D1124 | thiram
P
P03AA05 Thiram
[P03AA] Sulfur containing products
[P03A] ECTOPARASITICIDES, INCL. SCABICIDES
[P03] ECTOPARASITICIDES, INCL. SCABICIDES, INSECTICIDES AND REPELLENTS
[P] Antiparasitic products, insecticides and repellents
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 1.94±25.92 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 24.49 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 16.51±20.26 | rat | hepatocytes | MMP assay | decrease | IC50 | 163 | |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
   |
Warning |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H315: Causes skin irritation [Warning Skin corrosion/irritation] H317: May cause an allergic skin reaction [Warning Sensitization, Skin] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] H332: Harmful if inhaled [Warning Acute toxicity, inhalation] H373 **: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P260, P261, P264, P270, P271, P272, P273, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P314, P321, P330, P332+P313, P333+P313, P337+P313, P362, P363, P391, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
Aggregated GHS information provided by 962 companies from 19 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] H317 (100%): May cause an allergic skin reaction [Warning Sensitization, Skin] H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H332 (100%): Harmful if inhaled [Warning Acute toxicity, inhalation] H373 (100%): Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] H400 (98.44%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410 (100%): Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P260, P261, P264, P270, P271, P272, P273, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P314, P321, P330, P332+P313, P333+P313, P337+P313, P362, P363, P391, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H315: Causes skin irritation [Warning Skin corrosion/irritation] H317: May cause an allergic skin reaction [Warning Sensitization, Skin] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] H332: Harmful if inhaled [Warning Acute toxicity, inhalation] H341: Suspected of causing genetic defects [Warning Germ cell mutagenicity] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P201, P202, P260, P261, P264, P270, P271, P272, P273, P280, P281, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P308+P313, P312, P314, P321, P330, P332+P313, P333+P313, P337+P313, P362, P363, P391, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
 |
Danger |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H317: May cause an allergic skin reaction [Warning Sensitization, Skin] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] H330: Fatal if inhaled [Danger Acute toxicity, inhalation] H340: May cause genetic defects [Danger Germ cell mutagenicity] H361: Suspected of damaging fertility or the unborn child [Warning Reproductive toxicity] H370: Causes damage to organs [Danger Specific target organ toxicity, single exposure] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] |
P201, P202, P260, P261, P264, P270, P271, P272, P280, P281, P284, P301+P312, P302+P352, P304+P340, P305+P351+P338, P307+P311, P308+P313, P310, P314, P320, P321, P330, P333+P313, P337+P313, P363, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H316: Causes mild skin irritation [Warning Skin corrosion/irritation] H317: May cause an allergic skin reaction [Warning Sensitization, Skin] H320: Causes eye irritation [Warning Serious eye damage/eye irritation] H340: May cause genetic defects [Danger Germ cell mutagenicity] H361: Suspected of damaging fertility or the unborn child [Warning Reproductive toxicity] H370: Causes damage to organs [Danger Specific target organ toxicity, single exposure] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] |
P201, P202, P260, P261, P264, P270, P272, P280, P281, P301+P312, P302+P352, P305+P351+P338, P307+P311, P308+P313, P314, P321, P330, P332+P313, P333+P313, P337+P313, P363, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H400: Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] H410: Very toxic to aquatic life with long lasting effects [Warning Hazardous to the aquatic environment, long-term hazard] |
