B
B02BA02 Menadione
[B02BA] Vitamin K
[B02B] VITAMIN K AND OTHER HEMOSTATICS
[B02] ANTIHEMORRHAGICS
[B] Blood and blood forming organs
Toxicity | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
---|---|---|---|---|---|---|---|---|
OPENING OF PERMEABILITY TRANSITION PORE (PTP) | increase | 35 | ||||||
UNCOUPLING | increase | 47 | ||||||
NONPROTONOPHORIC UNCOUPLERS | rat | liver mitochondria | RST assay( Respiratory Screening Technology)-measurement of oxygen consumption in isolated mitochondria using a phosphorescent oxygen-sensitive probe A65N-1 | increase | 204 | |||
REDOX CYCLING | 278 | |||||||
GLUCOSE GALACTOSE IC50 RATIO | 18.0 ± 7.2, 14.7 ± 7.9 ,1.2, 19.5 ± 8.3, 14.0 ± 8.7, 1.4 | 4hr | H9c2 cells | high-glucose–galactose cell viability assay with JC-1 mitochondrial membrane potential and ATP-depletion assays (CellTiter-Glo reagent ). | glucose/galactose IC50 ratio (JC-1 IC50 in glucose, JC-1 IC50 in galactose, JC-1 glu/gla, ATP IC50 in glucose, ATP IC50 in galactose, ATP glu/gla ) | 50 | ||
MITOCHONDRIAL MOTILITY | 10 μM | Time lapse fluorescence microscopy | decrease | 218 | ||||
OXIDATIVE STRESS | increase | 35 | ||||||
ROS PRODUCTION | 20 µM | 24hr | U2OS | mt-roGFP and mitoSOX | increase | 313 | ||
MITOCHONDRIAL DNA METABOLIC PROCESS | 6.0 μM | 1 hours | human | pFastBac | Meassurement of DNA polymerase gamma activity | affect | IC50 | 9 |
Target | Dose | Time | Species | Model | Method | Action | Positive criterion | Reference |
---|---|---|---|---|---|---|---|---|
DNA polymerase gamma | 6.0 μM | 1 hours | human | pFastBac | Meassurement of DNA polymerase gamma activity | not specified | IC50 | 9 |
Pictogram | Signal | Statements | Precautionary Statement Codes |
---|---|---|---|
![]() ![]() ![]() |
Warning |
Aggregated GHS information provided by 70 companies from 12 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. H302 (92.86%): Harmful if swallowed [Warning Acute toxicity, oral] H315 (87.14%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] H335 (95.71%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure Respiratory tract irritation] H341 (12.86%): Suspected of causing genetic defects [Warning Germ cell mutagenicity] H361 (12.86%): Suspected of damaging fertility or the unborn child [Warning Reproductive toxicity] H400 (21.43%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard] Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. |
P201, P202, P261, P264, P270, P271, P273, P280, P281, P301+P312, P302+P352, P304+P340, P305+P351+P338, P308+P313, P312, P321, P330, P332+P313, P337+P313, P362, P391, P403+P233, P405, and P501; (The corresponding statement to each P-code can be found at the GHS Classification page.) |
Organism | Test type | Route | Dose (normalized dose) | Effect | Source |
---|---|---|---|---|---|
mouse | LD50 | intraperitoneal | 15mg/kg (15mg/kg) | National Technical Information Service. Vol. AD691-490, | |
001M681 | 03AAE1E9-B215-45AF-976C-91E61894A467 | 1,4-Dihydro-2-methylnaphthalene-1,4-dione |
1,4-Naphthalenedione, 2-methyl- | 1,4-Naphthalenedione, 2-methyl-, radical ion(1-) | 1,4-Naphthoquinone, 2-methyl- |
2-METHYL-1,4-NAPHTHALENEDIONE | 2-Methyl-1,4-naftochinon | 2-Methyl-1,4-naftochinon [Czech] |
2-Methyl-1,4-naphthalendione | 2-Methyl-1,4-naphthalenedione | 2-Methyl-1,4-naphthochinon |
2-Methyl-1,4-naphthochinon [German] | 2-Methyl-1,4-naphthodione | 2-Methyl-1,4-naphthoquinone |
2-Methyl-1,4-naphthoquinone | 2-Methyl-1,4-naphthoquinone, 98% | 2-Methyl-[1,4]-naphthoquinone |
2-Methylnaphthoquinone | 2-methyl-1,4 naphthoquinone | 2-methyl-1,4-dihydronaphthalene-1,4-dione |
2-methyl-1,4-naphthoquinone, 5 | 2-methyl-1,4-napthoquinone | 2-methylnaphthalene-1,4-dione |
3-Methyl-1,4-naphthoquinone | 3-methyl-1,4-naphthalenedione | 34524-96-4 |
58-27-5 | 72060-21-0 | 723JX6CXY5 |
A831816 | AB2000387 | ACMC-1BCKI |
AI3-14700 | AKOS004910447 | AKOS025244105 |
