N
N02BE71 Paracetamol, combinations with psycholeptics
[N02BE] Anilides
[N02B] OTHER ANALGESICS AND ANTIPYRETICS
[N02] ANALGESICS
[N] Nervous system
N02BE51 Paracetamol, combinations excl. psycholeptics
[N02BE] Anilides
[N02B] OTHER ANALGESICS AND ANTIPYRETICS
[N02] ANALGESICS
[N] Nervous system
N02BE01 Paracetamol
[N02BE] Anilides
[N02B] OTHER ANALGESICS AND ANTIPYRETICS
[N02] ANALGESICS
[N] Nervous system
N02AJ17 Oxycodone and paracetamol
[N02AJ] Opioids in combination with non-opioid analgesics
[N02A] OPIOIDS
[N02] ANALGESICS
[N] Nervous system
N02AJ13 Tramadol and paracetamol
[N02AJ] Opioids in combination with non-opioid analgesics
[N02A] OPIOIDS
[N02] ANALGESICS
[N] Nervous system
N02AJ06 Codeine and paracetamol
[N02AJ] Opioids in combination with non-opioid analgesics
[N02A] OPIOIDS
[N02] ANALGESICS
[N] Nervous system
N02AJ01 Dihydrocodeine and paracetamol
[N02AJ] Opioids in combination with non-opioid analgesics
[N02A] OPIOIDS
[N02] ANALGESICS
[N] Nervous system
| Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| MEMBRANE POTENTIAL | > 200 µM | 30 mins | mouse | liver mitochondria | Rh123 fluorescence (excitation 485 nm, emission 535 nm) are recorded using a fluorescence multi-well plate reader (mCICCP (20 µM) treatments was considered as the 100% baseline for ΔΨm loss) | decrease | EC20 | 36 |
| RESPIRATION | 348.5 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Rotenone (2µM) was used as 100% baseline for complex I inhibition. | decrease | EC20 | 36 |
| RESPIRATION | > 400 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Oligomycin A (1µM) was used as 100% baseline for complex II inhibition. | decrease | EC20 | 36 |
| ELECTRON TRANSPORT CHAIN | decrease | 35 | ||||||
| ELECTRON TRANSPORT CHAIN | decrease | 35 | ||||||
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | affect | 227 | ||||||
| MITOCHONDRIAL FATTY ACID BETA OXIDATION | >400μM | >400 | mice | Lean mice vs Ob/ob mice | Measurement of oxygen consumption in the presence of ADP (state 3) and the different substrates was carried out on the Mitologics screening platform | EC20 | 227 | |
| GSSH/GHS RATIO | 300 mg/kg | 1 hour | rat; Fischer (F344) | in vivo | GSH level measurement | Negative | p < 0.05 | 1 |
| GSSH/GHS RATIO | 1 g/kg | 1 hour | mice; C57Bl/6 | in vivo | GSH level measurement | Negative | p < 0.05 | 1 |
| GSSH/GHS RATIO | 300 mg/kg | 3 hours | rat; Fischer (F344) | in vivo | GSH level measurement | Negative | p < 0.05 | 1 |
| GSSH/GHS RATIO | 1 g/kg | 3 hours | mice; C57Bl/6 | in vivo | GSH level measurement | Negative | p < 0.05 | 1 |
| GSSH/GHS RATIO | 300 mg/kg | 6 hours | rat; Fischer (F344) | in vivo | GSH level measurement | Negative | p < 0.05 | 1 |
| GSSH/GHS RATIO | 1 g/kg | 6 hours | mice; C57Bl/6 | in vivo | GSH level measurement | increase | p < 0.05 | 1 |
| GSSH/GHS RATIO | 300 mg/kg | 12 hours | rat; Fischer (F344) | in vivo | GSH level measurement | Negative | p < 0.05 | 1 |
| GSSH/GHS RATIO | 1 g/kg | 12 hours | mice; C57Bl/6 | in vivo | GSH level measurement | increase | p < 0.05 | 1 |
| GSSH/GHS RATIO | 300 mg/kg | 24 hours | rat; Fischer (F344) | in vivo | GSH level measurement | Negative | p < 0.05 | 1 |
| GSSH/GHS RATIO | 1 g/kg | 24 hours | mice; C57Bl/6 | in vivo | GSH level measurement | increase | p < 0.05 | 1 |
| SWELLING | > 200 µM | 30 mins | mouse | liver mitochondria | swelling assay: Absorbance at 545 nm using a fluorescence multi-well plate reader (CaCl2 (50 µM) was considered as the 100% baseline for the swelling ) | increase | EC20 | 36 |
| OXIDATIVE STRESS | increase | 35 | ||||||
| OXIDATIVE STRESS | 243 | |||||||
