMBL1437065 | CTK0H4630 | D05191 |
| DB-022109 | DSSTox_CID_25836 | DSSTox_GSID_45836 |
| DSSTox_RID_81163 | DTXSID0045836 | DivK1c_000813 |
| EINECS 204-499-8 | FT-0614715 | HMS1920B06 |
| HMS2091J06 | HMS502I15 | HY-B0945 |
| IDI1_000813 | InChI=1/C7H5N3O5/c8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15/h1-3H,(H2,8,11); | J-004683 |
| KBio1_000813 | KBio2_001545 | KBio2_004113 |
| KBio2_006681 | KBio3_001577 | KBioGR_000633 |
| KBioSS_001545 | LS-26754 | MCULE-9213012419 |
| MFCD00007985 | MLS002207159 | NCGC00094736-01 |
| NCGC00094736-02 | NCGC00094736-03 | NCGC00094736-05 |
| NCI60_004694 | NINDS_000813 | NSC 60719 |
| NSC-60719 | NSC-757245 | NSC60719 |
| NSC757245 | Nitroamide | Nitromide (USAN) |
| Nitromide [USAN] | Nitromide, VETRANAL(TM), analytical standard | Pharmakon1600-01500435 |
| Q27272407 | SBB057213 | SBI-0051459.P003 |
| SC-47147 | SCHEMBL193674 | SMR001306736 |
| SPBio_000968 | SPECTRUM1500435 | SR-05000002028 |
| SR-05000002028-1 | SR-05000002028-3 | ST50308244 |
| Spectrum2_001044 | Spectrum3_000519 | Spectrum4_000077 |
| Spectrum5_001200 | Spectrum_001065 | TC-169911 |
| TRA0037962 | Tox21_111321 | Tox21_111321_1 |
| Tristat | UNII-9DUJ3CMK8S | UPCMLD0ENAT5895628:001 |
| UUKWKUSGGZNXGA-UHFFFAOYSA- | UUKWKUSGGZNXGA-UHFFFAOYSA-N | Unistat |
| VZ25861 | ZINC1690424 | component of Tristat |
| component of Unistat-3 | nitromide |