ANW-32906 | ARONIS24154 | Aquakay |
Aquinone | BBL027351 | BB_NC-02319 |
BCP25699 | BDBM24778 | BENZOYL CHLORIDE,2,5-DIHYDROXY- |
BG0249 | BIDD:ER0556 | BPBio1_000592 |
BRD-K78126613-001-16-0 | BSPBio_000538 | Bio1_000471 |
Bio1_000960 | Bio1_001449 | C-24481 |
C05377 | C11H8O2 | CAS-58-27-5 |
CC-30201 | CCG-35354 | CCRIS 6672 |
CHEBI:28869 | CHEMBL590 | CS-2374 |
CTK5A8103 | Certified Reference Material | D02335 |
DB00170 | DSSTox_CID_1715 | DSSTox_GSID_21715 |
DSSTox_RID_76289 | DTXSID4021715 | DivK1c_000080 |
DivK1c_006287 | EINECS 200-372-6 | FCH1114831 |
FS-2556 | FT-0612893 | H500 |
HMS1569K20 | HMS1921P06 | HMS2092F12 |
HMS2096K20 | HMS2232A09 | HMS2234J16 |
HMS3371M08 | HMS3373A12 | HMS3655P03 |
HMS500D22 | HSDB 3354 | HY-B0332 |
Hemodal | IDI1_000080 | InChI=1/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H |
Juva-K | K-Thrombyl | K-Vitan |
KBio1_000080 | KBio1_001231 | KBio2_001708 |
KBio2_002527 | KBio2_004276 | KBio2_005095 |
KBio2_006844 | KBio2_007663 | KBio3_003005 |
KBioGR_000984 | KBioGR_002527 | KBioSS_001708 |
KBioSS_002535 | KS-00000C40 | KSC608C0H |
Kaergona | Kanone | Kappaxan (VAN) |
Kappaxin | Kappaxin (TN) | Karcon |
Kareon | Kativ-G | Kayklot |
Kaykot | Kaynone | Kayquinone |
Kipca | Kipca, oil soluble | Kipca-Oil Soluble |
Klottone | Koaxin | Kolklot |
LS-95653 | LS-95654 | M0373 |
MCULE-2487773379 | MFCD00001681 | MFCD00001681 (97+%) |
MJVAVZPDRWSRRC-UHFFFAOYSA-N | MLS000069420 | MLS001148443 |
MNQ | Memodol | Menadion |
Menadione (K3), analytical standard | Menadione (USP) | Menadione (Vitamin K3) |
Menadione [USAN:BAN] | Menadione [USP:BAN] | Menadione semiquinone |
Menadione, 9 | Menadione, 98% | Menadione, European Pharmacopoeia (EP) Reference Standard |
Menadione, Pharmaceutical Secondary Standard | Menadione, United States Pharmacopeia (USP) Reference Standard | Menadione, crystalline |
Menadione, meets USP testing specifications | Menadione,(S) | Menadionum |
Menaphthene | Menaphthon | Menaphthone |
Menaphthone | Menaphtone | Menaquinone 0 |
Menaquinone O | Mendione | Methyl-1,4-naphthalenedione |
Methyl-1,4-naphthoquinone | Methylnaphthoquinone | Mitenon |
Mitenone | NAPHTHOQUINONE, METHYL- | NCGC00016258-01 |
NCGC00016258-02 | NCGC00016258-03 | NCGC00016258-04 |
NCGC00016258-06 | NCGC00016258-07 | NCGC00016258-08 |
NCGC00094978-01 | NCGC00094978-02 | NCGC00255225-01 |
NCI60_003945 | NCIMech_000105 | NINDS_000080 |
NSC 4170 | NSC-4170 | NSC-758200 |
NSC4170 | NSC758200 | Opera_ID_1802 |
Panosine | Pharmakon1600-01502254 | Prestwick0_000459 |
Prestwick1_000459 | Prestwick2_000459 | Prestwick3_000459 |
Prestwick_313 | Prokayvit | PubChem14596 |
Q-201350 | Q192471 | QTL1_000056 |
RTR-037165 | SB17255 | SBB012369 |
SBI-0051776.P002 | SC-16348 | SC-61015 |
SCHEMBL25970 | SMR000059102 | SMR000653532 |
SPBio_001267 | SPBio_002477 | SPECTRUM1502254 |
SR-01000712386 | SR-01000712386-2 | SR-01000712386-5 |
SR-01000712386-6 | ST066885 | STL377874 |
STR01143 | SW219798-1 | SY018303 |
SpecPlus_000191 | Spectrum2_001194 | Spectrum4_000722 |
Spectrum5_001764 | Spectrum_001228 | Synkay |
TR-037165 | TRA0064327 | Thyloquinone |
Tox21_110334 | Tox21_110334_1 | Tox21_301367 |
UNII-723JX6CXY5 | Usaf ek-5185 | VITAMIN K3 |
VK3 | Vicasol | Vitamin K 3 |
Vitamin K0 | Vitamin K2(0) | Vitamin K3 |
Vitamin K3 | Vitamin K3: 1,4-Dihydro-1,4-dioxo-2-methylnaphthalene | WLN: L66 BV EVJ C1 |
Z-3172 | ZINC1677 | ZX-AS004517 |
ZX-AT006056 | cMAP_000077 | cid_4055 |
menadione | s1949 |
DrugBank Name | Menadione |
DrugBank | DB00170 |
CAS Number | 12001-79-5, 130-37-0, 21715-15-1, 34524-96-4, 57414-02-5, 58-27-5, 72060-21-0 |
PubChem Compound | 4055 |
KEGG Compound ID | C05377 |
KEGG Drug | D02335 |
PubChem.Substance | 46505447 |
ChEBI | 28869 |
PharmGKB | PA450358 |
ChemSpider | 3915 |
BindingDB | 24778.0 |
TTD | DNC001501 |
Wikipedia | Menadione |
HET | VK3 |
DPD | 4913 |