| OXIDATIVE STRESS | 258 | |||||||
| LIVER-SPECIFIC OXIDATIVE STRESS | 300 mg/kg | 1 hour | mice; C57Bl/6 | in vivo | ALT activity measurement | Negative | p < 0.05 | 1 |
| LIVER-SPECIFIC OXIDATIVE STRESS | 1 g/kg | 1 hour | rat; Fischer (F344) | in vivo | ALT activity measurement | Negative | p < 0.05 | 1 |
| LIVER-SPECIFIC OXIDATIVE STRESS | 300 mg/kg | 3 hours | mice; C57Bl/6 | in vivo | ALT activity measurement | increase | p < 0.05 | 1 |
| LIVER-SPECIFIC OXIDATIVE STRESS | 1 g/kg | 3 hours | rat; Fischer (F344) | in vivo | ALT activity measurement | Negative | p < 0.05 | 1 |
| LIVER-SPECIFIC OXIDATIVE STRESS | 300 mg/kg | 6 hours | mice; C57Bl/6 | in vivo | ALT activity measurement | increase | p < 0.05 | 1 |
| LIVER-SPECIFIC OXIDATIVE STRESS | 1 g/kg | 6 hours | rat; Fischer (F344) | in vivo | ALT activity measurement | Negative | p < 0.05 | 1 |
| LIVER-SPECIFIC OXIDATIVE STRESS | 300 mg/kg | 24 hours | mice; C57Bl/6 | in vivo | ALT activity measurement | increase | p < 0.05 | 1 |
| LIVER-SPECIFIC OXIDATIVE STRESS | 1 g/kg | 24 hours | rat; Fischer (F344) | in vivo | ALT activity measurement | Negative | p < 0.05 | 1 |
| LIVER-SPECIFIC OXIDATIVE STRESS | 1 g/kg | 24 hours | rat; Fischer (F344) | in vivo | ALT activity measurement | Negative | p < 0.05 | 1 |
| LIVER-SPECIFIC OXIDATIVE STRESS | 1.5 g/kg | 24 hours | rat; Fischer (F344) | in vivo | ALT activity measurement | increase | p < 0.05 | 1 |
| LIVER-SPECIFIC OXIDATIVE STRESS | 1 g/kg | 24 hours | rat; Sprague–Dawley | in vivo | ALT activity measurement | Negative | p < 0.05 | 1 |
| LIVER-SPECIFIC OXIDATIVE STRESS | 2 g/kg | 24 hours | rat; Sprague–Dawley | in vivo | ALT activity measurement | Negative | p < 0.05 | 1 |
| Target | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
|---|---|---|---|---|---|---|---|---|
| NADH:ubiquinone reductase | inhibitor | 35 | ||||||
| NADH:ubiquinone reductase | 348.5 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Rotenone (2µM) was used as 100% baseline for complex I inhibition. | inhibit | EC20 | 36 |
| Succinate dehydrogenase | inhibitor | 35 | ||||||
| Succinate dehydrogenase | > 400 µM | 60 mins | mouse | liver mitochondria | Oxygen consumption was monitored with 50nM MitoXpress ( an oxygen-sensitive phosphorescent dye) using a spectrofluorimeter (Tecan Infinite 200; λExcitation 380nm; λEmission 650nm). Oligomycin A (1µM) was used as 100% baseline for complex II inhibition. | inhibit | EC20 | 36 |
| Cytochrome c | > 400 µM | 30 mins | mouse | liver mitochondria | Cytochrome c release was evaluated using ELISA kit ( 20 µg/ml Alamethicin was used as 100% baseline) | release | EC20 | 36 |
| Pictogram | Signal | Statements | Precautionary Statement Codes |
|---|---|---|---|
![]() |
Warning |
Aggregated GHS information provided by 320 companies from 46 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. Reported as not meeting GHS hazard criteria by 5 of 320 companies. For more detailed information, please visit ECHA C&L website Of the 44 notification(s) provided by 315 of 320 companies with hazard statement code(s): H302 (99.05%): Harmful if swallowed [Warning Acute toxicity, oral] H315 (40.32%): Causes skin irritation [Warning Skin corrosion/irritation] H317 (19.37%): May cause an allergic skin reaction [Warning Sensitization, Skin] H319 (40%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H412 (50.48%): Harmful to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P261, P264, P270, P272, P273, P280, P301+P312, P302+P352, P305+P351+P338, P321, P330, P332+P313, P333+P313, P337+P313, P362, P363, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
![]() |
