Drug
D0109 | Salicylic acid
D
S
N
S01BC08 Salicylic acid
[S01BC] Antiinflammatory agents, non-steroids
[S01B] ANTIINFLAMMATORY AGENTS
[S01] OPHTHALMOLOGICALS
[S] Sensory organs
N02BA12 Potassium salicylate
[N02BA] Salicylic acid and derivatives
[N02B] OTHER ANALGESICS AND ANTIPYRETICS
[N02] ANALGESICS
[N] Nervous system
N02BA04 Sodium salicylate
[N02BA] Salicylic acid and derivatives
[N02B] OTHER ANALGESICS AND ANTIPYRETICS
[N02] ANALGESICS
[N] Nervous system
D01AE12 Salicylic acid
[D01AE] Other antifungals for topical use
[D01A] ANTIFUNGALS FOR TOPICAL USE
[D01] ANTIFUNGALS FOR DERMATOLOGICAL USE
[D] Dermatological drugs
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| UNCOUPLING | increase | 31 | ||||||
| ASSOCIATE WITH UNCOUPLING | rat | liver mitochondria | RST assay( Respiratory Screening Technology)-measurement of oxygen consumption in isolated mitochondria using a phosphorescent oxygen-sensitive probe A65N-1 | affect | 204 | |||
| MEMBRANE POTENTIAL | 304.3 µM | 30 mins | mouse | liver mitochondria | Rh123 fluorescence (excitation 485 nm, emission 535 nm) are recorded using a fluorescence multi-well plate reader (mCICCP (20 µM) treatments was considered as the 100% baseline for ΔΨm loss) | decrease | EC20 | 36 |
| RESPIRATION | 354.4 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Rotenone (2µM) was used as 100% baseline for complex I inhibition. | decrease | EC20 | 36 |
| RESPIRATION | 120.9 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Oligomycin A (1µM) was used as 100% baseline for complex II inhibition. | decrease | EC20 | 36 |
| OXYGEN CONSUMPTION RATE (OCR) | 1 mM | 2 minutes | human | HepG2 | Measurement of OCR | Negative | EC50 | 7 |
| ECAR | 1 mM | 2 minutes | human | HepG2 | Measurement of ECAR | Negative | EC50 | 7 |
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | decrease | 32 | ||||||
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | decrease | 35 | ||||||
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | affect | 227 | ||||||
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | >400μM | >400 | mice | Lean mice vs Ob/ob mice | Measurement of oxygen consumption in the presence of ADP (state 3) and the different substrates was carried out on the Mitologics screening platform | EC20 | 227 | |
| SWELLING | > 400 µM | 30 mins | mouse | liver mitochondria | swelling assay: Absorbance at 545 nm using a fluorescence multi-well plate reader (CaCl2 (50 µM) was considered as the 100% baseline for the swelling ) | increase | EC20 | 36 |
| Target | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| NADH:ubiquinone reductase | 354.4 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Rotenone (2µM) was used as 100% baseline for complex I inhibition. | inhibit | EC20 | 36 |
| Succinate dehydrogenase | 120.9 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Oligomycin A (1µM) was used as 100% baseline for complex II inhibition. | inhibit | EC20 | 36 |
