Drug
D0398 | resveratrol
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | 1.60±0.43 | human | qHTS-HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | 3.71 | human | HepG2 | MMP assay | decrease | IC50 | 163 | |
| MEMBRANE POTENTIAL | rat | hepatocytes | MMP assay | Negative | IC50 | 163 | ||
| MEMBRANE POTENTIAL | 395.4 µM | 30 mins | mouse | liver mitochondria | Rh123 fluorescence (excitation 485 nm, emission 535 nm) are recorded using a fluorescence multi-well plate reader (mCICCP (20 µM) treatments was considered as the 100% baseline for ΔΨm loss) | decrease | EC20 | 36 |
| RESPIRATION | 7.7 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Rotenone (2µM) was used as 100% baseline for complex I inhibition. | decrease | EC20 | 36 |
| RESPIRATION | ND | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Oligomycin A (1µM) was used as 100% baseline for complex II inhibition. | Negative | EC20 | 36 |
| ELECTRON TRANSPORT CHAIN | affect | 170 | ||||||
| ELECTRON TRANSPORT CHAIN | 27.7 μM | rat | brain SMP, ATP synthesis | decrease | 140 | |||
| ELECTRON TRANSPORT CHAIN | 14 μM | rat | liver MF1-ATPase | decrease | 141 | |||
| ELECTRON TRANSPORT CHAIN | 19 μM | rat | brain M F0F1-ATPase | decrease | 140 | |||
| ELECTRON TRANSPORT CHAIN | 6.4 μM | bovine | bovine heart MF1-ATPase | decrease | 142 | |||
| ELECTRON TRANSPORT CHAIN | 2 μM | human | human umbilical vein endothelial cell, nonmitochondrial ATP synthase, ATP synthesis | decrease | 136 | |||
| SWELLING | > 200 µM | 30 mins | mouse | liver mitochondria | swelling assay: Absorbance at 545 nm using a fluorescence multi-well plate reader (CaCl2 (50 µM) was considered as the 100% baseline for the swelling ) | increase | EC20 | 36 |
| SIGNALING | 267 | |||||||
| Target | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| NADH:ubiquinone reductase | 7.7 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Rotenone (2µM) was used as 100% baseline for complex I inhibition. | inhibit | EC20 | 36 |
| Succinate dehydrogenase | ND | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Oligomycin A (1µM) was used as 100% baseline for complex II inhibition. | Negative | EC20 | 36 |
| ATP synthase | 27.7 μM | rat | brain SMP, ATP synthesis | inhibitor | 140 | |||
| ATP synthase | 14 μM | rat | liver MF1-ATPase | inhibitor | 141 | |||
| ATP synthase | 19 μM | rat | brain M F0F1-ATPase | inhibitor | 140 | |||
| ATP synthase | 6.4 μM | bovine | bovine heart MF1-ATPase | inhibitor | 142 | |||
| ATP synthase | 2 μM | human | human umbilical vein endothelial cell, nonmitochondrial ATP synthase, ATP synthesis | inhibitor | 136 | |||
| F1 subunits | inhibitor | 170 | ||||||
| Cytochrome c | > 200 µM | 30 mins | mouse | liver mitochondria | Cytochrome c release was evaluated using ELISA kit ( 20 µg/ml Alamethicin was used as 100% baseline) | release | EC20 | 36 |
| NAD-dependent protein deacetylase sirtuin-1 | 267 | |||||||