Warning |
H302: Harmful if swallowed [Warning Acute toxicity, oral] H315: Causes skin irritation [Warning Skin corrosion/irritation] H319: Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335: May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H401: Toxic to aquatic life [Hazardous to the aquatic environment, acute hazard] |
P261, P264, P270, P271, P273, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
![]() |
Danger |
H341: Suspected of causing genetic defects [Warning Germ cell mutagenicity] H370: Causes damage to organs [Danger Specific target organ toxicity, single exposure] H371: May cause damage to organs [Warning Specific target organ toxicity, single exposure] H372: Causes damage to organs through prolonged or repeated exposure [Danger Specific target organ toxicity, repeated exposure] H373: Causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure] |
P201, P202, P260, P264, P270, P281, P307+P311, P308+P313, P309+P311, P314, P321, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
| Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
|---|---|---|---|---|---|
| child | TDLo | oral | 801mg/kg (801mg/kg) | Pediatrics. Vol. 61, Pg. 68, 1978. | |
| mouse | LD50 | subcutaneous | 310mg/kg (310mg/kg) | Human Toxicology. Vol. 3, Pg. 13S, 1984. | |
| rat | LC50 | inhalation | 100mg/m3/4H (100mg/m3) | National Technical Information Service. Vol. OTS0538278, | |
| mammal (species unspecified) | LD50 | oral | > 5gm/kg (5000mg/kg) | National Technical Information Service. Vol. OTS0538278, | |
| child | LDLo | oral | 140mg/kg/7D-I (140mg/kg) | Medical Journal of Australia. Vol. 171, Pg. 472, 1999. | |
| mammal (species unspecified) | LDLo | oral | 512mg/kg (512mg/kg) | United States Patent Document. Vol. #4035499, | |
| mouse | LD50 | oral | 338mg/kg (338mg/kg) | Toxicology and Applied Pharmacology. Vol. 19, Pg. 20, 1971. | |
| human | LDLo | oral | 143mg/kg (143mg/kg) | behavioral: general anesthetic | British Medical Journal. Vol. 282, Pg. 199, 1981. |
| man | LDLo | oral | 143mg/kg/24H- (143mg/kg) | American Journal of Medicine. Vol. 74, Pg. 349, 1983. | |
| mouse | LD50 | intraperitoneal | 367mg/kg (367mg/kg) | behavioral: analgesia | Arzneimittel-Forschung. Drug Research. Vol. 15, Pg. 520, 1965. |
| child | LDLo | oral | 50mg/kg (50mg/kg) | American Journal of Emergency Medicine. Vol. 6, Pg. 510, 1988. | |
| child | TDLo | oral | 591mg/kg/2D-I (591mg/kg) | Clinical Pediatrics Vol. 33, Pg. 42, 1994. | |
| man | TDLo | oral | 714mg/kg (714mg/kg) | cardiac: ekg changes not diagnostic of above | Postgraduate Medical Journal. Vol. 69, Pg. 52, 1993. |
| rat | LD50 | intraperitoneal | 1205mg/kg (1205mg/kg) | Studi Sassaresi, Sezione 2. Vol. 57, Pg. 561, 1979. | |
| man | TDLo | oral | 9286ug/kg (9.286mg/kg) | Allergy. Vol. 50(Suppl, | |
| women | LDLo | oral | 400mg/kg (400mg/kg) | Journal of Toxicology, Clinical Toxicology. Vol. 35, Pg. 325, 1997. | |
| child | LDLo | oral | 360mg/kg/2D (360mg/kg) | Journal of Pediatrics. Vol. 92, Pg. 832, 1978. | |
| women | TDLo | oral | 325mg/kg (325mg/kg) | Postgraduate Medical Journal. Vol. 68, Pg. 116, 1992. | |
| women | TDLo | oral | 13mg/kg (13mg/kg) | behavioral: excitement | Allergy. Vol. 50(Suppl, |
| dog | LDLo | intravenous | 826mg/kg (826mg/kg) | behavioral: analgesia | Archives Internationales de Pharmacodynamie et de Therapie. Vol. 149, Pg. 571, 1964. |
| pig | LDLo | intravenous | 1gm/kg (1000mg/kg) | Veterinary and Human Toxicology. Vol. 30, Pg. 324, 1988. | |
| women | TDLo | oral | 4962ug/kg (4.962mg/kg) | Journal of Toxicology, Clinical Toxicology. Vol. 29, Pg. 223, 1991. | |