| Cytochrome c | > 200 µM | 30 mins | mouse | liver mitochondria | Cytochrome c release was evaluated using ELISA kit ( 20 µg/ml Alamethicin was used as 100% baseline) | release | EC20 | 36 |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
   |
Danger |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H318: Causes serious eye damage [Danger Serious eye damage/eye irritation] H361d: Suspected of damaging the unborn child [Warning Reproductive toxicity] |
P201, P202, P264, P270, P280, P281, P301+P312, P305+P351+P338, P308+P313, P310, P330, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
Aggregated GHS information provided by 4655 companies from 43 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 7 of 4655 companies. For more detailed information, please visit ECHA C&L website Of the 42 notification(s) provided by 4648 of 4655 companies with hazard statement code(s): H302 (98.13%): Harmful if swallowed [Warning Acute toxicity, oral] H312 (46.23%): Harmful in contact with skin [Warning Acute toxicity, dermal] H318 (49.1%): Causes serious eye damage [Danger Serious eye damage/eye irritation] H319 (52.07%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P264, P270, P280, P301+P312, P302+P352, P305+P351+P338, P310, P312, P322, P330, P337+P313, P363, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H318: Causes serious eye damage [Danger Serious eye damage/eye irritation] |
P264, P270, P280, P301+P312, P305+P351+P338, P310, P330, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Danger |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H315: Causes skin irritation [Warning Skin corrosion/irritation] H317: May cause an allergic skin reaction [Warning Sensitization, Skin] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] H361: Suspected of damaging fertility or the unborn child [Warning Reproductive toxicity] H370: Causes damage to organs [Danger Specific target organ toxicity, single exposure] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H402: Harmful to aquatic life [Hazardous to the aquatic environment, acute hazard] |
P201, P202, P260, P261, P264, P270, P272, P273, P280, P281, P301+P312, P302+P352, P305+P351+P338, P307+P311, P308+P313, P314, P321, P330, P332+P313, P333+P313, P337+P313, P362, P363, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| mouse | LD50 | intravenous | 184mg/kg (184mg/kg) | behavioral: convulsions or effect on seizure threshold | Yakugaku Zasshi. Journal of Pharmacy. Vol. 91, Pg. 550, 1971. |
| mouse | LD50 | oral | 480mg/kg (480mg/kg) | "Handbook of Toxicology," 4 vols., Philadelphia, W.B. Saunders Co., 1956-59Vol. 5, Pg. 148, 1959. | |
| mammal (species unspecified) | LC50 | inhalation | > 300mg/m3 (300mg/m3) | Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 57(7-8), Pg. 31, 1992. | |
| rat | LC50 | inhalation | > 900mg/m3/1H (900mg/m3) | BIOFAX Industrial Bio-Test Laboratories, Inc., Data Sheets. Vol. 21-3/1971, | |
| man | TDLo | skin | 57mg/kg (57mg/kg) | sense organs and special senses: tinnitus: ear | JAMA, Journal of the American Medical Association. Vol. 244, Pg. 660, 1980. |
