Drug
D0420 | Benzofuran
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| UNCOUPLING | 1 μmol/L | rat; Sprague–Dawley | hepatocytes | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| UNCOUPLING | 10 μmol/L | rat; Sprague–Dawley | hepatocytes | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| UNCOUPLING | 20 μmol/L | rat; Sprague–Dawley | hepatocytes | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| UNCOUPLING | 50 μmol/L | rat; Sprague–Dawley | hepatocytes | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| UNCOUPLING | 80 μmol/L | rat; Sprague–Dawley | hepatocytes | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| UNCOUPLING | 100 μmol/L | rat; Sprague–Dawley | hepatocytes | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| MEMBRANE POTENTIAL | 0.5 μmol/L | 1 hour | rat; Sprague–Dawley | hepatocytes | Measurement of mitochondrial membrane potential | Negative | p < 0.05 | 4 |
| MEMBRANE POTENTIAL | 1 μmol/L | 1 hour | rat; Sprague–Dawley | hepatocytes | Measurement of mitochondrial membrane potential | Negative | p < 0.05 | 4 |
| MEMBRANE POTENTIAL | 4 μmol/L | 1 hour | rat; Sprague–Dawley | hepatocytes | Measurement of mitochondrial membrane potential | Negative | p < 0.05 | 4 |
| MEMBRANE POTENTIAL | 8 μmol/L | 1 hour | rat; Sprague–Dawley | hepatocytes | Measurement of mitochondrial membrane potential | Negative | p < 0.05 | 4 |
| MEMBRANE POTENTIAL | 20 μmol/L | 1 hour | rat; Sprague–Dawley | hepatocytes | Measurement of mitochondrial membrane potential | Negative | p < 0.05 | 4 |
| STATE 3 RESPIRATION | 10 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| STATE 3 RESPIRATION | 20 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| STATE 3 RESPIRATION | 50 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| STATE 3 RESPIRATION | 100 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| STATE 3 RESPIRATION | 10 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| STATE 3 RESPIRATION | 20 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| STATE 3 RESPIRATION | 50 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| STATE 3 RESPIRATION | 100 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| RESPIRATORY CONTROL RATIO (RCR) | 10 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| RESPIRATORY CONTROL RATIO (RCR) | 20 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| RESPIRATORY CONTROL RATIO (RCR) | 50 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| RESPIRATORY CONTROL RATIO (RCR) | 100 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| RESPIRATORY CONTROL RATIO (RCR) | 10 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| RESPIRATORY CONTROL RATIO (RCR) | 20 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| RESPIRATORY CONTROL RATIO (RCR) | 50 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| RESPIRATORY CONTROL RATIO (RCR) | 100 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of oxygen uptake | Negative | p < 0.05 | 4 | |
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | 10 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of beta oxidation and ketone body formation | Negative | p < 0.05 | 4 | |
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | 20 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of beta oxidation and ketone body formation | Negative | p < 0.05 | 4 | |