| guinea pig | LD50 | oral | 2620mg/kg (2620mg/kg) | Journal of the American Pharmaceutical Association, Scientific Edition. Vol. 47, Pg. 479, 1958. | |
| man | LDLo | oral | 714mg/kg (714mg/kg) | liver: other changes | Human Toxicology. Vol. 1, Pg. 25, 1981. |
| women | LDLo | oral | 260mg/kg (260mg/kg) | JAMA, Journal of the American Medical Association. Vol. 236, Pg. 1874, 1976. | |
| rat | LD50 | oral | 1944mg/kg (1944mg/kg) | United States Patent Document. Vol. #4636513, | |
| frog | LDLo | subcutaneous | 50mg/kg (50mg/kg) | Archiv fuer Experimentelle Pathologie und Pharmakologie. Vol. 33, Pg. 216, 1894. | |
| dog | LDLo | oral | 2gm/kg (2000mg/kg) | Iyakuhin Kenkyu. Study of Medical Supplies. Vol. 24, Pg. 602, 1993. | |
| infant | TDLo | oral | 1440mg/kg/6D (1440mg/kg) | American Journal of Diseases of Children. Vol. 137, Pg. 386, 1983. | |
| mammal (species unspecified) | LD50 | unreported | 891mg/kg (891mg/kg) | Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 48(6), Pg. 22, 1983. | |
| women | LDLo | oral | 650mg/kg (650mg/kg) | American Journal of Emergency Medicine. Vol. 6, Pg. 511, 1988. | |
| mammal (species unspecified) | LD50 | skin | > 2gm/kg (2000mg/kg) | National Technical Information Service. Vol. OTS0538278, | |
| women | TDLo | oral | 490mg/kg (490mg/kg) | Southern Medical Journal. Vol. 71, Pg. 906, 1978. | |
| human | LDLo | oral | 357mg/kg (357mg/kg) | Lancet. Vol. 1, Pg. 66, 1973. | |
| 103-90-2 | 222 AF | 362O9ITL9D |
| 4 inverted exclamation marka-Hydroxyacetanilide | 4'-Hydroxyacetanilide | 4-(Acetylamino)phenol |
| 4-(N-Acetylamino)phenol | 4-13-00-01091 (Beilstein Handbook Reference) | 4-Acetamidophenol |
| 4-Acetamidophenol | 4-Acetamidophenol, 98% | 4-Acetamino phenol |
| 4-Acetaminophenol | 4-Hydroxyacetanilide | 4-Hydroxyanilid kyseliny octove |
| 4-Hydroxyanilid kyseliny octove [Czech] | 4-acetamido phenol | 4-acetamido-phenol |
| 4-acetominophenol | 4-acetylaminophenol | 6473-EP1441224A2 |
| 6473-EP2270008A1 | 6473-EP2272832A1 | 6473-EP2275420A1 |
| 6473-EP2277565A2 | 6473-EP2277566A2 | 6473-EP2277567A1 |
| 6473-EP2277568A2 | 6473-EP2277569A2 | 6473-EP2277570A2 |
| 6473-EP2277861A1 | 6473-EP2277865A1 | 6473-EP2277875A2 |
| 6473-EP2280008A2 | 6473-EP2281559A1 | 6473-EP2281819A1 |
| 6473-EP2281823A2 | 6473-EP2292280A1 | 6473-EP2292617A1 |
| 6473-EP2292619A1 | 6473-EP2298764A1 | 6473-EP2298765A1 |
| 6473-EP2305219A1 | 6473-EP2305654A1 | 6473-EP2305659A1 |
| 6473-EP2308510A1 | 6473-EP2308872A1 | 6473-EP2311818A1 |
| 6473-EP2314585A1 | 6473-EP2314590A1 | 6473-EP2316829A1 |
| 6473-EP2371811A2 | 72238-EP2305640A2 | 72238-EP2308867A2 |
| 72238-EP2308870A2 | 91399-EP2277876A1 | 91399-EP2284149A1 |
| 91399-EP2292614A1 | 91399-EP2305636A1 | A-Per |
| A.F. Anacin | AB00051905 | AB00051905-09 |
| AB00051905_10 | AB1009347 | AC-23969 |
| ACMC-20989w | ACT06727 | AKOS000121004 |
| ANEXSIA 10/660 | ANW-14994 | APAP |
| APAP | APAP, Paracetamol | Abenol |
| Abensanil | Abrol | Abrolet |
| Acamol | Accu-Tap | Acenol |
| Acenol (pharmaceutical) | Acertol | Aceta Elixir |
| Aceta Tablets | Acetaco | Acetagesic |
| Acetalgin | Acetamide, N-(4-hydroxyphenyl)- | Acetamide, N-(p-hydroxyphenyl)- |
| Acetaminofen | Acetaminophen (4-hydroxyacetanilide) | Acetaminophen (JP17/USP) |
| Acetaminophen 650 | Acetaminophen Uniserts | Acetaminophen [USP:JAN] |
| Acetaminophen [USP] | Acetaminophen solution, 1.0 mg/mL in methanol, ampule of 1 mL, certified reference material | Acetaminophen solution, drug standard, 1.0 mg/mL in methanol |
| Acetaminophen, BioXtra, >=99.0% | Acetaminophen, Pharmaceutical Secondary Standard | Acetaminophen, United States Pharmacopeia (USP) Reference Standard |