| mouse | LD50 | intraperitoneal | 300mg/kg (300mg/kg) | Gendai no Rinsho. Vol. 3, Pg. 675, 1969. | |
| rabbit | LD50 | oral | 1300mg/kg (1300mg/kg) | Drugs in Japan Vol. 6, Pg. 291, 1982. | |
| mouse | LD60 | subcutaneous | 520mg/kg (520mg/kg) | Archives Internationales de Pharmacodynamie et de Therapie. Vol. 38, Pg. 9, 1930. | |
| rabbit | LDLo | subcutaneous | 6gm/kg (6000mg/kg) | "Abdernalden's Handbuch der Biologischen Arbeitsmethoden." Vol. 4, Pg. 1392, 1935. | |
| rat | LD50 | skin | > 2gm/kg (2000mg/kg) | Acute Toxicity Data. Journal of the American College of Toxicology, Part B. Vol. 15(Suppl, | |
| women | TDLo | skin | 111mg/kg/10D- (111mg/kg) | Postgraduate Medical Journal. Vol. 70, Pg. 146, 1994. | |
| rat | LD50 | intraperitoneal | 157mg/kg (157mg/kg) | Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 57(7-8), Pg. 31, 1992. | |
| cat | LD50 | oral | 400mg/kg (400mg/kg) | "Handbook of Toxicology," 4 vols., Philadelphia, W.B. Saunders Co., 1956-59Vol. 5, Pg. 148, 1959. | |
| rat | LD50 | oral | 891mg/kg (891mg/kg) | BIOFAX Industrial Bio-Test Laboratories, Inc., Data Sheets. Vol. 21-3/1971, | |
| rabbit | LD50 | skin | > 10gm/kg (10000mg/kg) | BIOFAX Industrial Bio-Test Laboratories, Inc., Data Sheets. Vol. 21-3/1971, | |
| 18917-89-0 | 18917-95-8 | 197900-EP2269975A2 |
| 197900-EP2269997A2 | 197900-EP2275415A2 | 2-Carboxyphenol |
| 2-Hydroxybenzenecarboxylate | 2-Hydroxybenzenecarboxylic acid | 2-Hydroxybenzoate, I |
| 2-Hydroxybenzoic Acid, Natural | 2-Hydroxybenzoic acid | 2-hydroxobenzoic acid |
| 2-hydroxy benzoic acid | 2-hydroxy-benzoic acid | 29656-58-4 |
| 3253-EP2269610A2 | 3253-EP2269988A2 | 3253-EP2270002A1 |
| 3253-EP2270006A1 | 3253-EP2270008A1 | 3253-EP2270011A1 |
| 3253-EP2270113A1 | 3253-EP2272935A1 | 3253-EP2275401A1 |
| 3253-EP2275413A1 | 3253-EP2275420A1 | 3253-EP2277867A2 |
| 3253-EP2280003A2 | 3253-EP2280008A2 | 3253-EP2280010A2 |
| 3253-EP2281563A1 | 3253-EP2281816A1 | 3253-EP2284146A2 |
| 3253-EP2284147A2 | 3253-EP2284160A1 | 3253-EP2284178A2 |
| 3253-EP2284179A2 | 3253-EP2287156A1 | 3253-EP2289510A1 |
| 3253-EP2289883A1 | 3253-EP2289890A1 | 3253-EP2292592A1 |
| 3253-EP2292597A1 | 3253-EP2292617A1 | 3253-EP2295053A1 |
| 3253-EP2295401A2 | 3253-EP2295416A2 | 3253-EP2295424A1 |
| 3253-EP2295433A2 | 3253-EP2298734A2 | 3253-EP2298735A1 |
| 3253-EP2298748A2 | 3253-EP2298757A2 | 3253-EP2298758A1 |
| 3253-EP2298759A1 | 3253-EP2298764A1 | 3253-EP2298765A1 |
| 3253-EP2301931A1 | 3253-EP2301937A1 | 3253-EP2301940A1 |
| 3253-EP2305243A1 | 3253-EP2305248A1 | 3253-EP2305257A1 |
| 3253-EP2305646A1 | 3253-EP2305651A1 | 3253-EP2305655A2 |
| 3253-EP2305662A1 | 3253-EP2305663A1 | 3253-EP2305664A1 |
| 3253-EP2305675A1 | 3253-EP2308851A1 | 3253-EP2308854A1 |
| 3253-EP2308873A1 | 3253-EP2308875A1 | 3253-EP2311807A1 |
| 3253-EP2311809A1 | 3253-EP2311810A1 | 3253-EP2311814A1 |
| 3253-EP2311831A1 | 3253-EP2311842A2 | 3253-EP2314574A1 |
