D1257 | Catechol
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| ELECTRON TRANSPORT CHAIN | 0.4 mM | NADH–Q | decrease | IC50 | 108 | |||
| Target | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| NADH:ubiquinone reductase | 0.4 mM | NADH–Q | inhibitor | IC50 | 108 | |||
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
   |
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H311: Toxic in contact with skin [Danger Acute toxicity, dermal] H315: Causes skin irritation [Warning Skin corrosion/irritation] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] H341: Suspected of causing genetic defects [Warning Germ cell mutagenicity] H350: May cause cancer [Danger Carcinogenicity] |
P201, P202, P264, P270, P280, P281, P301+P310, P302+P352, P305+P351+P338, P308+P313, P312, P321, P322, P330, P332+P313, P337+P313, P361, P362, P363, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
Aggregated GHS information provided by 3049 companies from 28 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H301 (18.07%): Toxic if swallowed [Danger Acute toxicity, oral] H302 (81.96%): Harmful if swallowed [Warning Acute toxicity, oral] H311 (18.1%): Toxic in contact with skin [Danger Acute toxicity, dermal] H312 (81.9%): Harmful in contact with skin [Warning Acute toxicity, dermal] H315 (99.97%): Causes skin irritation [Warning Skin corrosion/irritation] H317 (10.59%): May cause an allergic skin reaction [Warning Sensitization, Skin] H319 (95.41%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H341 (18.07%): Suspected of causing genetic defects [Warning Germ cell mutagenicity] H350 (13.35%): May cause cancer [Danger Carcinogenicity] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P261, P264, P270, P272, P280, P281, P301+P310, P301+P312, P302+P352, P305+P351+P338, P308+P313, P312, P321, P322, P330, P332+P313, P333+P313, P337+P313, P361, P362, P363, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. H317 (100%): May cause an allergic skin reaction [Warning Sensitization, Skin] H412 (100%): Harmful to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] |
P261, P272, P273, P280, P302+P352, P321, P333+P313, P363, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H412 (100%): Harmful to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] |
P264, P273, P280, P302+P352, P305+P351+P338, P321, P332+P313, P337+P313, P362, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H311: Toxic in contact with skin [Danger Acute toxicity, dermal] H315: Causes skin irritation [Warning Skin corrosion/irritation] H317: May cause an allergic skin reaction [Warning Sensitization, Skin] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] H341: Suspected of causing genetic defects [Warning Germ cell mutagenicity] H351: Suspected of causing cancer [Warning Carcinogenicity] |
P201, P202, P261, P264, P270, P272, P280, P281, P301+P310, P302+P352, P305+P351+P338, P308+P313, P312, P321, P322, P330, P332+P313, P333+P313, P337+P313, P361, P362, P363, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
 |
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H311: Toxic in contact with skin [Danger Acute toxicity, dermal] H315: Causes skin irritation [Warning Skin corrosion/irritation] H317: May cause an allergic skin reaction [Warning Sensitization, Skin] H318: Causes serious eye damage [Danger Serious eye damage/eye irritation] H332: Harmful if inhaled [Warning Acute toxicity, inhalation] H341: Suspected of causing genetic defects [Warning Germ cell mutagenicity] H401: Toxic to aquatic life [Hazardous to the aquatic environment, acute hazard] |
P201, P202, P261, P264, P270, P271, P272, P273, P280, P281, P301+P310, P302+P352, P304+P312, P304+P340, P305+P351+P338, P308+P313, P310, P312, P321, P322, P330, P332+P313, P333+P313, P361, P362, P363, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H301: Toxic if swallowed [Danger Acute toxicity, oral] H311: Toxic in contact with skin [Danger Acute toxicity, dermal] H314: Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] H318: Causes serious eye damage [Danger Serious eye damage/eye irritation] H335: May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H341: Suspected of causing genetic defects [Warning Germ cell mutagenicity] H351: Suspected of causing cancer [Warning Carcinogenicity] H361: Suspected of damaging fertility or the unborn child [Warning Reproductive toxicity] H370: Causes damage to organs [Danger Specific target organ toxicity, single exposure] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] |