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
 |
Warning |
Aggregated GHS information provided by 277 companies from 9 notifications to the ECHA C&L Inventory. Reported as not meeting GHS hazard criteria by 1 of 277 companies. For more detailed information, please visit ECHA C&L website Of the 8 notification(s) provided by 276 of 277 companies with hazard statement code(s): H319 (94.93%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P264, P280, P305+P351+P338, and P337+P313; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| (E)-1-(3,5-dihydroxyphenyl)-2-(4-hydroxyphenyl)ethene | (E)-5-(2-(4-hydroxyphenyl)ethenyl)-1,3-benzenediol(E)-5-(2-(4-hydroxyphenyl)ethenyl)-1,3-benzenediol | (E)-5-(4-Hydroxystyryl)benzene-1,3-diol |
| (E)-5-(p-Hydroxystyryl)resorcinol | (E)-5-[2-(4-hydroxyphenyl)ethenyl]-1,3-benzendiol | (E)-resveratrol |
| (E)1-(3,5-dihydroxyphenyl)-2-(4-hydroxyphenyl)ethene | 01R360 | 1,3-Benzenediol, 5-(2-(4-hydroxyphenyl)ethenyl)-, (E)- |
| 1,3-Benzenediol, 5-[(1E)-2-(4-hydroxyphenyl)ethenyl]- | 1,3-Benzenediol, 5-[(E)-2-(4-hydroxyphenyl)ethenyl]- | 2l98 |
| 3,4',5-Stilbenetriol | 3,4',5-Trihydroxy-trans-stilbene | 3,4',5-Trihydroxy-trans-stilbene 5-[(1E)-2-(4-hydroxyphenyl)ethenyl]-1,3-benzenediol |
| 3,4',5-Trihydroxystilbene | 3,4',5-trihydroxy-stilbene | 3,5,4'-Trihydroxy-trans-stilbene |
| 3,5,4'-Trihydroxystilbene | 3fts | 4CN-0696 |
| 4jaz | 4qer | 5-((1E)-2-(4-Hydroxyphenyl)ethenyl)-1,3-benzenediol |
| 5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,3,benzenediol | 5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,3-benzenediol | 5-[(1E)-2-(4-hydroxyphenyl)vinyl]benzene-1,3-diol |
| 5-[(E)-2-(4-Hydroxyphenyl)ethenyl]benzol-1,3-diol | 5-[(E)-2-(4-Hydroxyphenyl)vinyl]-1,3-benzenediol | 5-[(E)-2-(4-Hydroxyphenyl)vinyl]-1,3-benzoldiol |
| 5-[(E)-2-(4-hydroxyphenyl)ethenyl]-1,3-benzenediol | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol | 5-[(E)-2-(4-hydroxyphenyl)vinyl]benzene-1,3-diol |
| 5-[(Z)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol | 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol | 5-[2-(4-hydroxyphenyl)vinyl]-1,3-benzenediol |
| 501-36-0 | 533C1DA0-4104-42B5-9D32-9265F40857E4 | 5[(E)-2-(4-Hydroxyphenyl)-vinyl]benzene 1,3-diol |
| A10785 | A827984 | AB00052942-29 |
| AB00052942_31 | AB0006623 | ABP000376 |
| AC-727 | ACN-034773 | ACT09778 |
| AK-39118 | AKOS005720936 | API0000480 |
| ARONIS24568 | AS-12413 | AX8004672 |
| BBC/741 | BBL028252 | BCP01416 |
| BCPP000091 | BDBM23926 | BIK9013 |
| BPBio1_000479 | BR-39118 | BRD-K25591257-001-01-2 |
| BRD-K80738081-001-06-2 | BRD-K80738081-001-07-0 | BRD-K80738081-001-09-6 |
| BRD-K80738081-001-10-4 | BRD-K80738081-001-23-7 | BS0159 |
| BSPBio_000435 | BSPBio_001114 | BSPBio_003461 |
| C03582 | C14H12O3 | CAS-501-36-0 |
| CC-34242 | CCG-38874 | CCRIS 8952 |
| CHEBI:27881 | CHEBI:45713 | CHEMBL165 |