| 3253-EP2314588A1 | 3253-EP2316457A1 | 3253-EP2316458A1 |
| 3253-EP2316459A1 | 3253-EP2316825A1 | 3253-EP2316826A1 |
| 3253-EP2316827A1 | 3253-EP2316828A1 | 3253-EP2316836A1 |
| 3253-EP2372017A1 | 3253-EP2380874A2 | 44642-EP2281819A1 |
| 44642-EP2292619A1 | 44642-EP2305659A1 | 44642-EP2311818A1 |
| 69-72-7 | 8052-31-1 | AB00489876_15 |
| AB1002436 | ACMC-1AZIK | AI3-02407 |
| AK112186 | AKOS000118979 | ALPHA/BETA HYDROXY ACIDS (SALICYLIC ACID) (SEE ALPHA/BETA HYDROXY ACIDS) |
| ANW-43703 | ARONIS27188 | ATA fraction 10, ammonium salt |
| Acido o-idrossibenzoico | Acido o-idrossibenzoico [Italian] | Acido salicilico |
| Acido salicilico [Italian] | Acidum salicylicum | Advanced pain relief callus removers |
| Advanced pain relief corn removers | Akurza Cream | Akurza Lotion |
| Alpha/Beta Hydroxy Acids (Glycolic Acid, Salicylic Acid) | Anti-blemish | BCP09067 |
| BDBM26193 | BENZOIC ACID,2-HYDROXY SALICYLIC ACID | BIDD:ER0602 |
| BP-12826 | BRN 0774890 | Bazuka Extra Strength Gel |
| Benzoic acid, 2-hydroxy- | Benzoic acid, 2-hydroxy- (9CI) | Benzoic acid, hydroxy- |
| Benzoic acid, o-hydroxy- | C00805 | CAS-69-72-7 |
| CCG-212792 | CCRIS 6714 | CHEBI:16914 |
| CHEMBL424 | CMC_13852 | CTK1A3418 |
| Caswell No. 731 | Certified Reference Material | Clear away wart remover |
| D00097 | DB00936 | DHS Sal Shampoo |
| DSSTox_CID_6368 | DSSTox_GSID_26368 | DSSTox_RID_78106 |
| DTXSID7026368 | DivK1c_000301 | Domerine |
| Domerine (Salt/Mix) | Dr. Scholl's callus removers | Dr. Scholl's corn removers |
| Dr. Scholl's wart remover kit | DuoPlant Gel | Duofil wart remover |
| Duofilm | Duofilm (Salt/Mix) | Duofilm Wart Remover |
| Duoplant | Durasal | E9A559BE-383B-4F83-BC02-3031D03D558A |
| EC 200-712-3 | EINECS 200-712-3 | EPA Pesticide Chemical Code 076602 |
| Epitope ID:124929 | F2191-0216 | FEMA3985 |
| FT-0645123 | Fostex (Salt/Mix) | Freezone |
| GTPL4306 | HMS2233A10 | HMS3373M19 |
| HSDB 672 | HY-B0167 | Hydrisalic Gel |
| IDI1_000301 | InChI=1/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10 | Ionil |
| Ionil plus | Ionil-Plus | J-509667 |
| K 537 | KBio1_000301 | KBio2_001428 |
| KBio2_003996 | KBio2_006564 | KBioSS_001428 |
| KS-00000KPH | KS-000048O6 | KSC-11-207-4 |
| KSC203I1R | KUC106694N | Keralyt |
| Kyselina 2-hydroxybenzoova | Kyselina 2-hydroxybenzoova [Czech] | Kyselina salicylova |
| Kyselina salicylova [Czech] | LS-2169 | MCULE-8407868694 |
| MFCD00002439 | MLS000069653 | Mediplast pads |
| NCGC00159447-02 | NCGC00159447-04 | NCGC00159447-05 |
| NCGC00159447-06 | NCGC00257065-01 | NCGC00259022-01 |
| NE10196 | NINDS_000301 | NSC 180 |
| NSC-180 | NSC180 | NSC629474 |
| Natural Salicylic Acid | O414PZ4LPZ | Occlusal |
| Opera_ID_582 | Oprea1_040343 | Orthohydroxybenzoic acid |
| P&S Shampoo | Pernox (Salt/Mix) | Phenol-2-carboxylate |
| Phenol-2-carboxylic acid | Propa pH Peel-Off Acne Mask | Psoriacid-S-stift |
| Q193572 | RTR-032850 | Retarder SAX (Salt/Mix) |
| Retarder W | Rutranex | SALICYLIC ACID (SEE ALSO ALPHA HYDROXY ACIDS) |