| Acetaminophen, analytical standard | Acetaminophen, meets USP testing specifications, 98.0-102.0%, powder | Acetamol |
| Acetanilide, 4'-hydroxy- | Acetavance | Acetofen |
| Acetominophen | Actamin | Actamin Extra |
| Actamin Super | Actifed Plus | Actifed Plus (Salt/Mix) |
| Actimol Chewable Tablets | Actimol Children's Suspension | Actimol Infants' Suspension |
| Actimol Junior Strength Caplets | Afebrin | Afebryl |
| Aferadol | Algesidal | Algina |
| Algomol | Algotropyl | Alpiny |
| Alpinyl | Alvedon | Amadil |
| Aminofen | Aminofen Max | Anacin-3 |
| Anacin-3 Extra Strength | Anadin dla dzieci | Anaflon |
| Analter | Anapap | Andox |
| Anelix | Anexsia | Anexsia (Salt/Mix) |
| Anhiba | Anti-Algos | Antidol |
| Anuphen | Apacet | Apacet Capsules |
| Apacet Elixir | Apacet Extra Strength Caplets | Apacet Extra Strength Tablets |
| Apacet Regular Strength Tablets | Apadon | Apamid |
| Apamide | Apitrelal | Apo-Acetaminophen |
| Arfen | Arthralgen | Asetam |
| Asomal | Aspac | Aspirin Free Anacin Maximum Strength Caplets |
| Aspirin Free Anacin Maximum Strength Gel Caplets | Aspirin Free Anacin Maximum Strength Tablets | Aspirin-Free Anacin |
| Aspirin-Free Anacin (Salt/Mix) | Aspirin-Free Excedrin Caplets | Asplin |
| Atasol | Atasol Caplets | Atasol Drops |
| Atasol Forte Caplets | Atasol Forte Tablets | Atasol Oral Solution |
| Atasol Tablets | Atralidon | BBL005229 |
| BCP0726000305 | BCP23431 | BCP9000225 |
| BCPP000441 | BDBM26197 | BIDD:GT0005 |
| BPBio1_001007 | BRD-K41524689-001-08-6 | BSPBio_000915 |
| BSPBio_001786 | Babikan | Bacetamol |
| Banesin | Bayer Select Allergy-Sinus | Bayer Select Allergy-Sinus (Salt/Mix) |
| Bayer Select Head Cold | Bayer Select Head Cold (Salt/Mix) | Bayer Select Headache Pain |
| Bayer Select Maximum Strength Headache Pain Relief Formula | Bayer Select Menstrual Multi-Symptom | Bayer Select Menstrual Multi-Symptom (Salt/Mix) |
| Bayer Select Sinus Pain Relief | Bayer Select Sinus Pain Relief (Salt/Mix) | Ben-u-ron |
| Benmyo | Bickie-mol | Biocetamol |
| C06804 | CAS-103-90-2 | CCG-38901 |
| CCRIS 3 | CHEBI:46195 | CHEMBL112 |
| CS-2819 | CTK3J2516 | Cadafen |
| Calapol | Calmanticold | Calonal |
| Calpol | Calpol infant | Capital |
| Capital with Codeine | Captin | Causalon |
| Cefalex | Certified Reference Material | Cetadol |
| Children's Acetaminophen Elixir Drops | Children's Acetaminophen Elixir Solution | Children's Acetaminophen Oral Solution |
| Children's Tylenol Chewable | Citramon P | Claradol Codeine |
| Claratal | Clixodyne | Cod-Acamol Forte |
| Codabrol | Codalgin | Codapane |
| Codicet | Codisal | Codisal Forte |
| Codoliprane | Codral Pain Relief | Cofamol |
| Conacetol | Contac Cough & Sore Throat Formula | Contac Cough & Sore Throat Formula (Salt/Mix) |
| Contra-Schmerz P | Coricidin (Salt/Mix) | Coricidin D |
| Coricidin D (Salt/Mix) | Coricidin Sinus | Coricidin Sinus (Salt/Mix) |
| Cosutone | Croix Blanche | Cuponol |
| Curadon | Curpol | Custodial |
| D oliprane | D00217 | DB00316 |
| DDS-06A | DSSTox_CID_6 | DSSTox_GSID_20006 |
| DSSTox_RID_75318 | DTXSID2020006 | Dafalgan |
| Dafalgan Codeine | Daga | Dapa X-S |
| Daphalgan | Darocet | Darvocet |
| Darvocet-N (Salt/Mix) | Datril | Datril Extra-Strength |
| Daygrip | Demilets | Demilets (Salt/Mix) |
| Deminofen | Democyl | Demogripal |
| Desfebre | Dhamol | Dial-A-Gesic |
| Dial-alpha-gesic | Dimindol | Dirox |
| Disprol | DivK1c_000660 | Dol-Stop |
| Dolcor | Dolefin | Dolegrippin |
| Dolgesic | Doliprane | Dolko |
| Dolofugin | Doloreduct | Dolorfug |
| Dolorol Forte | Dolorstop | Dolotec |
| Dolprone | Dorocoff | Dresan |