P273, P391, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| (dimethylamino){[(dimethylamino)thioxomethyl]disulfanyl}methane-1-thione | .alpha.,.alpha.'-Dithiobis(dimethylthio)formamide | 0D771IS0FH |
| 1-(3-{[hydroxy(methoxy)methylidene]amino}phenoxy)-N-(3-methylphenyl)methanimidic acid | 1-(dimethylthiocarbamoyldisulfanyl)-N,N-dimethyl-methanethioamide | 137-26-8 |
| 26833-EP2280009A1 | 26833-EP2305658A1 | 26833-EP2314583A1 |
| 37T268 | 4-04-00-00242 (Beilstein Handbook Reference) | AB00052345_10 |
| AB1002114 | AI3-00987 | AKOS000120200 |
| Aapirol | Aatiram | Accel TMT |
| Accelerant T | Accelerator T | Accelerator thiuram |
| Aceto TETD | Agrichem flowable thiram | Akrochem TMTD |
| Anles | Arasan | Arasan 42-S |
| Arasan 42S | Arasan 50 red | Arasan 70 |
| Arasan 70-S Red | Arasan 75 | Arasan m |
| Arasan-M | Arasan-SF | Arasan-SF-X |
| Atiram | Attack | Attack [Antifungal] |
| Aules | B0486 | BDBM43362 |
| BIDD:ER0359 | BRD-K29254801-001-06-3 | BRN 1725821 |
| BSPBio_003184 | Basultra | Betoxin |
| Bis((dimethylamino)carbonothioyl) disulfide | Bis((dimethylamino)carbonothioyl) disulphide | Bis(dimethyl thiocarbamoyl)disulfide |
| Bis(dimethyl-thiocarbamoyl)-disulfid | Bis(dimethyl-thiocarbamoyl)-disulfid [German] | Bis(dimethylaminothiocarbonyl)disulfide |
| Bis(dimethylthiocarbamoyl) disulfide | Bis(dimethylthiocarbamoyl) disulfide | Bis(dimethylthiocarbamoyl) disulphide |
| Bis(dimethylthiocarbamyl) disulfide | Bis(dimethylthiocarbamyl) disulfide | Bis[(dimethylamino)carbonothioyl] disulfide |
| C-31381 | C11160 | C6H12N2S4 |
| CAS-137-26-8 | CC-34914 | CCG-35460 |
| CCRIS 1282 | CHEBI:9495 | CHEMBL120563 |
| CS-0012858 | CTK3J1182 | Caswell No. 856 |
| Chipco thiram 75 | Cunitex | Cyuram DS |
| D06114 | DB-042384 | DB13245 |
| DSSTox_CID_1332 | DSSTox_GSID_21332 | DSSTox_RID_76087 |
| DTXSID5021332 | Delsan | Disolfuro di tetrametiltiourame |
| Disolfuro di tetrametiltiourame [Italian] | Disulfide, bis(dimethylthiocarbamoyl) | Disulfure de tetramethylthiourame |
| Disulfure de tetramethylthiourame [French] | Disulfuro di tetrametiltiourame | Disulfuro di tetrametiltiourame [Italian] |
| DivK1c_000741 | EC 205-286-2 | EINECS 205-286-2 |
| ENT 987 | ENT-987 | EPA Pesticide Chemical Code 079801 |
| Ekagom TB | F0001-0468 | FMC 2070 |
| FT-0083178 | FT-0631799 | Falitiram |
| Fermide | Fermide 850 | Fernacol |
| Fernasan | Fernasan A | Fernide |
| Flo Pro T Seed Protectant | Formalsol | Formamide, 1,1'-dithiobis(N,N-dimethylthio- |
| Formamide,1'-dithiobis(N,N-dimethylthio- | Granuflo | HMS1922A12 |
| HMS2093E03 | HMS2234B08 | HMS3374C05 |
| HMS502F03 | HSDB 863 | Hermal |
| Hermat TMT | Heryl | Hexathir |
| Hy-Vic | IDI1_000741 | InChI=1/C6H12N2S4/c1-7(2)5(9)11-12-6(10)8(3)4/h1-4H3 |
| J-006992 | J-524968 | KBio1_000741 |
| KBio2_002167 | KBio2_004735 | KBio2_007303 |
| KBio3_002684 | KBioGR_001499 | KBioSS_002167 |
| KS-00000Z7X | KS-5354 | KSC491C8F |
| KUAZQDVKQLNFPE-UHFFFAOYSA- | KUAZQDVKQLNFPE-UHFFFAOYSA-N | Kregasan |
| LS-803 | MCULE-4171536161 | MFCD00008325 |
| MLS000069752 | MLS002702972 | Mercuram |
| Methyl Thiram | Methyl thiuramdisulfide | Methyl tuads |
| Methylthiuram disulfide | Metiur | Metiurac |
| Micropearls | N(1),N(1),N(3),N(3)-tetramethyl-2-dithioperoxy-1,3-dithiodicarbonic diamide | N,N',N'-Tetramethylthiuram disulfide |
| N,N'-(Dithiodicarbonothioyl)bis(N-methylmethanamine) | N,N,N',N'-Tetramethylthiuram disulfide | N,N-Tetramethylthiuram disulfide |
| N,N-Tetramethylthiuram disulphide | N,N-dimethyl[(dimethylcarbamothioyl)disulfanyl]carbothioamide | N,N-dimethylcarbamodithioic acid (dimethylthiocarbamoylthio) ester |
| N,N-dimethylcarbamodithioic acid [[dimethylamino(sulfanylidene)methyl]thio] ester; | NCGC00091563-01 | NCGC00091563-02 |
| NCGC00091563-03 | NCGC00091563-04 | NCGC00091563-05 |
| NCGC00091563-06 | NCGC00091563-07 | NCGC00091563-08 |
