Drug
D1070 | propyl gallate
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| TRANSMEMBRANE POTENTIAL | >100 μM | 72hr | Epimastigote forms of Trypanosoma cruzi of Y strain, | measured by flow cytometry using JC-1 dye (BD MitoScreen kit) | Negative | IC50 | 305 | |
| MEMBRANE POTENTIAL | 42.29±3.93 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 35.48 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | rat | hepatocytes | MMP assay | Negative | IC50 | 163 | ||
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Warning |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H317: May cause an allergic skin reaction [Warning Sensitization, Skin] |
P261, P264, P270, P272, P280, P301+P312, P302+P352, P321, P330, P333+P313, P363, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
Aggregated GHS information provided by 1851 companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] H317 (99.95%): May cause an allergic skin reaction [Warning Sensitization, Skin] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P270, P272, P280, P301+P312, P302+P352, P321, P330, P333+P313, P363, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H317: May cause an allergic skin reaction [Warning Sensitization, Skin] |
P261, P264, P270, P272, P280, P301+P312, P302+P352, P321, P330, P333+P313, P363, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
 |
Danger |
H317: May cause an allergic skin reaction [Warning Sensitization, Skin] H334: May cause allergy or asthma symptoms or breathing difficulties if inhaled [Danger Sensitization, respiratory] |
P261, P272, P280, P285, P302+P352, P304+P341, P321, P333+P313, P342+P311, P363, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H317: May cause an allergic skin reaction [Warning Sensitization, Skin] |
P261, P272, P280, P302+P352, P321, P333+P313, P363, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| rabbit | LD50 | oral | 2750mg/kg (2750mg/kg) | National Technical Information Service. Vol. PB223-840, | |
| pig | LD50 | oral | > 6gm/kg (6000mg/kg) | kidney, ureter, and bladder: other changes | Voeding. Vol. 16, Pg. 683, 1955. |
| rat | LD50 | unreported | 2500mg/kg (2500mg/kg) | Voprosy Pitaniya. Problems of Nutrition. Vol. 25(6), Pg. 47, 1966. | |
| hamster | LD50 | oral | 2480mg/kg (2480mg/kg) | National Technical Information Service. Vol. PB223-840, | |
| rat | LD50 | oral | 2100mg/kg (2100mg/kg) | National Technical Information Service. Vol. PB245-441, | |
| mouse | LD50 | oral | 1700mg/kg (1700mg/kg) | Journal of the American Oil Chemists' Society. Vol. 54, Pg. 239, 1977. | |
| rat | LD50 | intraperitoneal | 380mg/kg (380mg/kg) | Food Technology Vol. 2, Pg. 308, 1948. | |
| 121-79-9 | 3,4,5-Trihydroxy-benzoic acid propyl ester | 3,4,5-Trihydroxybenzene-1-propylcarboxylate |
| 3,4,5-Trihydroxybenzoic acid n-propyl ester | 3,4,5-Trihydroxybenzoic acid propyl ester | 3,4,5-Trihydroxybenzoic acid, propyl ester |
| 3,5-Trihydroxybenzene-1-propylcarboxylate | 3,5-Trihydroxybenzoic acid, propyl ester | 8D4SNN7V92 |
| A19435 | AC-11365 | ACMC-209ahq |
| AI3-17136 | AK-94176 | AKOS001603853 |
| ANGC-121-79-9 | ANW-17868 | AS-11986 |
| AX8149297 | BCP13340 | BDBM50032154 |
| BI141962 | BIDD:ER0334 | Benzoic acid, 3,4,5-trihydroxy-, propyl ester |
| Benzoic acid,4,5-trihydroxy-, propyl ester | C11155 | CAS-121-79-9 |
| CBDivE_013134 | CCG-207932 | CCRIS 541 |
| CHEBI:10607 | CHEMBL7983 | CP0103 |
| CTK0H5537 | Certified Reference Material | D02382 |
| DB-003766 | DB12450 | DSSTox_CID_1201 |
| DSSTox_GSID_21201 | DSSTox_RID_76009 | DTXSID5021201 |
| E-310 | E310 | EFFF5FFA-651C-4DE3-A25F-D807C65D5537 |
| EINECS 204-498-2 | EU-0036319 | FEMA 2947 |
| FEMA No. 2947 | FT-0626599 | G0018 |
| Gallate, Propyl | Gallic acid n-propyl ester | Gallic acid propyl ester |
| Gallic acid propyl esterZ | Gallic acid, n-propyl ester | Gallic acid, propyl ester |
| Gallic acid-propyl ester | HSDB 591 | INS NO.310 |
| INS-310 | InChI=1/C10H12O5/c1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h4-5,11-13H,2-3H2,1H; | J10100 |
| KS-00000GZF | KSC175K3P | LS-655 |
| M-5795 | MCULE-2693876364 | MFCD00002196 |
| N-Propyl gallate | NCGC00164234-01 | NCGC00164234-02 |
| NCGC00164234-03 | NCGC00164234-04 | NCGC00254138-01 |
| NCGC00259835-01 | NCI-C50588 | NCI-C505888 |
| NCI60_002094 | NIPA 49 | NSC 2626 |
| NSC-2626 | NSC2626 | Nipagallin P |
| Nipanox S 1 | OR70180 | Oprea1_580415 |
| Pro gallin P | Progallin P | Propyl 3,4,5-trihydroxybenzoate |
| Propyl 3,5-trihydroxybenzoate | Propyl Gallate FCC | Propyl galiate |
| Propyl gallate (NF) | Propyl gallate [NF] | Propyl gallate, 98% |
| Propyl gallate, >=98%, FCC | Propyl gallate, European Pharmacopoeia (EP) Reference Standard | Propyl gallate, Pharmaceutical Secondary Standard |
| Propyl gallate, USP, 98.0-102.0% | Propyl gallate, United States Pharmacopeia (USP) Reference Standard | Propyl gallate, antioxidant, >=98.0% (HPLC) |
| Propyl gallate, for microscopy, >=98.0% (HPLC) | Propyl gallate, powder | Propylester kyseliny gallove |
| Propylester kyseliny gallove [Czech] | Propylgallate | Propylgallate,(S) |
| Q-201634 | Q608726 | RTR-034741 |
| SBB060377 | SC-19600 | SCHEMBL22630 |
| SR-01000944710 | SR-01000944710-1 | ST24031571 |
| ST50307922 | Sustane PG | TR-034741 |
| Tenox PG | Tox21_113531 | Tox21_202286 |
| Tox21_300060 | UNII-8D4SNN7V92 | WLN: QR BQ CQ EVO3 |
| ZINC1532172 | ZTHYODDOHIVTJV-UHFFFAOYSA-N | n-Propyl 3,4,5-trihydroxybenzoate |
| n-Propyl 3,5-trihydroxybenzoate | n-Propyl ester of 3,4,5-trihydroxybenzoic acid | n-Propyl ester of 3,5-trihydroxybenzoic acid |
| n-Propyl-3,4,5-Trihydroxybenzoate | n-propyl-gallate | propyl gallate |
| propyl-gallate | s5113 |