| Dristan Cold No Drowsiness | Dristancito | Drixoral Cold & Flu |
| Drixoral Cold & Flu (Salt/Mix) | Drixoral Sinus | Drixoral Sinus (Salt/Mix) |
| Duaneo | Dularin | Duorol |
| Duracetamol | Durapan | Dymadon |
| Dymadon Co | Dymadon Forte | Dypap |
| EBD5728 | EC 203-157-5 | EINECS 203-157-5 |
| Ecosetol | Elixodyne | Empracet |
| Empracet (Salt/Mix) | Endecon | Endecon (Salt/Mix) |
| Enelfa | Eneril | Epitope ID:117710 |
| Eu-Med | Excedrin Caplets | Excedrin Extra Strength Caplets |
| Excipain | Exdol | Exdol Strong |
| F3096-1731 | F48B493F-B1FD-410C-AA0A-F40EC71A0689 | FT-0658035 |
| Fanalgic | Farmadol | Febranine |
| Febrectal | Febrectol | Febrex |
| Febricet | Febridol | Febrilix |
| Febrin | Febrinol | Febro-Gesic |
| Febrolin | Fendon | Fensum |
| Fepanil | Fever All | Feverall Junior Strength |
| Feverall Sprinkle Caps Junior Strength | Fevor | Finimal |
| Finiweh | Flexsure | Fluparmol |
| Fortalidon P | Freka-cetamol | GTPL5239 |
| Gattaphen T | Gelocatil | Geluprane |
| Genapap Children's Elixir | Genapap Children's Tablets | Genapap Extra Strength Caplets |
| Genapap Extra Strength Tablets | Genapap Regular Strength Tablets | Genebs Extra Strength Caplets |
| Genebs Regular Strength Tablets | Genebs X-Tra | Geralgine-P |
| Gripin Bebe | Grippostad | Gynospasmine |
| H865 | HMS1570N17 | HMS1920A03 |
| HMS2091G03 | HMS2097N17 | HMS2269G20 |
| HMS3268A10 | HMS3412D16 | HMS3676D16 |
| HMS3714N17 | HMS502A22 | HSDB 3001 |
| HY-66005 | Hedex | Helon N |
| Homoolan | Hy-Phen | Hy-Phen (Salt/Mix) |
| IDI1_000660 | INFANTS' FEVERALL | IV-APAP |
| Ildamol | InChI=1/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10 | Inalgex |
| Infadrops | Influbene N | Injectapap |
| Intensin | Intensin (Salt/Mix) | J-001064 |
| J-514275 | Janupap | Jin Gang |
| Junior Disprol | KBio1_000660 | KBio2_000356 |
| KBio2_002924 | KBio2_005492 | KBio3_001286 |
| KBioGR_000560 | KBioSS_000356 | KS-000002NN |
| KSC492K1N | Kataprin | Kinder Finimal |
| Korum | Kratofin simplex | L024125 |
| LS-32 | Labamol | Lekadol |
| Lemgrip | Lemsip | Lestemp |
| Liqiprine | Liquagesic | Liquigesic Co |
| Liquiprin (Salt/Mix) | Liquiprin Children's Elixir | Liquiprin Infants" Drops |
| Lonarid | Lonarid Mono | Lupocet |
| Lyteca | Lyteca Syrup | MCULE-3844920617 |
| MFCD00002328 | MLS001146925 | MLS001331684 |
| MLS002154041 | Magnidol | Malex N |
| Malgis | Malidens | Maxadol |
| Medinol Paediatric | Medocodene | Melabon Infantil |
| Mexalen | Midol PM Night Time Formula | Midol PM Night Time Formula (Salt/Mix) |
| Midol Regular Strength | Midol Regular Strength (Salt/Mix) | Midol Teen Formula |
| Midol Teen Formula (Salt/Mix) | Migraleve Yellow | Minafen |
| Minoset | Miralgin | Momentum |
| Mono Praecimed | Multin | N-(4-Hydroxyphenyl)acetamide |
| N-(4-Hydroxyphenyl)acetamide (Tylenol) | N-(4-Hydroxyphenyl)acetanilide | N-(4-hydroxyfenyl)ethanamid |
| N-(4-hydroxyphenyl)-acetamide | N-(4-hydroxyphenyl)ethanamide | N-Acetyl-4-aminophenol |
| N-Acetyl-4-aminophenol | N-Acetyl-p-aminophenol | N-acetyl para aminophenol |
| N-acetyl-4-hydroxyaniline; | N-acetyl-para-aminophenol | NCGC00016361-01 |
| NCGC00016361-02 | NCGC00016361-03 | NCGC00016361-04 |
| NCGC00016361-05 | NCGC00016361-06 | NCGC00016361-07 |
| NCGC00016361-08 | NCGC00016361-09 | NCGC00016361-10 |
| NCGC00016361-12 | NCGC00016361-13 | NCGC00025267-01 |
| NCGC00025267-02 | NCGC00025267-03 | NCGC00025267-04 |
| NCGC00025267-05 | NCGC00253912-01 | NCGC00259479-01 |
| NCI-C55801 | NEBS | NINDS_000660 |
| NSC 109028 | NSC 3991 | NSC-109028 |
| NSC-3991 | NSC-755853 | NSC109028 |
| NSC3991 | NSC755853 | Naldegesic |