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | 50 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of beta oxidation and ketone body formation | Negative | p < 0.05 | 4 | |
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | 80 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of beta oxidation and ketone body formation | Negative | p < 0.05 | 4 | |
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | 100 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of beta oxidation and ketone body formation | Negative | p < 0.05 | 4 | |
| SYNTHESIS OF KETONE BODY | 100 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurement of beta oxidation and ketone body formation | Negative | no inhibition | 4 | |
| SWELLING | 1 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurements of mitochondrial swelling | Negative | p < 0.05 | 4 | |
| SWELLING | 10 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurements of mitochondrial swelling | Negative | p < 0.05 | 4 | |
| SWELLING | 100 μmol/L | rat; Sprague–Dawley | liver mitochondria | Measurements of mitochondrial swelling | Negative | p < 0.05 | 4 | |
| OXIDATIVE STRESS | 0.1 μmol/L | 1 hour | human | HepG2 | Measurement of ROS | Negative | p < 0.05 | 4 |
| OXIDATIVE STRESS | 1 μmol/L | 1 hour | human | HepG2 | Measurement of ROS | Negative | p < 0.05 | 4 |
| OXIDATIVE STRESS | 100 μmol/L | 1 hour | human | HepG2 | Measurement of ROS | Negative | p < 0.05 | 4 |
| APOPTOSIS | 100 μmol/L | 8 hours | human | HepG2 | Assessment of cytochrome c release | Negative | observable | 4 |
| LATE APOPTOSIS | 100 μmol/L | 8 hours | rat; Sprague–Dawley | hepatocytes | Apoptosis measurement | Negative | p < 0.05 | 4 |
| LATE APOPTOSIS | 1 μmol/L | 8 hours | rat; Sprague–Dawley | hepatocytes | Apoptosis measurement | Negative | p < 0.05 | 4 |
| LATE APOPTOSIS | 100 μmol/L | 8 hours | rat; Sprague–Dawley | hepatocytes | Apoptosis measurement | Negative | p < 0.05 | 4 |
| Target | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| Cytochrome c | 100 μmol/L | 8 hours | human | HepG2 | Assessment of cytochrome c release | Negative | observable | 4 |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
  |
Warning |
Aggregated GHS information provided by 63 companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H226 (100%): Flammable liquid and vapor [Warning Flammable liquids] H351 (95.24%): Suspected of causing cancer [Warning Carcinogenicity] H412 (63.49%): Harmful to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P210, P233, P240, P241, P242, P243, P273, P280, P281, P303+P361+P353, P308+P313, P370+P378, P403+P235, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
|
|
Warning |
H226: Flammable liquid and vapor [Warning Flammable liquids] H351: Suspected of causing cancer [Warning Carcinogenicity] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] |
P201, P202, P210, P233, P240, P241, P242, P243, P260, P280, P281, P303+P361+P353, P308+P313, P314, P370+P378, P403+P235, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| 1-Benzofuran | 1-Benzofuran # | 1-Oxaindene |
| 1-Oxidene | 1-Oxindene | 10195-EP2269978A2 |
| 10195-EP2269985A2 | 10195-EP2269991A2 | 10195-EP2269992A1 |
| 10195-EP2270010A1 | 10195-EP2272832A1 | 10195-EP2272972A1 |