| CPD000058206 | CR-003 | CS-1050 |
| CU-01000001503-3 | DB02709 | DSSTox_CID_11980 |
| DSSTox_GSID_31980 | DSSTox_RID_78898 | DTXSID4031980 |
| EU-0101111 | FT-0082623 | GP2549 |
| GP5884 | GTPL8741 | HMS1362H15 |
| HMS1569F17 | HMS1792H15 | HMS1921N04 |
| HMS1990H15 | HMS2052I09 | HMS2096F17 |
| HMS2232A18 | HMS3263O04 | HMS3403H15 |
| HMS3412O14 | HMS3649A20 | HMS3676O14 |
| HSDB 7571 | HY-16561 | IDI1_002152 |
| InChI=1/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1 | J10118 | KS-5047 |
| KSC-10-164 | KUC104385N | LMPK13090005 |
| LP01111 | LS-2146 | LUKBXSAWLPMMSZ-OWOJBTEDSA-N |
| Lopac0_001111 | MCULE-5678456463 | MFCD00133799 |
| MLS000069735 | MLS001055357 | MLS001076538 |
| MLS001424228 | MLS002207121 | MLS002222231 |
| N1848 | N88795 | NC00349 |
| NCGC00015894-02 | NCGC00017352-05 | NCGC00017352-06 |
| NCGC00017352-07 | NCGC00017352-08 | NCGC00017352-09 |
| NCGC00017352-10 | NCGC00017352-11 | NCGC00017352-12 |
| NCGC00017352-13 | NCGC00017352-14 | NCGC00017352-15 |
| NCGC00017352-16 | NCGC00017352-17 | NCGC00017352-18 |
| NCGC00017352-19 | NCGC00017352-24 | NCGC00024003-00 |
| NCGC00024003-04 | NCGC00024003-05 | NCGC00024003-06 |
| NCGC00024003-07 | NCGC00024003-08 | NCGC00024003-09 |
| NCGC00024003-10 | NCGC00024003-11 | NCGC00024003-12 |
| NCGC00024003-13 | NCGC00024003-14 | NCGC00257465-01 |
| NCGC00258925-01 | NCGC00261796-01 | NSC 327430 |
| NSC-327430 | NSC327430 | OR46018 |
| Opera_ID_586 | PREVENTION 8 (RESVERATROL) | Prestwick2_000508 |
| Prestwick3_000508 | Prestwick_619 | Q369O8926L |
| Q407329 | R 5010 | R0071 |
| REGID_for_CID_445154 | REGID_for_CID_6240 | RM-1812 |
| Resveratol | Resveratrol, 99% | Resveratrol, >=99% (HPLC) |
| Resveratrol, E- | Resveratrol, European Pharmacopoeia (EP) Reference Standard | Resveratrol, Vetec(TM) reagent grade, 98% |
| Resveratrol, analytical standard | Resveratrol, certified reference material, TraceCERT(R) | Resveratrol, natural |
| Resveratrol, synthetic | Resveratrol, trans- | Resveratrol,(S) |
| Resvida | SAM001246888 | SB17273 |
| SBB055452 | SC-11924 | SCHEMBL19425 |
| SDCCGMLS-0002998.P003 | SGCUT00007 | SMR000058206 |
| SPECTRUM1502223 | SR-01000000163 | SR-01000000163-10 |
| SR-01000000163-11 | SR-01000000163-16 | SR-01000000163-3 |
| SR-01000000163-4 | SR-01000000163-9 | SRT 501 |
| SRT-501 | SRT501 | ST057251 |
| ST2408097 | STL | STL146386 |
| SW196786-4 | Spectrum5_000552 | Stilbene, 2f |
| TaxusChinensisiRehd | Tox21_110257 | Tox21_110257_1 |
| Tox21_201374 | Tox21_303376 | Tox21_501111 |
| UNII-Q369O8926L | ZINC6787 | ZX-AS004941 |
| ZX-AT013797 | cid_445154 | resveratrol |
| s1396 | to_000079 | trans [2,5,4'-trihydroxydiphenyl] ethylene |
| trans-1,2-(3,4',5-Trihydroxydiphenyl)ethylene | trans-3,4′,5-Trihydroxystilbene | trans-3,4',5 - trihydroxystilbene |
| trans-3,4',5-trihydroxystilbene | trans-Resveratrol, United States Pharmacopeia (USP) Reference Standard | trans-resveratrol |