| Naldegesic (Salt/Mix) | Napafen | Naprinol |
| Nealgyl | Neo-Fepramol | NeoCitran |
| Neodol | Neodolito | Neopap |
| Neotrend | Neuridon | New Cortal for Children |
| NilnOcen | Nina | No-Febril |
| Nobedon | Nodolex | Noral |
| Ofirmev | Oltyl | Oralgan |
| Oraphen-PD | Ornex Severe Cold Formula (Salt/Mix) | Ortensan |
| Oxycocet | PCM Paracetamol Lichtenstein | Paceco |
| Pacemo | Pacemol | Pacet |
| Pacimol | Paedialgon | Paedol |
| Painex | Paldesic | Pamol |
| Panacete | Panadeine | Panadeine Co |
| Panadiene | Panado-Co | Panado-Co Caplets |
| Panadol | Panadol Extra Strength | Panadol Junior Strength Caplets |
| Panadol Maximum Strength Caplets | Panadol Maximum Strength Tablets | Panale ve |
| Panaleve | Panamax | Panasorb |
| Panasorbe | Panets | Panex |
| Panodil | Panofen | Pantalgin |
| Para-Suppo | Para-Tabs | Paracemol |
| Paracenol | Paracet | Paracetamol |
| Paracetamol (Acetaminophen) 1.0 mg/ml in Methanol | Paracetamol (INN) | Paracetamol 100 microg/mL in Methanol |
| Paracetamol AL | Paracetamol Antipanin P | Paracetamol BC |
| Paracetamol Basics | Paracetamol DC | Paracetamol Dr. Schmidgall |
| Paracetamol Fecofar | Paracetamol Genericon | Paracetamol Hanseler |
| Paracetamol Harkley | Paracetamol Heumann | Paracetamol Hexal |
| Paracetamol Italfarmaco | Paracetamol Nycomed | Paracetamol PB |
| Paracetamol Raffo | Paracetamol Ratiopharm | Paracetamol Rosch |
| Paracetamol Saar | Paracetamol SmithKline Beecham | Paracetamol Stada |
| Paracetamol Winthrop | Paracetamol [INN:BAN] | Paracetamol for equipment qualification, EuropePharmacopoeia (EP) Reference Standard |
| Paracetamol von ct | Paracetamol, British Pharmacopoeia (BP) Reference Standard | Paracetamol, European Pharmacopoeia (EP) Reference Standard |
| Paracetamol;Tylenol | Paracetamole | Paracetamolo |
| Paracetamolo [Italian] | Paracetamolum | Paracetamolum [INN-Latin] |
| Paracetanol | Paracetol | Paracin |
| Paracod | Paracodol | Parador |
| Paradrops | Parakapton | Parake |
| Paralen | Paralief | Paralink |
| Paralyoc | Paramol | Paramolan |
| Paranox | Parapan | Parasedol |
| Parasin | Paraspen | Parcetol |
| Parelan | Parmol | Parogal |
| Paroma | Pasolind | Pasolind N |
| Pe-Tam | Pediapirin | Pediatrix |
| Pedric | Percocet-5 | Percocet-Demi |
| Percogesic with Codeine | Perdolan Mono | Perfalgan |
| Pharmakon1600-01500101 | Phenaphen Caplets | Phenaphen W/Codeine |
| Phendon | Phenipirin | Phenol, p-acetamido- |
| Phogoglandin | Pinex | Piramin |
| Pirinasol | Plicet | Polmofen |
| Predimol | Predualito | Prestwick0_000868 |
| Prestwick1_000868 | Prestwick2_000868 | Prestwick3_000868 |
| Prestwick_13 | Prodol | Prompt |
| Prontina | Propacet | Propacet (Salt/Mix) |
| Proxyphene/Acetamine | PubChem17726 | Puernol |
| Pulmofen | Pyregesic-C | Pyrigesic |
| Pyrinazine | Pyromed | Q57055 |
| Quiet World | Quiet World (Salt/Mix) | RTR-000905 |
| RZVAJINKPMORJF-UHFFFAOYSA-N | Redutemp | Reliv |
| Remedol | Resfenol | Resprin |
| Rhinex D-Lay Tablets | Rivalgyl | Robigesic |
| Robitussin Night Relief | Robitussin Night Relief (Salt/Mix) | Rockamol Plus |
| Rounox | Roxicet 5/500 | RubieMol |
| Rubophen | Rupemol | SBB043758 |
| SBI-0051269.P003 | SC-19146 | SCHEMBL19474893 |
| SCHEMBL3480 | SGCUT00014 | SK-Apap |
| SMR000112065 | SOM | SPBio_000010 |
| SPBio_002836 | SPECTRUM1500101 | SR-01000597517 |
| SR-01000597517-1 | SR-01000597517-2 | SR-01000597517-4 |
| ST24028862 | ST45179777 | STL140694 |
| STR00901 | Salzone | Sanicet |
| Sanicopyrine | Scanol | Scentalgyl |
| Scherzatabletten Rezeptur 534 | Schmerzex | Sedalito |
| Semolacin | Servigesic | Seskamol |