| SBB052826 | SBI-0051510.P003 | SC-18305 |
| SCHEMBL1967 | SGCUT00012 | SMP2_000145 |
| SMR000059163 | ST2416966 | ST51046715 |
| STK258681 | Salex Cream | Salex Lotion |
| Salicyclic acid | Salicylic Acid 1.0 mg/ml in Acetonitrile | Salicylic Acid,(S) |
| Salicylic acid & Sulfur Soap | Salicylic acid & Sulfur Soap (Salt/Mix) | Salicylic acid (6CI,8CI) |
| Salicylic acid (JP17/USP) | Salicylic acid (TN) | Salicylic acid ACS grade |
| Salicylic acid [USAN:JAN] | Salicylic acid [USP:JAN] | Salicylic acid collodion |
| Salicylic acid inclusion complex | Salicylic acid soap | Salicylic acid, 1.0 mg/mL in acetonitrile, ampule of 1 mL, certified reference material |
| Salicylic acid, 99+% | Salicylic acid, 99+%, ACS reagent | Salicylic acid, >=99%, FG |
| Salicylic acid, ACS reagent, >=99.0% | Salicylic acid, BioXtra, >=99.0% | Salicylic acid, British Pharmacopoeia (BP) Reference Standard |
| Salicylic acid, European Pharmacopoeia (EP) Reference Standard | Salicylic acid, LR, >=99% | Salicylic acid, Pharmaceutical Secondary Standard |
| Salicylic acid, ReagentPlus(R), >=99% | Salicylic acid, SAJ first grade, >=99.0% | Salicylic acid, United States Pharmacopeia (USP) Reference Standard |
| Salicylic acid, Vetec(TM) reagent grade, 98% | Salicylic acid, certified reference material, TraceCERT(R) | Salicylic acid, meets analytical specification of Ph. Eur., BP, USP, 99.5-100.5% (calc. to the dried substance) |
| Salicylic acid, p.a., 99.0% | Salicylic acid, plant cell culture tested | Salicylic acid, puriss. p.a., >=99.0% (T) |
| Salicylic acid, tech | Salicylic acid, tech. | Salicylic acid, tested according to Ph.Eur. |
| Salicylic acid,medicinal | Saligel | Salonil |
| Sebucare | Sebucare (Salt/Mix) | Sebulex |
| Sebulex (Salt/Mix) | Spectrum_000948 | Stri-Dex |
| TR-032850 | TS-03583 | Tox21_113453 |
| Tox21_201471 | Tox21_303109 | Trans-Ver-Sal |
| UNII-I3P9R8317T component YGSDEFSMJLZEOE-UHFFFAOYSA-N | UNII-O414PZ4LPZ | UPCMLD-DP126 |
| UPCMLD-DP126:001 | Verrugon | WLN: QVR BQ |
| YGSDEFSMJLZEOE-UHFFFAOYSA-N | ZINC1554 | bmse000252 |
| component of Fostex medicated bar and cream (Salt/Mix) | component of Keralyt (Salt/Mix) | component of Solarcaine first aid spray (Salt/Mix) |
| component of Tinver (Salt/Mix) | hydroxy-benzoic acid | o-Carboxyphenol |
| o-hydroxy benzoic acid | o-hydroxybenzoic acid | ortho-Hydroxybenzoic Acid |
| ortho-salicylic acid | phenol derivative, 7 | s4539 |
| salicylic acid | salicylic-acid | salicylicum acidum |
| to_000004 |
| DrugBank Name | Salicylic acid |
| DrugBank | DB00936 |
| CAS Number | 1189678-81-6, 12214-50-5, 29656-58-4, 34144-47-3, 63-36-5, 69-72-7, 8052-31-1, 94891-34-6, 97952-82-4 |
| PubChem Compound | 338 |
| KEGG Compound ID | C00805 |
| KEGG Drug | D00097 |
| PubChem.Substance | 46504942 |
| ChEBI | 16914 |
| PharmGKB | PA451299 |
| ChemSpider | 331 |
| BindingDB | 26193.0 |
| TTD | DAP000731 |
| Wikipedia | Salicylic_acid |
| HET | SAL |
| DPD | 9766|9783 |
1. Chan et al. (2005)
2. Nulton-Persson et al. (2004)