| NCGC00091563-09 | NCGC00091563-10 | NCGC00091563-12 |
| NCGC00255002-01 | NCGC00259118-01 | NCI60_001477 |
| NCI60_006736 | NCIMech_000272 | NCIOpen2_007854 |
| NINDS_000741 | NSC 1771 | NSC 49512 |
| NSC 59637 | NSC 622696 | NSC-1771 |
| NSC-49512 | NSC-622696 | NSC-758454 |
| NSC1771 | NSC49512 | NSC59637 |
| NSC622696 | NSC758454 | Naftocit thiuram 16 |
| Nobecutan | Nocceler TT | Nomersan |
| Normersan | Orac TMTD | Panoram 75 |
| Perkacit TMTD | Pharmakon1600-01503322 | Pol-Thiuram |
| Polyram ultra | Pomarsol | Pomarsol forte |
| Pomasol | Puralin | Q416572 |
| QTL1_000082 | RCRA waste no. U244 | RCRA waste number U244 |
| RTR-004967 | Radothiram | Rezifilm |
| Rezifilm (TN) | Robac TMT | Royal TMTD |
| SBB000804 | SBI-0051813.P002 | SC-18941 |
| SCHEMBL21144 | SMR000059023 | SPBio_001428 |
| SPECTRUM1503322 | SQ 1489 | SQ-1489 |
| SR-01000736911 | SR-01000736911-2 | ST044501 |
| STL264104 | Sadoplon | Sadoplon 75 |
| Spectrum2_001554 | Spectrum3_001592 | Spectrum4_000860 |
| Spectrum5_001653 | Spectrum_001687 | Spotrete |
| Spotrete WP 75 | Spotrete-F | Sranan-sf-X |
| TETRAMETHYLTHIOPEROXYDICARBONIC ACID [(H2N)C(S)]2S2 | TMT Disulfide | TMTD |
| TMTDS | TNTD | TR-004967 |
| TRA-0180716 | TUEX | Teramethylthiuram disulfide |
| Tersan | Tersan 75 | Tersantetramethyldiurane sulfide |
| Tetramethyl thiuram disulfide | Tetramethyl thiuramdisulfide | Tetramethyl thiurane disulfide |
| Tetramethyl thiurane disulphide | Tetramethyl-thiram disulfid | Tetramethyl-thiram disulfid [German] |
| Tetramethyldiurane sulphite | Tetramethylenethiuram disulfide | Tetramethylenethiuram disulphide |
| Tetramethylthiocarbamoyldisulphide | Tetramethylthioperoxydicarbonic diamide | Tetramethylthioramdisulfide |
| Tetramethylthioramdisulfide [Dutch] | Tetramethylthiouram disulfide | Tetramethylthiuram |
| Tetramethylthiuram bisulfide | Tetramethylthiuram bisulphide | Tetramethylthiuram disulfide |
| Tetramethylthiuram disulfide, 97% | Tetramethylthiuram disulphide | Tetramethylthiuran disulphide |
| Tetramethylthiurane disulfide | Tetramethylthiurum disulfide | Tetramethylthiurum disulphide |
| Tetrapom | Tetrasipton | Tetrathiuram disulfide |
| Tetrathiuram disulphide | Thianosan | Thillate |
| Thimar | Thimer | Thioknock |
| Thioperoxydicarbonic diamide (((H2N)C(S))2S2), N,N,N',N'-tetramethyl- | Thioperoxydicarbonic diamide (((H2N)C(S))2S2), tetramethyl- | Thioperoxydicarbonic diamide ((H2N)C(S))2S2, tetramethyl- |
| Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), N,N,N',N'-tetramethyl- | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), tetramethyl- | Thioperoxydicarbonic diamide, tetramethyl- |
| Thiosan | Thioscabin | Thiotex |
| Thiotox | Thiotox (fungicide) | Thiram |
| Thiram (Tmtd) | Thiram (USAN/INN) | Thiram 10 microg/mL in Cyclohexane |
| Thiram 75 | Thiram 80 | Thiram B |
| Thiram [BSI:ISO] | Thiram [USAN:INN:BSI:ISO] | Thiram [USAN:INN] |
| Thiram, PESTANAL(R), analytical standard | Thiram, certified reference material, TraceCERT(R) | Thiramad |
| Thirame | Thirame [INN-French] | Thirampa |
| Thiramum | Thiramum [INN-Latin] | Thirasan |
| Thiulin | Thiulix | Thiurad |
| Thiuram | Thiuram D | Thiuram M |
| Thiuram M rubber accelerator | Thiuram disulfide, tetramethyl- | Thiuram-M |
| Thiuramin | Thiuramyl | Thylate |
| Tiradin | Tirampa | Tiuramyl |
| Tox21_111150 | Tox21_111150_1 | Tox21_201569 |
| Tox21_301102 | Trametan | Tridipam |
| Tripomol | Tuads | Tutan |
| Tyradin | UNII-0D771IS0FH | VUAgT-I-4 |
| Vancida tm-95 | Vancide TM | Vancide TM-95 |
| Vanguard GF | Vulcafor TMT | Vulcafor TMTD |
| Vulkacit DTMT | Vulkacit TH | Vulkacit mtic |
| Vulkacit thiuram | Vulkazam S | WLN: 1N1 & YUS & SSYUS & N1 & 1 |
| ZINC1532176 | Zaprawa Nasienna T | [Me2NC(S)S]2 |
| [disulfanediylbis(carbonothioylnitrilo)]tetramethane | [dithiobis(carbonothioylnitrilo)]tetramethane | alpha,alpha'-Dithiobis(dimethylthio)formamide |
| bis (dimethyl thiocarbamoyl) disulfide | bmse000928 | cid_5455 |
| dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate | thiram | tiramo |