| 10195-EP2272973A1 | 10195-EP2275401A1 | 10195-EP2277858A1 |
| 10195-EP2277872A1 | 10195-EP2277874A1 | 10195-EP2280000A1 |
| 10195-EP2281563A1 | 10195-EP2281818A1 | 10195-EP2284150A2 |
| 10195-EP2284151A2 | 10195-EP2284152A2 | 10195-EP2284153A2 |
| 10195-EP2284155A2 | 10195-EP2284156A2 | 10195-EP2284157A1 |
| 10195-EP2284164A2 | 10195-EP2284174A1 | 10195-EP2287140A2 |
| 10195-EP2287148A2 | 10195-EP2287150A2 | 10195-EP2289871A1 |
| 10195-EP2292586A2 | 10195-EP2292590A2 | 10195-EP2292592A1 |
| 10195-EP2292593A2 | 10195-EP2292604A2 | 10195-EP2292611A1 |
| 10195-EP2292630A1 | 10195-EP2295419A2 | 10195-EP2295429A1 |
| 10195-EP2295432A1 | 10195-EP2295433A2 | 10195-EP2295503A1 |
| 10195-EP2298732A1 | 10195-EP2298766A1 | 10195-EP2298767A1 |
| 10195-EP2298770A1 | 10195-EP2301536A1 | 10195-EP2301538A1 |
| 10195-EP2301912A2 | 10195-EP2301913A1 | 10195-EP2301914A1 |
| 10195-EP2301916A2 | 10195-EP2301923A1 | 10195-EP2305219A1 |
| 10195-EP2305637A2 | 10195-EP2305648A1 | 10195-EP2305651A1 |
| 10195-EP2305695A2 | 10195-EP2305696A2 | 10195-EP2305697A2 |
| 10195-EP2305698A2 | 10195-EP2308510A1 | 10195-EP2308562A2 |
| 10195-EP2308832A1 | 10195-EP2308840A1 | 10195-EP2308849A1 |
| 10195-EP2308850A1 | 10195-EP2308854A1 | 10195-EP2308863A1 |
| 10195-EP2311455A1 | 10195-EP2311796A1 | 10195-EP2311797A1 |
| 10195-EP2311798A1 | 10195-EP2311799A1 | 10195-EP2311825A1 |
| 10195-EP2311842A2 | 10195-EP2314558A1 | 10195-EP2314575A1 |
| 10195-EP2314587A1 | 10195-EP2316452A1 | 10195-EP2316459A1 |
| 10195-EP2371811A2 | 10195-EP2371812A1 | 10195-EP2371831A1 |
| 103410-EP2270101A1 | 103410-EP2301924A1 | 2,3-Benzofuran |
| 2,3-Benzofuran, 99% | 2,3-Benzofuran, 99.5% | 2,3-Benzofuran, analytical standard |
| 271-89-6 | 29075-EP2270505A1 | 29075-EP2281815A1 |
| 29075-EP2305640A2 | 29075-EP2311842A2 | 5-17-02-00003 (Beilstein Handbook Reference) |
| 80096-EP2272517A1 | 80096-EP2305250A1 | A818947 |
| ACMC-1CR9M | AI3-17613 | AKOS000121520 |
| AM84862 | ANW-26149 | B0060 |
| BDBM50167940 | BENZOFURAN | BR-46635 |
| BRN 0107704 | BZF | Benzo(b)furan |
| Benzo[b]furan | Benzofuran (IUPAC) | Benzofurfuran |
| C14512 | CAS-271-89-6 | CCRIS 2384 |
| CHEBI:35260 | CHEMBL363614 | CTK1A2129 |
| Coumaron | Coumarone | Cumaron |
| Cumarone | DB-047175 | DB04179 |
| DSSTox_CID_141 | DSSTox_GSID_20141 | DSSTox_RID_75394 |
| DTXSID6020141 | EINECS 205-982-6 | FT-0609496 |
| FT-0660665 | HMS2268K20 | HSDB 4173 |
| IANQTJSKSUMEQM-UHFFFAOYSA-N | InChI=1/C8H6O/c1-2-4-8-7(3-1)5-6-9-8/h1-6 | J-640079 |
| J-800081 | KS-00000W6C | LK6946W774 |
| LS-25 | M-6414 | MCULE-3934334695 |
| MFCD00005847 | MLS002454357 | NCGC00091088-01 |
| NCGC00091088-02 | NCGC00091088-03 | NCGC00091088-04 |
| NCGC00091088-05 | NCGC00091088-06 | NCI-C56166 |
| NSC 1255 | NSC-1255 | NSC1255 |
| PS-5764 | PubChem7003 | Q410089 |
| RTR-012243 | SBB060607 | SC-03045 |
| SCHEMBL5564 | SMR000112279 | ST2412637 |
| ST51046756 | Tox21_400054 | UNII-LK6946W774 |
| W-107126 | WLN: T56 BOJ | ZINC1591814 |
| benzfuran | benzo[b]furane | bezofuran |
| DrugBank Name | Benzofuran |
| DrugBank | DB04179 |
| CAS Number | 271-89-6, 496-16-2, 870599-57-8 |
| PubChem Compound | 9223 |
| KEGG Compound ID | C14512 |
| PubChem.Substance | 46505707 |
| ChEBI | 35260 |
| ChemSpider | 8868 |
| BindingDB | 50167940.0 |
| Wikipedia | Benzofuran |