| Setakop | Setamol | Setol |
| Sifenol | Sinaspril | Sine-Aid, Maximum Strength (Salt/Mix) |
| Sine-Off Sinus Medicine Caplets | Sine-Off Sinus Medicine Caplets (Salt/Mix) | Sinedol |
| Sinmol | Sinubid (Salt/Mix) | Snaplets-FR |
| Spalt N | Spalt fur die nacht | Spectrum2_000085 |
| Spectrum3_000283 | Spectrum4_000140 | Spectrum5_000736 |
| Spectrum_000016 | St Joseph Aspirin-Free | St Joseph Aspirin-Free for Children |
| St. Joseph Cold Tablets for Children | St. Joseph Cold Tablets for Children (Salt/Mix) | St. Joseph Fever Reducer |
| Stanback | Stopain | Sudafed Severe Cold Formula |
| Sudafed Severe Cold Formula (Salt/Mix) | Sudafed Sinus | Sudafed Sinus (Salt/Mix) |
| Sunetheton | Supac (Salt/Mix) | Supadol mono |
| Supofen | Suppap | Suppap-120 |
| Suppap-325 | Suppap-650 | Supramol-M |
| TR-000905 | TRA0127672 | TYL |
| Tabalgin | Tachiprina | Talacen (Salt/Mix) |
| Tapanol Extra Strength Caplets | Tapanol Extra Strength Tablets | Tapar |
| Tavist Allergy/Sinus/Headache | Tazamol | Temlo |
| Tempanal | Tempra | Tempra Caplets |
| Tempra Chewable Tablets | Tempra D.S | Tempra Drops |
| Tempra Syrup | Termacet | Termalgin |
| Termalgine | Termofren | TheraFlu (Salt/Mix) |
| Theraflu | Tiffy | Titralgan |
| Tocris-1706 | Tox21_110397 | Tox21_110397_1 |
| Tox21_201930 | Tox21_300100 | Toximer P |
| Tralgon | Treupel N | Treupel mon |
| Treuphadol | Triaminic Sore Throat Formula | Triaminic Sore Throat Formula (Salt/Mix) |
| Tricoton | Tussapap | Ty lenol |
| Tylenol | Tylenol (TN) | Tylenol (caplet) |
| Tylenol (geltab) | Tylenol 8-Hour | Tylenol Allergy Sinus |
| Tylenol Allergy Sinus (Salt/Mix) | Tylenol Arthritis Extended Relief | Tylenol Caplets |
| Tylenol Children's Chewable Tablets | Tylenol Children's Elixir | Tylenol Children's Suspension Liquid |
| Tylenol Drops | Tylenol Elixir | Tylenol Extra Strength Adult Liquid Pain Reliever |
| Tylenol Extra Strength Caplets | Tylenol Extra Strength Gelcaps | Tylenol Extra Strength Tablets |
| Tylenol Gelcaps | Tylenol Infants Drops | Tylenol Infants" Suspension Drops |
| Tylenol Junior Strength Caplets | Tylenol Junior Strength Chewable Tablets | Tylenol Regular Strength Caplets |
| Tylenol Regular Strength Tablets | Tylenol Tablets | Tylex |
| Tylex CD | Tylol | Tylox (Salt/Mix) |
| Tymol | UNII-362O9ITL9D | Upsanol |
| Utragin | Valadol | Valgesic |
| Valorin | Valorin Extra | Veralgina |
| Vermidon | Verpol | Viclor Richet |
| Vicodin | Vicodin (Salt/Mix) | Vips |
| Viruflu | Vivimed | Volpan |
| WLN: QR DMV1 | Wygesic | Wygesic (Salt/Mix) |
| ZINC13550868 | Zatinol | Zolben |
| Zydone (Salt/Mix) | acetaminophen | acetaminophene |
| acetaminophenol | acetominophene | alpha-Per |
| component of Dialog | component of Dilone | component of Endecon |
| component of Hycomine Compound | component of Percocet | component of Percogesic |
| component of Phenaphen | n-acetyl-4-hydroxyaniline | p-(Acetylamino)phenol |
| p-Acetamidophenol | p-Acetaminophenol | p-Acetoaminophen |
| p-Acetylaminophenol | p-Hydroxyacetanilide | p-Hydroxyphenolacetamide |
| p-hydroxy-acetanilid | p-hydroxyacetoanilide | para-acetylaminophenol |
| paracetamol (acetaminophen) | phenol derivative, 11 | to_000023 |
| DrugBank Name | Acetaminophen |
| DrugBank | DB00316 |
| CAS Number | 103-90-2, 147630-09-9, 1693-37-4, 24424-99-5, 39465-00-4, 64315-36-2, 8055-08-1 |
| PubChem Compound | 1983 |
| KEGG Compound ID | C06804 |
| KEGG Drug | D00217 |
| PubChem.Substance | 46506142 |
| ChEBI | 46195 |
| PharmGKB | PA448015 |
| ChemSpider | 1906 |
| BindingDB | 26197.0 |
| TTD | DAP001436 |
| Wikipedia | Acetaminophen |
| HET | TYL |
| DPD | 270 |