D1019 | nitroxoline
J
J01XX07 Nitroxoline
[J01XX] Other antibacterials
[J01X] OTHER ANTIBACTERIALS
[J01] ANTIBACTERIALS FOR SYSTEMIC USE
[J] Antiinfectives for systemic use
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 9.22±2.41 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 19.95 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 72.33±39.13 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Danger |
Aggregated GHS information provided by 206 companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H301+H311+H331 (76.7%): Toxic if swallowed, in contact with skin or if inhaled [Danger Acute toxicity, oral acute toxicity, dermal acute toxicity, inhalation] H301 (96.6%): Toxic if swallowed [Danger Acute toxicity, oral] H311 (96.6%): Toxic in contact with skin [Danger Acute toxicity, dermal] H315 (99.51%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (99.51%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H331 (96.6%): Toxic if inhaled [Danger Acute toxicity, inhalation] H335 (99.03%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P311, P312, P321, P322, P330, P332+P313, P337+P313, P361, P362, P363, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| 08N484 | 3ai8 | 4008-48-4 |
| 5-21-03-00297 (Beilstein Handbook Reference) | 5-NOK | 5-Nitro-8-hydroxyquinoline |
| 5-Nitro-8-oxychinoline | 5-Nitro-8-oxyquinoline | 5-Nitro-8-quinolinol |
| 5-Nitro-8-quinolinol|5-Nitro-8-hydroxyquinoline | 5-Nitro-8hydroxyquinoline | 5-Nitro-quinolin-8-ol |
| 5-Nitroks | 5-Nitroquinolin-8-ol, 96% | 5-Nitroquinoline-8-ol |
| 5-Nitrox | 5-Nitroxine | 5-nitroquinolin-8-ol |
| 5NOK | 8-Hydroxy-5-nitro-chinoline | 8-Hydroxy-5-nitroquinoline |
| 8-Hydroxy-5-nitroquinoline, 96% | 8-Quinolinol, 5-nitro- | A-82 |
| A6696 | A8M33244M6 | AB0010831 |
| AB00572598_14 | AB1003427 | AC-7828 |
| ACMC-209jar | AG-205/04556035 | AKOS001053242 |
| ANW-29281 | BAS 58 | BBL023366 |
| BDBM64987 | BRN 0166146 | CAS-4008-48-4 |
| CCG-213981 | CHEBI:67121 | CHEMBL1454910 |
| CS-4761 | CTK1D5867 | D07245 |
| DB-049530 | DB01422 | DSSTox_CID_26284 |
| DSSTox_GSID_46284 | DSSTox_RID_81510 | DTXSID4046284 |
| EINECS 223-662-4 | FT-0621541 | Galinok |
| HMS2230I14 | HMS3264C05 | HMS3374D08 |
| HNQ | HY-B1159 | InChI=1/C9H6N2O3/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8/h1-5,12; |
| Isinok | KSC-8-140 | KUC105356N |
| LS-142569 | LS20671 | MCULE-8622459990 |
| MFCD00006791 | MLS000069750 | MLS001148594 |
| NCGC00160664-01 | NCGC00160664-03 | NITROXOLINE |
| NSC 74947 | NSC-74947 | NSC-760393 |
| NSC74947 | NSC760393 | Nibiol |
| Nicene Forte | Nitrohydroxyquinoline | Nitroxolin |
| Nitroxolina | Nitroxolina [INN-Spanish] | Nitroxoline (INN) |
| Nitroxoline (TN) | Nitroxoline [INN:BAN:DCF] | Nitroxolinum |
| Nitroxolinum [INN-Latin] | Notroxoline | Noxibiol |
| Noxin | Opera_ID_204 | Oprea1_594857 |
| PS-5547 | Pharmakon1600-01506173 | PubChem7565 |
| Q304570 | Quinolin-8-ol, 5-nitro- | REGID_for_CID_19910 |
| RJIWZDNTCBHXAL-UHFFFAOYSA-N | RTR-015997 | SBB037944 |
| SC-04243 | SCHEMBL151248 | SMR000059036 |
| SR-01000721863 | SR-01000721863-4 | ST086486 |
| ST24029546 | STK099582 | T7793 |
| TR-015997 | Tox21_111969 | Tox21_111969_1 |
| UNII-A8M33244M6 | Uro-Coli | VQ10269 |
| W-106391 | WLN: T66 BNJ GNW JQ | Z56922155 |
| ZINC15831592 | cid_19910 | s4591 |
| DrugBank Name | nitroxoline |
| DrugBank | DB01422 |
| CAS Number | 112-13-0, 4008-48-4, 858275-30-6 |
| PubChem Compound | 19910 |
| KEGG Drug | D07245 |
| ChEBI | 67121 |