P201, P202, P260, P261, P264, P270, P271, P280, P281, P301+P310, P301+P330+P331, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P307+P311, P308+P313, P310, P312, P314, P321, P322, P330, P361, P363, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| 1,2-Benzenediol | 1,2-Dihydroxybenzene | 1,2-Dihydroxybenzene, ReagentPlus(R), >=99% |
| 1,2-Dihydroxybenzene, XI | 1,2-benzenedio | 1,2-benzenediol |
| 1,2-dihydroxybenzene | 120-80-9 | 12385-08-9 |
| 19481-10-8 | 2-hydroxyphenol | 28696-EP2314579A1 |
| 2H-1-Benzopyran-3,5,7-triol, 2-(3,4-dihydroxyphenyl)-3,4-dihydro-,(2R-trans)- | 3437-EP2298767A1 | 3437-EP2301934A1 |
| 3437-EP2305633A1 | 3437-EP2314587A1 | 3fw4 |
| 4k7i | 4oow | A804599 |
| AB-131/40235236 | AB1002105 | ACMC-1BTYG |
| AI3-03995 | AKOS000119002 | ANW-17534 |
| BBL002408 | BDBM26188 | BIDD:ER0327 |
| BP-21156 | BRN 0471401 | Benzcatechin |
| Benzene, o-dihydroxy- | Benzene-1,2-diol (Pyrocatechol) | Benzene-1,2-diol) |
| C 9510 | C.I. 76500 | C.I. Oxidation Base 26 |
| C00090 | C01785 | C15571 |
| CAQ | CAS-120-80-9 | CCG-204375 |
| CCRIS 741 | CHEBI:18135 | CHEMBL280998 |
| CI 76500 | CI Oxidation Base 26 | CTK0H7279 |
| Catechin (phenol) | Catechol | Catechol |
| Catechol (Pyrocatechol | Catechol (phenol) | Catechol 100 microg/mL in Acetonitrile |
| Catechol, 99+% | Catechol-pyrocatechol | DB-003770 |
| DB02232 | DSSTox_CID_257 | DSSTox_GSID_20257 |
| DSSTox_RID_75468 | DTXSID3020257 | Durafur Developer CFouramine PCH |
| Durafur developer C | EC 204-427-5 | EINECS 204-427-5 |
| EU-0100280 | F0001-0332 | FT-0606411 |
| Fouramine PCH | Fourrine 68 | HMS2233A17 |
| HMS3260H22 | HMS3373K16 | HSDB 1436 |
| InChI=1/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8 | KS-000000NB | KSC177E7T |
| Kachin | Katechol | Katechol [Czech] |
| LF3AJ089DQ | LP00280 | LS-637 |
| Lopac-C-9510 | Lopac0_000280 | MCULE-9007211544 |
| MFCD00002188 | MLS002153385 | MLS002303022 |
| NCGC00015283-01 | NCGC00015283-02 | NCGC00015283-03 |
| NCGC00015283-04 | NCGC00015283-05 | NCGC00015283-06 |
| NCGC00015283-07 | NCGC00015283-08 | NCGC00091262-01 |
| NCGC00091262-02 | NCGC00091262-03 | NCGC00253952-01 |
| NCGC00259866-01 | NCGC00260965-01 | NCI-C55856 |
| NSC 1573 | NSC-1573 | NSC1573 |
| Oxyphenate | Oxyphenic acid | P0317 |
| P0567 | Pelagol Grey C | Phthalhydroquinone |
| Phthalic alcohol | Pyrocatechine | Pyrocatechinic acid |
| Pyrocatechinic acidPyrocatechol | Pyrocatechol | Pyrocatechol, >=99% |
| Pyrocatechol, certified reference material, TraceCERT(R) | Pyrocatechol, p.a., 99.0% | Pyrocatechol, plant cell culture tested, BioReagent, >=99%, powder |
| Pyrocatechol, purified by sublimation, >=99.5% | Pyrokatechin | Pyrokatechin [Czech] |
| Pyrokatechol | Pyrokatechol [Czech] | Q282440 |
| RTR-003436 | SBB040792 | SC-19023 |
| SCHEMBL18351 | SDCCGSBI-0050268.P002 | SMR000326660 |
| SR-01000075791 | SR-01000075791-1 | ST2407554 |
| ST50214346 | STK398651 | T7344 |
| TR-003436 | TRA0043461 | Tox21_202317 |
| Tox21_300153 | Tox21_500280 | UNII-LF3AJ089DQ |
| W-109068 | WLN: QR BQ | YCIMNLLNPGFGHC-UHFFFAOYSA-N |
| Z1262246103 | ZINC13512214 | alpha-hydroxyphenol |
| benzene diol | benzene-1,2-diol | benzenediol |
| bmse000385 | catechol | o Dihydroxybenzene |
| o-Benzenediol | o-Dihydroxybenzene | o-Dioxybenzene |
| o-Diphenol | o-Hydroquinone | o-Hydroxyphenol |
| o-Phenylenediol | o-dihydroxy-benzene | ortho-Benzenediol |
| ortho-Dihydroxybenzene | ortho-Dioxybenzene | ortho-Hydroquinone |
| ortho-Hydroxyphenol | ortho-Phenylenediol | ortho-Quinol |
| ortho-diphenol | phenol derivative, 2 | pyrocatechin |
| pyrocatechol | s6305 |
| DrugBank Name | 1,2-Dihydroxybenzene |
| DrugBank | DB02232 |
| CAS Number | 104130-35-0, 120-80-9, 12385-08-9, 37349-32-9 |
| PubChem Compound | 289 |
| KEGG Compound ID | C00090|C15571 |
| ChEBI | 18135 |
| ChemSpider | 13837760 |
| BindingDB | 26188.0 |
| Wikipedia | Catechol |